Difference between revisions of "Tiso gene 12200"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7247 CPD-7247] == * smiles: ** CC(C=CC1(C(CCCC=1C)(C)C))=CC=CC(CCO)C * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_12200 == * right end position: ** 4113 * transcription direction: ** POSITIVE * left end position: ** 327 * centisome position: ** 4.526578...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12200 == |
− | * | + | * right end position: |
− | ** | + | ** 4113 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 327 |
− | * | + | * centisome position: |
− | ** | + | ** 4.526578 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.1.1.39-RXN]] | |
− | * [[1. | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[MALIC-NADP-RXN]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[OXALODECARB-RXN]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-3641]] | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[PWY-7384]] | ||
+ | * [[P184-PWY]] | ||
+ | * [[METHYLGALLATE-DEGRADATION-PWY]] | ||
+ | * [[PWY-7686]] | ||
+ | * [[PWY-7117]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[PWY-7118]] | ||
+ | * [[PWY-241]] | ||
+ | * [[PWY-6339]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4113}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=327}} | |
− | + | {{#set: centisome position=4.526578 }} | |
− | + | {{#set: reaction associated=1.1.1.39-RXN|MALIC-NADP-RXN|OXALODECARB-RXN}} | |
− | + | {{#set: pathway associated=PWY-3641|GLUCONEO-PWY|PWY-7384|P184-PWY|METHYLGALLATE-DEGRADATION-PWY|PWY-7686|PWY-7117|PWY-7115|PWY-7118|PWY-241|PWY-6339}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_12200
- right end position:
- 4113
- transcription direction:
- POSITIVE
- left end position:
- 327
- centisome position:
- 4.526578
- Synonym(s):
Reactions associated
- Reaction: 1.1.1.39-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: MALIC-NADP-RXN
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Reaction: OXALODECARB-RXN
- Source: orthology-esiliculosus
Pathways associated
- PWY-3641
- GLUCONEO-PWY
- PWY-7384
- P184-PWY
- METHYLGALLATE-DEGRADATION-PWY
- PWY-7686
- PWY-7117
- PWY-7115
- PWY-7118
- PWY-241
- PWY-6339