|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RNA-DIRECTED-DNA-POLYMERASE-RXN RNA-DIRECTED-DNA-POLYMERASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] |
| * common name: | | * common name: |
− | ** tick_transposon | + | ** (R)-mevalonate diphosphate |
− | ** pol-like_protein
| + | * inchi key: |
− | ** ORF | + | ** InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J |
− | ** polyprotein | + | * molecular weight: |
− | ** astrotactin-2-_partial
| + | ** 304.087 |
− | * ec number: | + | |
− | ** [http://enzyme.expasy.org/EC/2.7.7.49 EC-2.7.7.49] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** mevalonate-5-PP |
| + | ** (R)-5-diphosphomevalonate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] |
− | ** 1 [[DNA-N]][c] '''+''' 1 [[Deoxy-Ribonucleoside-Triphosphates]][c] '''<=>''' 1 [[DNA-N]][c] '''+''' 1 [[PPI]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 DNAn[c] '''+''' 1 a 2'-deoxyribonucleoside 5'-triphosphate[c] '''<=>''' 1 DNAn[c] '''+''' 1 diphosphate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_9299]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_19787]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_13149]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_16363]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_17913]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_12839]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_11396]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_16466]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_10914]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_13740]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_20543]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_2320]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_6741]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_13368]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_17558]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_1846]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * CAS : 4872-34-8 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00379 R00379]
| + | * PUBCHEM: |
− | * UNIPROT: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916915 24916915] |
− | ** [http://www.uniprot.org/uniprot/P03364 P03364] | + | * HMDB : HMDB01090 |
− | ** [http://www.uniprot.org/uniprot/P03365 P03365]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q53751 Q53751]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57557 57557] |
− | ** [http://www.uniprot.org/uniprot/P31795 P31795] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q9WJH6 Q9WJH6] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01143 C01143] |
− | ** [http://www.uniprot.org/uniprot/Q99B21 Q99B21] | + | {{#set: smiles=CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]}} |
− | ** [http://www.uniprot.org/uniprot/Q90J60 Q90J60]
| + | {{#set: common name=(R)-mevalonate diphosphate}} |
− | ** [http://www.uniprot.org/uniprot/Q90IY3 Q90IY3]
| + | {{#set: inchi key=InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J}} |
− | ** [http://www.uniprot.org/uniprot/Q90GL4 Q90GL4] | + | {{#set: molecular weight=304.087 }} |
− | ** [http://www.uniprot.org/uniprot/Q90GG6 Q90GG6] | + | {{#set: common name=mevalonate-5-PP|(R)-5-diphosphomevalonate}} |
− | ** [http://www.uniprot.org/uniprot/Q90D85 Q90D85]
| + | {{#set: consumed by=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q76441 Q76441]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGG1 Q9IGG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B98 Q99B98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B34 Q99B34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AW0 Q99AW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JS5 Q90JS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HY3 Q90HY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H27 Q90H27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J778 Q8J778]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI1 Q9WJI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ9 Q9WFQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V1 Q9J4V1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B31 Q99B31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S71 Q90S71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RR9 Q90RR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QH9 Q90QH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX7 Q90MX7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J92 Q90J92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IZ6 Q90IZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I72 Q90I72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GZ1 Q90GZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q115 Q8Q115]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KY7 Q90KY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI2 Q9WJI2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL9 Q9WFL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5M9 Q9J5M9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ47 Q9DZ47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B94 Q99B94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B22 Q99B22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S80 Q90S80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H63 Q90H63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F70 Q90F70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904Q2 Q904Q2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEF0 Q8JEF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEE4 Q8JEE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYX2 Q9DYX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B33 Q99B33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AW1 Q99AW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RR2 Q90RR2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L13 Q90L13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HP6 Q90HP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCQ7 Q8QCQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92065 O92065]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEE5 Q8JEE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN10 Q9IN10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RP1 Q90RP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L05 Q90L05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FR4 Q90FR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904Q3 Q904Q3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKY2 Q8UKY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71145 Q71145]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEE1 Q8JEE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92898 O92898]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJF0 Q9WJF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPL0 Q9DPL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B89 Q99B89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IE0 Q90IE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UTW0 Q8UTW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD61 Q8QD61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72552 Q72552]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72548 Q72548]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92078 O92078]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEE0 Q8JEE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WEZ4 Q9WEZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99BA6 Q99BA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B25 Q99B25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B20 Q99B20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RR1 Q90RR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JZ4 Q90JZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GF2 Q90GF2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EW5 Q90EW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71151 Q71151]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71147 Q71147]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93176 O93176]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B90 Q99B90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B26 Q99B26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B18 Q99B18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AW5 Q99AW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72550 Q72550]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72549 Q72549]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71157 Q71157]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92879 O92879]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WEZ2 Q9WEZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B32 Q99B32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RQ8 Q90RQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JF8 Q90JF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J47 Q90J47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6P5 Q8J6P5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CH2 Q90CH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPJ5 Q9DPJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99BA5 Q99BA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B92 Q99B92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B88 Q99B88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B39 Q99B39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B37 Q99B37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S72 Q90S72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RR3 Q90RR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KV7 Q90KV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JZ0 Q90JZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JG3 Q90JG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904H7 Q904H7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URS5 Q8URS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL35 Q8UL35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD56 Q8QD56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEF1 Q8JEF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4U8 Q9J4U8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ94 Q9DZ94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYX5 Q9DYX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B99 Q99B99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B28 Q99B28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B27 Q99B27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AW4 Q99AW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S78 Q90S78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S74 Q90S74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S70 Q90S70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MT4 Q90MT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JV9 Q90JV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HP5 Q90HP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEG0 Q8JEG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WQ94 Q9WQ94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5R1 Q9J5R1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S75 Q90S75]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HP7 Q90HP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GY1 Q90GY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72554 Q72554]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WQ84 Q9WQ84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V3 Q9J4V3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V0 Q9J4V0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4U9 Q9J4U9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B93 Q99B93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S81 Q90S81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RQ9 Q90RQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KR8 Q90KR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FX2 Q90FX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90E01 Q90E01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD62 Q8QD62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7C2 Q8J7C2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6S2 Q8J6S2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71159 Q71159]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71155 Q71155]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJH1 Q9WJH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5R2 Q9J5R2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z74 Q98Z74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S76 Q90S76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QF3 Q90QF3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KS1 Q90KS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ1 Q90IJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FA0 Q90FA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F97 Q90F97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EW8 Q90EW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD09 Q8QD09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6H3 Q8J6H3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72551 Q72551]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92076 O92076]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AW3 Q99AW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QF5 Q90QF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M58 Q90M58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GX6 Q90GX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GP6 Q90GP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B23 Q99B23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S84 Q90S84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RR0 Q90RR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RN9 Q90RN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HG4 Q90HG4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GV5 Q90GV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EY4 Q90EY4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ18 Q9DZ18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99BA7 Q99BA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99BA1 Q99BA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B35 Q99B35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AW7 Q99AW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IH9 Q90IH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FM4 Q90FM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DB4 Q90DB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92892 O92892]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIK8 Q9QIK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN09 Q9IN09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B97 Q99B97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B40 Q99B40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AW6 Q99AW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T45 Q90T45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S77 Q90S77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RQ7 Q90RQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KG3 Q90KG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J28 Q90J28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEE6 Q8JEE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92884 O92884]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B36 Q99B36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J79 Q90J79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IU9 Q90IU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H96 Q90H96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG3 Q90FG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JED9 Q8JED9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK2 Q9WFK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFJ9 Q9WFJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGG7 Q9IGG7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99BA0 Q99BA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B96 Q99B96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98WR2 Q98WR2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JJ7 Q90JJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I99 Q90I99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904H3 Q904H3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72553 Q72553]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71153 Q71153]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36554 O36554]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q7Z7 Q8Q7Z7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92894 O92894]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ5 Q9WFQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B30 Q99B30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B19 Q99B19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AV9 Q99AV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AV8 Q99AV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KC0 Q90KC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IZ4 Q90IZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F84 Q90F84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DQ33 Q9DQ33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI0 Q9WJI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ09 Q9DZ09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B38 Q99B38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J95 Q90J95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IY6 Q90IY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IM4 Q90IM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZD7 Q9DZD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V2 Q9J4V2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA0 Q90NA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N67 Q90N67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N27 Q90N27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV1 Q90MV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJH2 Q9WJH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGF7 Q9IGF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B95 Q99B95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AW8 Q99AW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GH7 Q90GH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PXX2 Q9PXX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99BA3 Q99BA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99BA2 Q99BA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RR7 Q90RR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K91 Q90K91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FR0 Q90FR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D6 Q8J7D6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGB3 Q9IGB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99AV7 Q99AV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S73 Q90S73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HS1 Q90HS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEE3 Q8JEE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WQ85 Q9WQ85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5X1 Q9E5X1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B91 Q99B91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B29 Q99B29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99B24 Q99B24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RR8 Q90RR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N89 Q90N89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD65 Q8QD65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71149 Q71149]
| + | |
− | ** [http://www.uniprot.org/uniprot/O42078 O42078]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W888 Q9W888]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YP28 Q9YP28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJW8 Q9WJW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJW3 Q9WJW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJW0 Q9WJW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJV7 Q9WJV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJV3 Q9WJV3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJV0 Q9WJV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJU6 Q9WJU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72987 Q72987]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72979 Q72979]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP4 Q8QCP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G84 Q90G84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIJ5 Q9QIJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCQ3 Q8QCQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP7 Q8QCP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY2 Q90MY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IU3 Q90IU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6W8 Q8J6W8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G89 Q90G89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ1 Q9WFQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q6W3 Q9Q6W3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JAC7 Q9JAC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J0H1 Q9J0H1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN25 Q9IN25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN24 Q9IN24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN22 Q9IN22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN21 Q9IN21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IMZ9 Q9IMZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IBN9 Q9IBN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E536 Q9E536]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E531 Q9E531]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E529 Q9E529]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E525 Q9E525]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E521 Q9E521]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E515 Q9E515]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E511 Q9E511]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E507 Q9E507]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DLF9 Q9DLF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DLF8 Q9DLF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DLF7 Q9DLF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q994K8 Q994K8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90PT9 Q90PT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MM9 Q90MM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MM0 Q90MM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ML1 Q90ML1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DE1 Q90DE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CJ5 Q90CJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q908N7 Q908N7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q908M8 Q908M8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q908L9 Q908L9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q908L0 Q908L0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q908K1 Q908K1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q908J2 Q908J2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q908I3 Q908I3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Y4 Q902Y4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902U8 Q902U8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902T9 Q902T9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902T0 Q902T0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902S1 Q902S1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902R2 Q902R2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Q3 Q902Q3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902P4 Q902P4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902N0 Q902N0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902M0 Q902M0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902L1 Q902L1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902J9 Q902J9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902J0 Q902J0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902I1 Q902I1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902H2 Q902H2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UPR1 Q8UPR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q79792 Q79792]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q77691 Q77691]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75755 Q75755]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q74835 Q74835]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q74807 Q74807]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q74596 Q74596]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q74085 Q74085]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q73368 Q73368]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72498 Q72498]
| + | |
− | ** [http://www.uniprot.org/uniprot/P89972 P89972]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93086 O93086]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93021 O93021]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92939 O92939]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92936 O92936]
| + | |
− | ** [http://www.uniprot.org/uniprot/O90289 O90289]
| + | |
− | ** [http://www.uniprot.org/uniprot/O90173 O90173]
| + | |
− | ** [http://www.uniprot.org/uniprot/O89294 O89294]
| + | |
− | ** [http://www.uniprot.org/uniprot/O40216 O40216]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YQW3 Q9YQW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YQW2 Q9YQW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YQS3 Q9YQS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YLQ2 Q9YLQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WQ96 Q9WQ96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WQ93 Q9WQ93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WQ88 Q9WQ88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WQ87 Q9WQ87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL8 Q9WKL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL7 Q9WKL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL6 Q9WKL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL5 Q9WKL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL4 Q9WKL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL3 Q9WKL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL2 Q9WKL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL1 Q9WKL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKL0 Q9WKL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK9 Q9WKK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK8 Q9WKK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK7 Q9WKK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK6 Q9WKK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK5 Q9WKK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK4 Q9WKK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK3 Q9WKK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK2 Q9WKK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK1 Q9WKK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKK0 Q9WKK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ9 Q9WKJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ8 Q9WKJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ6 Q9WKJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ5 Q9WKJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ4 Q9WKJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ3 Q9WKJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ2 Q9WKJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ1 Q9WKJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ0 Q9WKJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKI9 Q9WKI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKI8 Q9WKI8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKI7 Q9WKI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKI6 Q9WKI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKI1 Q9WKI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKI0 Q9WKI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKH9 Q9WKH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKH8 Q9WKH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKH6 Q9WKH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKE8 Q9WKE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKD7 Q9WKD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKB2 Q9WKB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKB0 Q9WKB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKA9 Q9WKA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKA8 Q9WKA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKA7 Q9WKA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK29 Q9WK29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK28 Q9WK28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK27 Q9WK27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK26 Q9WK26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK25 Q9WK25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK24 Q9WK24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK23 Q9WK23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK22 Q9WK22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK21 Q9WK21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK20 Q9WK20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK19 Q9WK19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK18 Q9WK18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK17 Q9WK17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK16 Q9WK16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK15 Q9WK15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK14 Q9WK14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK13 Q9WK13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK12 Q9WK12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WK11 Q9WK11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJQ6 Q9WJQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJQ5 Q9WJQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJQ4 Q9WJQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJQ3 Q9WJQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJQ2 Q9WJQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJQ0 Q9WJQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJP9 Q9WJP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJK4 Q9WJK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJK3 Q9WJK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJK2 Q9WJK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJK1 Q9WJK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJJ9 Q9WJJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJJ2 Q9WJJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJJ0 Q9WJJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI9 Q9WJI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI8 Q9WJI8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI7 Q9WJI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI6 Q9WJI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI5 Q9WJI5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI4 Q9WJI4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJI3 Q9WJI3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJH9 Q9WJH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJH7 Q9WJH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJF6 Q9WJF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFR0 Q9WFR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ8 Q9WFQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ7 Q9WFQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ6 Q9WFQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ4 Q9WFQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ3 Q9WFQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ0 Q9WFQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFP8 Q9WFP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFP7 Q9WFP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFP6 Q9WFP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFP5 Q9WFP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFP3 Q9WFP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFP2 Q9WFP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFP1 Q9WFP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFP0 Q9WFP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN9 Q9WFN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN8 Q9WFN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN6 Q9WFN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN5 Q9WFN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN4 Q9WFN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN3 Q9WFN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN2 Q9WFN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN1 Q9WFN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFN0 Q9WFN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM9 Q9WFM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM8 Q9WFM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM6 Q9WFM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM5 Q9WFM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM4 Q9WFM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM2 Q9WFM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM1 Q9WFM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM0 Q9WFM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL8 Q9WFL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL7 Q9WFL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL6 Q9WFL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL5 Q9WFL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL4 Q9WFL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL3 Q9WFL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL2 Q9WFL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL0 Q9WFL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK9 Q9WFK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK8 Q9WFK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK7 Q9WFK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK6 Q9WFK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK5 Q9WFK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK4 Q9WFK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK1 Q9WFK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFK0 Q9WFK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFJ8 Q9WFJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFJ6 Q9WFJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFJ4 Q9WFJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFJ3 Q9WFJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFJ0 Q9WFJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WF00 Q9WF00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WEZ9 Q9WEZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WEZ8 Q9WEZ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WEZ3 Q9WEZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBX5 Q9WBX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBX4 Q9WBX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBX3 Q9WBX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBX2 Q9WBX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBW6 Q9WBW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBW3 Q9WBW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBW2 Q9WBW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBW0 Q9WBW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBV6 Q9WBV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W9T0 Q9W9T0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W9J4 Q9W9J4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W8P8 Q9W8P8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W8M4 Q9W8M4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W8D0 Q9W8D0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W8A4 Q9W8A4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQX4 Q9QQX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQX3 Q9QQX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQW8 Q9QQW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQW7 Q9QQW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQW4 Q9QQW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQW3 Q9QQW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQW2 Q9QQW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQW1 Q9QQW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQV9 Q9QQV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQV8 Q9QQV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQV7 Q9QQV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQV1 Q9QQV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQU9 Q9QQU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQU6 Q9QQU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQU0 Q9QQU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLX1 Q9QLX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLW2 Q9QLW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLV6 Q9QLV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLV5 Q9QLV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLV3 Q9QLV3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLV1 Q9QLV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLU4 Q9QLU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLU3 Q9QLU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLT4 Q9QLT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLT3 Q9QLT3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLT2 Q9QLT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLS3 Q9QLS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLS0 Q9QLS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJB3 Q9QJB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJB1 Q9QJB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJB0 Q9QJB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJA8 Q9QJA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJA6 Q9QJA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJA3 Q9QJA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ99 Q9QJ99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ95 Q9QJ95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ90 Q9QJ90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ88 Q9QJ88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ85 Q9QJ85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ83 Q9QJ83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ81 Q9QJ81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ79 Q9QJ79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ78 Q9QJ78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ77 Q9QJ77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ73 Q9QJ73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ72 Q9QJ72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ71 Q9QJ71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ68 Q9QJ68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ67 Q9QJ67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ66 Q9QJ66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ63 Q9QJ63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ62 Q9QJ62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIQ7 Q9QIQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIP3 Q9QIP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIN7 Q9QIN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIN4 Q9QIN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIN2 Q9QIN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIN1 Q9QIN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIM9 Q9QIM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIM0 Q9QIM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIL2 Q9QIL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIK3 Q9QIK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QII9 Q9QII9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEQ5 Q9QEQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEP8 Q9QEP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEP7 Q9QEP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEP5 Q9QEP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEN9 Q9QEN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEN2 Q9QEN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEM8 Q9QEM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEM7 Q9QEM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEM4 Q9QEM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEM0 Q9QEM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEL9 Q9QEL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEL8 Q9QEL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QCY2 Q9QCY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q3C4 Q9Q3C4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q3C0 Q9Q3C0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q3B8 Q9Q3B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q3B4 Q9Q3B4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q3B2 Q9Q3B2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q396 Q9Q396]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q394 Q9Q394]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q382 Q9Q382]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q378 Q9Q378]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q362 Q9Q362]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q356 Q9Q356]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q344 Q9Q344]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q342 Q9Q342]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q340 Q9Q340]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q338 Q9Q338]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q336 Q9Q336]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q332 Q9Q332]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q330 Q9Q330]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q324 Q9Q324]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q322 Q9Q322]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q320 Q9Q320]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q318 Q9Q318]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q2Z8 Q9Q2Z8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q2Z6 Q9Q2Z6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q2Z4 Q9Q2Z4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q2Z2 Q9Q2Z2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PXX1 Q9PXX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J8Q0 Q9J8Q0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J6K3 Q9J6K3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J6K0 Q9J6K0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J6I9 Q9J6I9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J6I7 Q9J6I7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5R0 Q9J5R0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5Q9 Q9J5Q9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5Q0 Q9J5Q0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5P1 Q9J5P1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5N0 Q9J5N0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5M5 Q9J5M5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5L9 Q9J5L9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4Z1 Q9J4Z1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4Y8 Q9J4Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4Y5 Q9J4Y5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4X7 Q9J4X7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4X2 Q9J4X2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4W9 Q9J4W9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4W8 Q9J4W8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4W5 Q9J4W5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4W4 Q9J4W4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4W3 Q9J4W3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4W1 Q9J4W1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V9 Q9J4V9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V8 Q9J4V8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V7 Q9J4V7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V6 Q9J4V6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4V4 Q9J4V4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IZZ7 Q9IZZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IZ72 Q9IZ72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IXN8 Q9IXN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IXN6 Q9IXN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVD9 Q9IVD9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVD7 Q9IVD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVD3 Q9IVD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVD0 Q9IVD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVC9 Q9IVC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVC8 Q9IVC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVC5 Q9IVC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVC4 Q9IVC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVC2 Q9IVC2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVB4 Q9IVB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVB0 Q9IVB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVA9 Q9IVA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN35 Q9IN35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN34 Q9IN34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN33 Q9IN33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN32 Q9IN32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN31 Q9IN31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN29 Q9IN29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN27 Q9IN27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN26 Q9IN26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN23 Q9IN23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN20 Q9IN20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN18 Q9IN18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN17 Q9IN17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN16 Q9IN16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN15 Q9IN15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN14 Q9IN14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN13 Q9IN13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN12 Q9IN12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN11 Q9IN11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN08 Q9IN08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN07 Q9IN07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IM80 Q9IM80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IM79 Q9IM79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IM76 Q9IM76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGK3 Q9IGK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGJ3 Q9IGJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGI1 Q9IGI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGH7 Q9IGH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGF2 Q9IGF2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGD4 Q9IGD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGC5 Q9IGC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGC4 Q9IGC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGB5 Q9IGB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGB1 Q9IGB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDL7 Q9IDL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDJ4 Q9IDJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDI9 Q9IDI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDI7 Q9IDI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDI4 Q9IDI4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDF3 Q9IDF3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDF2 Q9IDF2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDF1 Q9IDF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDF0 Q9IDF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDE1 Q9IDE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDB8 Q9IDB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDB6 Q9IDB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDB5 Q9IDB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDB4 Q9IDB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDB2 Q9IDB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDB1 Q9IDB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDB0 Q9IDB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDA9 Q9IDA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ID80 Q9ID80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ID62 Q9ID62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EN96 Q9EN96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5Y3 Q9E5Y3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5X6 Q9E5X6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5W5 Q9E5W5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5W4 Q9E5W4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5U9 Q9E5U9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5T7 Q9E5T7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5G9 Q9E5G9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5G8 Q9E5G8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5G7 Q9E5G7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E583 Q9E583]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E581 Q9E581]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E580 Q9E580]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E579 Q9E579]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E578 Q9E578]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E577 Q9E577]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E576 Q9E576]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E575 Q9E575]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E573 Q9E573]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E571 Q9E571]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E562 Q9E562]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E561 Q9E561]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E560 Q9E560]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E559 Q9E559]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E558 Q9E558]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E557 Q9E557]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E556 Q9E556]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E554 Q9E554]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E553 Q9E553]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E552 Q9E552]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E550 Q9E550]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E410 Q9E410]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E409 Q9E409]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E406 Q9E406]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E405 Q9E405]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E404 Q9E404]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E403 Q9E403]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Z9 Q9E3Z9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Z4 Q9E3Z4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Z3 Q9E3Z3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Z2 Q9E3Z2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Z1 Q9E3Z1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Z0 Q9E3Z0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Y8 Q9E3Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Y7 Q9E3Y7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Y6 Q9E3Y6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E360 Q9E360]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E359 Q9E359]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E358 Q9E358]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E357 Q9E357]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E356 Q9E356]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E355 Q9E355]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E354 Q9E354]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E346 Q9E346]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E345 Q9E345]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E344 Q9E344]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E343 Q9E343]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZE2 Q9DZE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZE1 Q9DZE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZD9 Q9DZD9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZD8 Q9DZD8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZD1 Q9DZD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZC3 Q9DZC3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZC2 Q9DZC2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZC1 Q9DZC1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZC0 Q9DZC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZB9 Q9DZB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZB6 Q9DZB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZB5 Q9DZB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZB3 Q9DZB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZB0 Q9DZB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZA3 Q9DZA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ97 Q9DZ97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ89 Q9DZ89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ86 Q9DZ86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ83 Q9DZ83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ77 Q9DZ77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ74 Q9DZ74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ71 Q9DZ71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ68 Q9DZ68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ65 Q9DZ65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ62 Q9DZ62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ59 Q9DZ59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ56 Q9DZ56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ53 Q9DZ53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ50 Q9DZ50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ44 Q9DZ44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ41 Q9DZ41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ34 Q9DZ34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ27 Q9DZ27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ24 Q9DZ24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ21 Q9DZ21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ15 Q9DZ15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ12 Q9DZ12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ06 Q9DZ06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ03 Q9DZ03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ00 Q9DZ00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYZ7 Q9DYZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYZ5 Q9DYZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYZ2 Q9DYZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYY9 Q9DYY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYY6 Q9DYY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYY4 Q9DYY4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYY1 Q9DYY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYX8 Q9DYX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYW9 Q9DYW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYW6 Q9DYW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYW0 Q9DYW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYV7 Q9DYV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYV0 Q9DYV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYT9 Q9DYT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYT6 Q9DYT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYS9 Q9DYS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYS2 Q9DYS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYR9 Q9DYR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYQ0 Q9DYQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYP8 Q9DYP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYP6 Q9DYP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYP4 Q9DYP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYP2 Q9DYP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYP0 Q9DYP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYN8 Q9DYN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYN6 Q9DYN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYN4 Q9DYN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYN2 Q9DYN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYN0 Q9DYN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYM8 Q9DYM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYM7 Q9DYM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYM5 Q9DYM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYM4 Q9DYM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYM2 Q9DYM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYM0 Q9DYM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYL8 Q9DYL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYL6 Q9DYL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYL4 Q9DYL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYL2 Q9DYL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYL0 Q9DYL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DYK8 Q9DYK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DS15 Q9DS15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DS14 Q9DS14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DS13 Q9DS13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DS12 Q9DS12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPL1 Q9DPL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPK8 Q9DPK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPK7 Q9DPK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPK6 Q9DPK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPJ6 Q9DPJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPJ4 Q9DPJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPJ3 Q9DPJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPJ2 Q9DPJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPJ0 Q9DPJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPI7 Q9DPI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPI6 Q9DPI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPH8 Q9DPH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPH7 Q9DPH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPH6 Q9DPH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPE1 Q9DPE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPE0 Q9DPE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FH4 Q99FH4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FH3 Q99FH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FH1 Q99FH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FH0 Q99FH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG9 Q99FG9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG8 Q99FG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG7 Q99FG7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG6 Q99FG6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG5 Q99FG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG3 Q99FG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG2 Q99FG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG1 Q99FG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG0 Q99FG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF9 Q99FF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF8 Q99FF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF7 Q99FF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF6 Q99FF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF5 Q99FF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF4 Q99FF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF3 Q99FF3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF1 Q99FF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FF0 Q99FF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE9 Q99FE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE8 Q99FE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE7 Q99FE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE5 Q99FE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE4 Q99FE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE3 Q99FE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE2 Q99FE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE1 Q99FE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FE0 Q99FE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD8 Q99FD8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD7 Q99FD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD6 Q99FD6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD5 Q99FD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD4 Q99FD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD3 Q99FD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD2 Q99FD2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD1 Q99FD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FD0 Q99FD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FC9 Q99FC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FC8 Q99FC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FC6 Q99FC6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FC5 Q99FC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FC4 Q99FC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FC2 Q99FC2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FC1 Q99FC1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FC0 Q99FC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB9 Q99FB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB7 Q99FB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB6 Q99FB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB5 Q99FB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB4 Q99FB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB3 Q99FB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB2 Q99FB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB1 Q99FB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FB0 Q99FB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FA9 Q99FA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FA8 Q99FA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FA7 Q99FA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FA6 Q99FA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FA4 Q99FA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FA3 Q99FA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FA1 Q99FA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FA0 Q99FA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F99 Q99F99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F98 Q99F98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F97 Q99F97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F96 Q99F96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F95 Q99F95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F94 Q99F94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F93 Q99F93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F92 Q99F92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F90 Q99F90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F89 Q99F89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F88 Q99F88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F87 Q99F87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F86 Q99F86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F85 Q99F85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F84 Q99F84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F83 Q99F83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F82 Q99F82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F81 Q99F81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F78 Q99F78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F77 Q99F77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F76 Q99F76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F74 Q99F74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99EW3 Q99EW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99ES9 Q99ES9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99DN8 Q99DN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99DN7 Q99DN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999S9 Q999S9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999S4 Q999S4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999S1 Q999S1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999R9 Q999R9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999R8 Q999R8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999R5 Q999R5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999R2 Q999R2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999R1 Q999R1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999R0 Q999R0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999Q8 Q999Q8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999H1 Q999H1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999H0 Q999H0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999G9 Q999G9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999G8 Q999G8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999G7 Q999G7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999G6 Q999G6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999G2 Q999G2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999F8 Q999F8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999F6 Q999F6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999F5 Q999F5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999F2 Q999F2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999F1 Q999F1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999E9 Q999E9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999E8 Q999E8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999E7 Q999E7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999E6 Q999E6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999E2 Q999E2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999E0 Q999E0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999D9 Q999D9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999D8 Q999D8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999D7 Q999D7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999D6 Q999D6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999D4 Q999D4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999D0 Q999D0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999C9 Q999C9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q993R9 Q993R9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992M3 Q992M3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992E7 Q992E7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992E3 Q992E3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992D6 Q992D6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992D4 Q992D4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992D1 Q992D1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992D0 Q992D0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992C9 Q992C9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992B8 Q992B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992B4 Q992B4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992B2 Q992B2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992A4 Q992A4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992A3 Q992A3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992A1 Q992A1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q991Z9 Q991Z9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q991N0 Q991N0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q991M9 Q991M9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZJ6 Q98ZJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZH5 Q98ZH5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZG8 Q98ZG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZF4 Q98ZF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZE9 Q98ZE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZC7 Q98ZC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZB4 Q98ZB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZB3 Q98ZB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZB2 Q98ZB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZB1 Q98ZB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZA5 Q98ZA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z81 Q98Z81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z63 Q98Z63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z59 Q98Z59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z58 Q98Z58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z53 Q98Z53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z50 Q98Z50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z47 Q98Z47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z44 Q98Z44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z43 Q98Z43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z36 Q98Z36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z29 Q98Z29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z28 Q98Z28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z21 Q98Z21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z10 Q98Z10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YP2 Q98YP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YK0 Q98YK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YJ4 Q98YJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YE4 Q98YE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YE2 Q98YE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YD5 Q98YD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YD2 Q98YD2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YB6 Q98YB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YA8 Q98YA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YA3 Q98YA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Y91 Q98Y91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Y89 Q98Y89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98WQ6 Q98WQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98WQ1 Q98WQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90U66 Q90U66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90TA4 Q90TA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T97 Q90T97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T95 Q90T95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T84 Q90T84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T81 Q90T81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T79 Q90T79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T76 Q90T76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T75 Q90T75]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T74 Q90T74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T73 Q90T73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T71 Q90T71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T70 Q90T70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T68 Q90T68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T67 Q90T67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T62 Q90T62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T60 Q90T60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T57 Q90T57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T56 Q90T56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T55 Q90T55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T54 Q90T54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T53 Q90T53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T52 Q90T52]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T49 Q90T49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T46 Q90T46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T44 Q90T44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T43 Q90T43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T40 Q90T40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T39 Q90T39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T38 Q90T38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T35 Q90T35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T33 Q90T33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T32 Q90T32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T31 Q90T31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T30 Q90T30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T29 Q90T29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T28 Q90T28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T26 Q90T26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T24 Q90T24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T23 Q90T23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T22 Q90T22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T19 Q90T19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T18 Q90T18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T13 Q90T13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T12 Q90T12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T11 Q90T11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T10 Q90T10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T09 Q90T09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T08 Q90T08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T05 Q90T05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T04 Q90T04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T03 Q90T03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T01 Q90T01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T00 Q90T00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SZ7 Q90SZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SZ6 Q90SZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SZ2 Q90SZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SZ1 Q90SZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SY8 Q90SY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SY6 Q90SY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SY5 Q90SY5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SY3 Q90SY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SY2 Q90SY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SY1 Q90SY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SY0 Q90SY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SX9 Q90SX9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SX8 Q90SX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SX6 Q90SX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SX4 Q90SX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SX3 Q90SX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SX2 Q90SX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SW5 Q90SW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SW4 Q90SW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SW3 Q90SW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SW2 Q90SW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SW0 Q90SW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SV9 Q90SV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SV8 Q90SV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SV6 Q90SV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SV5 Q90SV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SV4 Q90SV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SV3 Q90SV3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SV2 Q90SV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SU8 Q90SU8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SU7 Q90SU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SU6 Q90SU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SU3 Q90SU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ST9 Q90ST9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ST8 Q90ST8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ST7 Q90ST7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ST4 Q90ST4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ST2 Q90ST2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ST0 Q90ST0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SS7 Q90SS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SS6 Q90SS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SS3 Q90SS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SR6 Q90SR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SR5 Q90SR5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SQ5 Q90SQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SQ4 Q90SQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SQ2 Q90SQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SQ0 Q90SQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SP8 Q90SP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SP0 Q90SP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SN8 Q90SN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SN7 Q90SN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SN4 Q90SN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SN2 Q90SN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SN0 Q90SN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SM8 Q90SM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S06 Q90S06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S05 Q90S05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S01 Q90S01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90S00 Q90S00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RZ9 Q90RZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RZ8 Q90RZ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RZ7 Q90RZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RZ6 Q90RZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RZ5 Q90RZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RZ4 Q90RZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RZ3 Q90RZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RZ0 Q90RZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RY9 Q90RY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RY8 Q90RY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RY7 Q90RY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RY6 Q90RY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RY3 Q90RY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RY2 Q90RY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RY1 Q90RY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RY0 Q90RY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RX9 Q90RX9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RU4 Q90RU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RN1 Q90RN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RN0 Q90RN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RM9 Q90RM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RM8 Q90RM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RM7 Q90RM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RM6 Q90RM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QJ1 Q90QJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QH3 Q90QH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QH1 Q90QH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QG9 Q90QG9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QG5 Q90QG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QF7 Q90QF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QF1 Q90QF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QE9 Q90QE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QE6 Q90QE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QD8 Q90QD8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QC8 Q90QC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QC4 Q90QC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QC0 Q90QC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QB8 Q90QB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QB6 Q90QB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ND5 Q90ND5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ND4 Q90ND4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ND2 Q90ND2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ND1 Q90ND1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NC9 Q90NC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NC8 Q90NC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NC6 Q90NC6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NC5 Q90NC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NC4 Q90NC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NC3 Q90NC3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NC0 Q90NC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB9 Q90NB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB8 Q90NB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB7 Q90NB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB6 Q90NB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB5 Q90NB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB3 Q90NB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB2 Q90NB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB1 Q90NB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NB0 Q90NB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA9 Q90NA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA8 Q90NA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA7 Q90NA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA6 Q90NA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA5 Q90NA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA4 Q90NA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA3 Q90NA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA2 Q90NA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NA1 Q90NA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N98 Q90N98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N96 Q90N96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N95 Q90N95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N94 Q90N94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N93 Q90N93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N92 Q90N92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N91 Q90N91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N90 Q90N90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N88 Q90N88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N87 Q90N87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N86 Q90N86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N85 Q90N85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N84 Q90N84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N81 Q90N81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N80 Q90N80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N79 Q90N79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N78 Q90N78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N77 Q90N77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N76 Q90N76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N75 Q90N75]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N73 Q90N73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N72 Q90N72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N70 Q90N70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N69 Q90N69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N68 Q90N68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N66 Q90N66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N65 Q90N65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N64 Q90N64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N63 Q90N63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N62 Q90N62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N61 Q90N61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N60 Q90N60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N59 Q90N59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N58 Q90N58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N57 Q90N57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N56 Q90N56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N55 Q90N55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N54 Q90N54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N53 Q90N53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N51 Q90N51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N50 Q90N50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N49 Q90N49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N48 Q90N48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N45 Q90N45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N42 Q90N42]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N41 Q90N41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N40 Q90N40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N39 Q90N39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N38 Q90N38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N36 Q90N36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N35 Q90N35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N31 Q90N31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N30 Q90N30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N29 Q90N29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N28 Q90N28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N26 Q90N26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N25 Q90N25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N24 Q90N24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N23 Q90N23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N22 Q90N22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N20 Q90N20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N19 Q90N19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N18 Q90N18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N17 Q90N17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N16 Q90N16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N15 Q90N15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N14 Q90N14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N13 Q90N13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N12 Q90N12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N11 Q90N11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N10 Q90N10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N09 Q90N09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N07 Q90N07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N04 Q90N04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N03 Q90N03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N01 Q90N01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N00 Q90N00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ9 Q90MZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ8 Q90MZ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ7 Q90MZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ6 Q90MZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ5 Q90MZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ4 Q90MZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ3 Q90MZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ2 Q90MZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ1 Q90MZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MZ0 Q90MZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY9 Q90MY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY8 Q90MY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY5 Q90MY5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY4 Q90MY4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY3 Q90MY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY1 Q90MY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY0 Q90MY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX9 Q90MX9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX8 Q90MX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX6 Q90MX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX5 Q90MX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX4 Q90MX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX3 Q90MX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX1 Q90MX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX0 Q90MX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW9 Q90MW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW8 Q90MW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW6 Q90MW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW5 Q90MW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW4 Q90MW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW2 Q90MW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW0 Q90MW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV9 Q90MV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV8 Q90MV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV7 Q90MV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV6 Q90MV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV5 Q90MV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV4 Q90MV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV3 Q90MV3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV2 Q90MV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MV0 Q90MV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU9 Q90MU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU8 Q90MU8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU7 Q90MU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU5 Q90MU5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU4 Q90MU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU3 Q90MU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU2 Q90MU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU1 Q90MU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MU0 Q90MU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MT9 Q90MT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MT7 Q90MT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MT5 Q90MT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MB0 Q90MB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MA9 Q90MA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MA6 Q90MA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MA5 Q90MA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MA3 Q90MA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MA2 Q90MA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MA1 Q90MA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M99 Q90M99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M98 Q90M98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M96 Q90M96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M94 Q90M94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M93 Q90M93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M92 Q90M92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M90 Q90M90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M89 Q90M89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M88 Q90M88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M87 Q90M87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M85 Q90M85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M81 Q90M81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M79 Q90M79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M77 Q90M77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M76 Q90M76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M75 Q90M75]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M73 Q90M73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M71 Q90M71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M69 Q90M69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M67 Q90M67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M66 Q90M66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M65 Q90M65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M64 Q90M64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M63 Q90M63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M62 Q90M62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M61 Q90M61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M59 Q90M59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M57 Q90M57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M54 Q90M54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M53 Q90M53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M52 Q90M52]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M51 Q90M51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M48 Q90M48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M43 Q90M43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M41 Q90M41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M40 Q90M40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M39 Q90M39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M38 Q90M38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M37 Q90M37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M36 Q90M36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M35 Q90M35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M34 Q90M34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M33 Q90M33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M32 Q90M32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M31 Q90M31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT9 Q90LT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT8 Q90LT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT7 Q90LT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT3 Q90LT3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT2 Q90LT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT1 Q90LT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT0 Q90LT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LS8 Q90LS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LS6 Q90LS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LS3 Q90LS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LS1 Q90LS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR8 Q90LR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR7 Q90LR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR6 Q90LR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR5 Q90LR5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR4 Q90LR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR3 Q90LR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR2 Q90LR2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR1 Q90LR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR0 Q90LR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ9 Q90LQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ8 Q90LQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ7 Q90LQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ6 Q90LQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ5 Q90LQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ4 Q90LQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ3 Q90LQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ2 Q90LQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ1 Q90LQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LQ0 Q90LQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LP9 Q90LP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LP8 Q90LP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LP7 Q90LP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LP6 Q90LP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LP5 Q90LP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LP2 Q90LP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LP1 Q90LP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LP0 Q90LP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LN9 Q90LN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LN8 Q90LN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LN7 Q90LN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LN5 Q90LN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LN4 Q90LN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LN1 Q90LN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LN0 Q90LN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LM9 Q90LM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LM8 Q90LM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LM6 Q90LM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LM5 Q90LM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LM4 Q90LM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LM3 Q90LM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LM2 Q90LM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LM0 Q90LM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL9 Q90LL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL8 Q90LL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL7 Q90LL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL6 Q90LL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL5 Q90LL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL4 Q90LL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL3 Q90LL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL2 Q90LL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL1 Q90LL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LL0 Q90LL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK8 Q90LK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK7 Q90LK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK6 Q90LK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK5 Q90LK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK4 Q90LK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK3 Q90LK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK2 Q90LK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK1 Q90LK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LK0 Q90LK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ9 Q90LJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ8 Q90LJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ7 Q90LJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ5 Q90LJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ4 Q90LJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ3 Q90LJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ2 Q90LJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ1 Q90LJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LJ0 Q90LJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI9 Q90LI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI8 Q90LI8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI7 Q90LI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI4 Q90LI4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI3 Q90LI3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI2 Q90LI2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI1 Q90LI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI0 Q90LI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH9 Q90LH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH8 Q90LH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH7 Q90LH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH6 Q90LH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH5 Q90LH5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH3 Q90LH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH2 Q90LH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH1 Q90LH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LG3 Q90LG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LF2 Q90LF2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LF1 Q90LF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE8 Q90LE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE7 Q90LE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE6 Q90LE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE5 Q90LE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE3 Q90LE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE2 Q90LE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE1 Q90LE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE0 Q90LE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD9 Q90LD9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD7 Q90LD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD6 Q90LD6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD5 Q90LD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD4 Q90LD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD3 Q90LD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD2 Q90LD2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD1 Q90LD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LD0 Q90LD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LC9 Q90LC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LC8 Q90LC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LC7 Q90LC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LC1 Q90LC1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LB7 Q90LB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LB4 Q90LB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LB3 Q90LB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LA1 Q90LA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LA0 Q90LA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L99 Q90L99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L72 Q90L72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L71 Q90L71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L70 Q90L70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L69 Q90L69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L67 Q90L67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L66 Q90L66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L65 Q90L65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L63 Q90L63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L62 Q90L62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L57 Q90L57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L55 Q90L55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L45 Q90L45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L43 Q90L43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L37 Q90L37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L36 Q90L36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L34 Q90L34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L32 Q90L32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L30 Q90L30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L28 Q90L28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L26 Q90L26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L22 Q90L22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L19 Q90L19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L17 Q90L17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L12 Q90L12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L09 Q90L09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L06 Q90L06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KZ8 Q90KZ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KZ5 Q90KZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KZ3 Q90KZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KZ1 Q90KZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KZ0 Q90KZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KY8 Q90KY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KY2 Q90KY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KX6 Q90KX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KX5 Q90KX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KW9 Q90KW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KW6 Q90KW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KW3 Q90KW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KW0 Q90KW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KV4 Q90KV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KV2 Q90KV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KV1 Q90KV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KU3 Q90KU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KU0 Q90KU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KT8 Q90KT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KT5 Q90KT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KT4 Q90KT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KS8 Q90KS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KS7 Q90KS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KS5 Q90KS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KS4 Q90KS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KR7 Q90KR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KR4 Q90KR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KR3 Q90KR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KR0 Q90KR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KQ7 Q90KQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KQ0 Q90KQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KP9 Q90KP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KP8 Q90KP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KP0 Q90KP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KN9 Q90KN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KN6 Q90KN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KN5 Q90KN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KN4 Q90KN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KN1 Q90KN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KN0 Q90KN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KM6 Q90KM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KM3 Q90KM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KM1 Q90KM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KL1 Q90KL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KK7 Q90KK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KK2 Q90KK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KK1 Q90KK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KI6 Q90KI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KI4 Q90KI4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KI0 Q90KI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KH8 Q90KH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KH7 Q90KH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KH6 Q90KH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KH2 Q90KH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KH1 Q90KH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KH0 Q90KH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KG2 Q90KG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KG0 Q90KG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KF9 Q90KF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KF8 Q90KF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KF7 Q90KF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KF4 Q90KF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KE9 Q90KE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KE8 Q90KE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KE2 Q90KE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KE1 Q90KE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KE0 Q90KE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KD9 Q90KD9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KD3 Q90KD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KD1 Q90KD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KD0 Q90KD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KC9 Q90KC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KC5 Q90KC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KC2 Q90KC2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KB7 Q90KB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KB6 Q90KB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KB5 Q90KB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KB4 Q90KB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KB3 Q90KB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KB2 Q90KB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KA8 Q90KA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KA7 Q90KA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KA6 Q90KA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KA1 Q90KA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K97 Q90K97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K90 Q90K90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K87 Q90K87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K86 Q90K86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K85 Q90K85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K83 Q90K83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K81 Q90K81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K80 Q90K80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K75 Q90K75]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K67 Q90K67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K66 Q90K66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K61 Q90K61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K60 Q90K60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K58 Q90K58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K56 Q90K56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K55 Q90K55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K51 Q90K51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K50 Q90K50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K41 Q90K41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K38 Q90K38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K35 Q90K35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K32 Q90K32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K28 Q90K28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K23 Q90K23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K21 Q90K21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K20 Q90K20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K16 Q90K16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K15 Q90K15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K12 Q90K12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K07 Q90K07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K03 Q90K03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JZ9 Q90JZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JZ3 Q90JZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JZ2 Q90JZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JZ1 Q90JZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JY7 Q90JY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JY6 Q90JY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JY2 Q90JY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JX9 Q90JX9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JX6 Q90JX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JX2 Q90JX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JX1 Q90JX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JW6 Q90JW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JW5 Q90JW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JW4 Q90JW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JW3 Q90JW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JW0 Q90JW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JV8 Q90JV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JV6 Q90JV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JV1 Q90JV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JU9 Q90JU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JU3 Q90JU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JU2 Q90JU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JT6 Q90JT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JT4 Q90JT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JT2 Q90JT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JS8 Q90JS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JS7 Q90JS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JS1 Q90JS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JS0 Q90JS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JR9 Q90JR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JR8 Q90JR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JR6 Q90JR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JR1 Q90JR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JR0 Q90JR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JQ7 Q90JQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JP7 Q90JP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JP6 Q90JP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JP5 Q90JP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JP4 Q90JP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JP3 Q90JP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JP0 Q90JP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JN8 Q90JN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JN6 Q90JN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JN4 Q90JN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JN3 Q90JN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JM6 Q90JM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JM5 Q90JM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JM4 Q90JM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JM1 Q90JM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JM0 Q90JM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JL6 Q90JL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JL5 Q90JL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JL4 Q90JL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JL1 Q90JL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JK8 Q90JK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JK3 Q90JK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JK2 Q90JK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JK1 Q90JK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JJ5 Q90JJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JJ3 Q90JJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JI6 Q90JI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JI5 Q90JI5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JI1 Q90JI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JH8 Q90JH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JH4 Q90JH4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JH1 Q90JH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JH0 Q90JH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JG2 Q90JG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JF9 Q90JF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JF7 Q90JF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JF5 Q90JF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JF0 Q90JF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JE7 Q90JE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JE6 Q90JE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JE4 Q90JE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JE3 Q90JE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JE2 Q90JE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JE0 Q90JE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JD8 Q90JD8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JD5 Q90JD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JD4 Q90JD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JD2 Q90JD2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JC8 Q90JC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JC7 Q90JC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JC5 Q90JC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JC3 Q90JC3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JC0 Q90JC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JB8 Q90JB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JB6 Q90JB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JB3 Q90JB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JB2 Q90JB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JB1 Q90JB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JA9 Q90JA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JA6 Q90JA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JA2 Q90JA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JA0 Q90JA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J96 Q90J96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J91 Q90J91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J89 Q90J89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J87 Q90J87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J82 Q90J82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J81 Q90J81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J80 Q90J80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J78 Q90J78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J70 Q90J70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J69 Q90J69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J66 Q90J66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J65 Q90J65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J64 Q90J64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J62 Q90J62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J59 Q90J59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J58 Q90J58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J57 Q90J57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J56 Q90J56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J55 Q90J55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J54 Q90J54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J46 Q90J46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J41 Q90J41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J39 Q90J39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J35 Q90J35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J33 Q90J33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J32 Q90J32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J27 Q90J27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J26 Q90J26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J21 Q90J21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J19 Q90J19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J16 Q90J16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J15 Q90J15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J14 Q90J14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J12 Q90J12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J11 Q90J11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J03 Q90J03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J02 Q90J02]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J00 Q90J00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IZ9 Q90IZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IZ2 Q90IZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IY8 Q90IY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IY4 Q90IY4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IY2 Q90IY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IY1 Q90IY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IX6 Q90IX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IX3 Q90IX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IW4 Q90IW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IW2 Q90IW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IW0 Q90IW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IV9 Q90IV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IV7 Q90IV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IV6 Q90IV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IV1 Q90IV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IV0 Q90IV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IU4 Q90IU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IU2 Q90IU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IT9 Q90IT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IT8 Q90IT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IT7 Q90IT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IT2 Q90IT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IT1 Q90IT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IT0 Q90IT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IS9 Q90IS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IS8 Q90IS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IS7 Q90IS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IS6 Q90IS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IS4 Q90IS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IS3 Q90IS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IS1 Q90IS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IS0 Q90IS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IR9 Q90IR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IR8 Q90IR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IR7 Q90IR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IR2 Q90IR2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IQ9 Q90IQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IQ8 Q90IQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IQ7 Q90IQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IQ6 Q90IQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IQ4 Q90IQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IP9 Q90IP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IP7 Q90IP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IP4 Q90IP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IP0 Q90IP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IN4 Q90IN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IN2 Q90IN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IN1 Q90IN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IN0 Q90IN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IM8 Q90IM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IM6 Q90IM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IM5 Q90IM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IM3 Q90IM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IM2 Q90IM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IL9 Q90IL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IL8 Q90IL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IL4 Q90IL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IL3 Q90IL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IL0 Q90IL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IK6 Q90IK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IK5 Q90IK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IK0 Q90IK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ9 Q90IJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ8 Q90IJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ7 Q90IJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ6 Q90IJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ5 Q90IJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ3 Q90IJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ2 Q90IJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90II9 Q90II9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90II4 Q90II4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90II3 Q90II3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90II1 Q90II1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IH8 Q90IH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IH7 Q90IH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IH6 Q90IH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IH2 Q90IH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IG9 Q90IG9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IG8 Q90IG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IG4 Q90IG4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IF6 Q90IF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IF1 Q90IF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IF0 Q90IF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IE9 Q90IE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IE6 Q90IE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IE5 Q90IE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IE4 Q90IE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IE2 Q90IE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ID9 Q90ID9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ID8 Q90ID8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ID6 Q90ID6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ID4 Q90ID4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ID2 Q90ID2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IC8 Q90IC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IC6 Q90IC6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IB9 Q90IB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IB8 Q90IB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IB7 Q90IB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IB6 Q90IB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IB0 Q90IB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IA7 Q90IA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IA5 Q90IA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IA2 Q90IA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IA1 Q90IA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I97 Q90I97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I95 Q90I95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I91 Q90I91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I88 Q90I88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I87 Q90I87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I84 Q90I84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I81 Q90I81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I80 Q90I80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I79 Q90I79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I78 Q90I78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I77 Q90I77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I74 Q90I74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I71 Q90I71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I69 Q90I69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I68 Q90I68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I66 Q90I66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I64 Q90I64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I63 Q90I63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I61 Q90I61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I58 Q90I58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I57 Q90I57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I56 Q90I56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I54 Q90I54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I51 Q90I51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I50 Q90I50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I46 Q90I46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I44 Q90I44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I42 Q90I42]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I40 Q90I40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I39 Q90I39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I37 Q90I37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I36 Q90I36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I34 Q90I34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I33 Q90I33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I32 Q90I32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I30 Q90I30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I28 Q90I28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I27 Q90I27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I25 Q90I25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I21 Q90I21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I20 Q90I20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I19 Q90I19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I14 Q90I14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I13 Q90I13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I11 Q90I11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I10 Q90I10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I05 Q90I05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I04 Q90I04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I01 Q90I01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I00 Q90I00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HZ9 Q90HZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HZ6 Q90HZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HZ4 Q90HZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HZ2 Q90HZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HZ1 Q90HZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HZ0 Q90HZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HY6 Q90HY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HY1 Q90HY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HY0 Q90HY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HX9 Q90HX9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HX5 Q90HX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HX2 Q90HX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HX1 Q90HX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HX0 Q90HX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HW9 Q90HW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HW4 Q90HW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HV8 Q90HV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HV5 Q90HV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HV4 Q90HV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HU7 Q90HU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HU3 Q90HU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HT8 Q90HT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HT6 Q90HT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HT4 Q90HT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HT2 Q90HT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HS6 Q90HS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HS0 Q90HS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HR7 Q90HR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HR4 Q90HR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HQ4 Q90HQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HQ3 Q90HQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HP8 Q90HP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HP4 Q90HP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HP3 Q90HP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HP2 Q90HP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HP1 Q90HP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HN9 Q90HN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HN2 Q90HN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HN1 Q90HN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HM9 Q90HM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HM8 Q90HM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HM6 Q90HM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HM4 Q90HM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HM0 Q90HM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HL6 Q90HL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HL5 Q90HL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HL2 Q90HL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HL1 Q90HL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HK9 Q90HK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HK3 Q90HK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HK2 Q90HK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HK0 Q90HK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HJ9 Q90HJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HJ8 Q90HJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HJ7 Q90HJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HJ4 Q90HJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HJ3 Q90HJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HJ2 Q90HJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HJ0 Q90HJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HI6 Q90HI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HI5 Q90HI5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HI4 Q90HI4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HI3 Q90HI3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HI2 Q90HI2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HI1 Q90HI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HH8 Q90HH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HH0 Q90HH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HG8 Q90HG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HG6 Q90HG6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HG5 Q90HG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HG0 Q90HG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HF9 Q90HF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HF6 Q90HF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HF5 Q90HF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HF4 Q90HF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HE8 Q90HE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HE7 Q90HE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HE3 Q90HE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HD7 Q90HD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HD4 Q90HD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HD3 Q90HD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HD1 Q90HD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HC9 Q90HC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HC5 Q90HC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HC4 Q90HC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HC1 Q90HC1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HC0 Q90HC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HB8 Q90HB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HB5 Q90HB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HB2 Q90HB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HB0 Q90HB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HA9 Q90HA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HA4 Q90HA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HA3 Q90HA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HA0 Q90HA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H99 Q90H99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H94 Q90H94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H90 Q90H90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H89 Q90H89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H86 Q90H86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H84 Q90H84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H79 Q90H79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H78 Q90H78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H75 Q90H75]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H73 Q90H73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H72 Q90H72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H70 Q90H70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H67 Q90H67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H66 Q90H66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H64 Q90H64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H62 Q90H62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H61 Q90H61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H60 Q90H60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H55 Q90H55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H54 Q90H54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H48 Q90H48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H46 Q90H46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H45 Q90H45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H41 Q90H41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H37 Q90H37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H36 Q90H36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H35 Q90H35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H30 Q90H30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H29 Q90H29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H26 Q90H26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H25 Q90H25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H23 Q90H23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H21 Q90H21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H19 Q90H19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H17 Q90H17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H12 Q90H12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H07 Q90H07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H06 Q90H06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GZ7 Q90GZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GZ5 Q90GZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GZ4 Q90GZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GZ3 Q90GZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GY8 Q90GY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GY7 Q90GY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GY6 Q90GY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GY3 Q90GY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GX8 Q90GX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GX7 Q90GX7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GX5 Q90GX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GX4 Q90GX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GX1 Q90GX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GW9 Q90GW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GW6 Q90GW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GW4 Q90GW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GW3 Q90GW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GW1 Q90GW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GW0 Q90GW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GV7 Q90GV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GV6 Q90GV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GV0 Q90GV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GU6 Q90GU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GU3 Q90GU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GU0 Q90GU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GT9 Q90GT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GT8 Q90GT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GT7 Q90GT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GT6 Q90GT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GT3 Q90GT3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GT2 Q90GT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GT0 Q90GT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GS9 Q90GS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GS8 Q90GS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GS7 Q90GS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GS5 Q90GS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GS4 Q90GS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GS3 Q90GS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GR9 Q90GR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GR6 Q90GR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GR5 Q90GR5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GR4 Q90GR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GR3 Q90GR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GR1 Q90GR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GR0 Q90GR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GQ9 Q90GQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GQ8 Q90GQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GQ7 Q90GQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GQ3 Q90GQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GP7 Q90GP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GP5 Q90GP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GP4 Q90GP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GP1 Q90GP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN9 Q90GN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN8 Q90GN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN6 Q90GN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN5 Q90GN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN4 Q90GN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN3 Q90GN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN2 Q90GN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN0 Q90GN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GM7 Q90GM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GM4 Q90GM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GM3 Q90GM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GM2 Q90GM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GL8 Q90GL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GL6 Q90GL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GL2 Q90GL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GK7 Q90GK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GK4 Q90GK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GJ8 Q90GJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GJ7 Q90GJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GJ5 Q90GJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GJ1 Q90GJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GI9 Q90GI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GI8 Q90GI8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GI7 Q90GI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GI5 Q90GI5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GI0 Q90GI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GH8 Q90GH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GH0 Q90GH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GG5 Q90GG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GG4 Q90GG4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GG2 Q90GG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GG0 Q90GG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GF7 Q90GF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GF6 Q90GF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GF5 Q90GF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GF4 Q90GF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GF1 Q90GF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GF0 Q90GF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GE8 Q90GE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GE7 Q90GE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GE6 Q90GE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GE5 Q90GE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GE4 Q90GE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GE3 Q90GE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GD9 Q90GD9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GD7 Q90GD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GD3 Q90GD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GC7 Q90GC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GC4 Q90GC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GC3 Q90GC3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GC2 Q90GC2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GC0 Q90GC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GB9 Q90GB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GB4 Q90GB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GB3 Q90GB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GB2 Q90GB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GB0 Q90GB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GA9 Q90GA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GA8 Q90GA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GA6 Q90GA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GA3 Q90GA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GA0 Q90GA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G99 Q90G99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G97 Q90G97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G95 Q90G95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G88 Q90G88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G87 Q90G87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G86 Q90G86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G85 Q90G85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G80 Q90G80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G79 Q90G79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G76 Q90G76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G73 Q90G73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G70 Q90G70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G67 Q90G67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G62 Q90G62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G61 Q90G61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G56 Q90G56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G55 Q90G55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G50 Q90G50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G47 Q90G47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G46 Q90G46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G45 Q90G45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G44 Q90G44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G42 Q90G42]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G37 Q90G37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G36 Q90G36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G35 Q90G35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G34 Q90G34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G33 Q90G33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G31 Q90G31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G29 Q90G29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G26 Q90G26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G25 Q90G25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G24 Q90G24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G21 Q90G21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G20 Q90G20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G17 Q90G17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G16 Q90G16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G15 Q90G15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G13 Q90G13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G12 Q90G12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G10 Q90G10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G09 Q90G09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G07 Q90G07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G06 Q90G06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G03 Q90G03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G01 Q90G01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G00 Q90G00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FZ7 Q90FZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FZ6 Q90FZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FZ2 Q90FZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FY7 Q90FY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FY4 Q90FY4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FY2 Q90FY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FY1 Q90FY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FX9 Q90FX9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FX8 Q90FX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FX7 Q90FX7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FX6 Q90FX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FX1 Q90FX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FW8 Q90FW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FW6 Q90FW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FW5 Q90FW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FW4 Q90FW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FW3 Q90FW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FW1 Q90FW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FW0 Q90FW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FV9 Q90FV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FV8 Q90FV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FV7 Q90FV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FV6 Q90FV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FV5 Q90FV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FV4 Q90FV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FV2 Q90FV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FU9 Q90FU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FU6 Q90FU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FU5 Q90FU5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FU4 Q90FU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FU3 Q90FU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FT9 Q90FT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FT6 Q90FT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FT3 Q90FT3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FT0 Q90FT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FS9 Q90FS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FS8 Q90FS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FS6 Q90FS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FS5 Q90FS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FS4 Q90FS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FS3 Q90FS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FS1 Q90FS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FS0 Q90FS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FR9 Q90FR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FR8 Q90FR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FR7 Q90FR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FR5 Q90FR5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FR1 Q90FR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FQ6 Q90FQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FQ5 Q90FQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FQ4 Q90FQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FQ3 Q90FQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FQ2 Q90FQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FQ0 Q90FQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FP8 Q90FP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FP7 Q90FP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FP5 Q90FP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FP0 Q90FP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FN8 Q90FN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FN7 Q90FN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FN6 Q90FN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FN5 Q90FN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FN3 Q90FN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FN1 Q90FN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FM9 Q90FM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FM1 Q90FM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FL8 Q90FL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FL7 Q90FL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FL5 Q90FL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FL1 Q90FL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FK9 Q90FK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FK7 Q90FK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FK6 Q90FK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FK4 Q90FK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FK2 Q90FK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FK1 Q90FK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FK0 Q90FK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FJ9 Q90FJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FJ7 Q90FJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FJ3 Q90FJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FJ2 Q90FJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FJ1 Q90FJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FJ0 Q90FJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FI7 Q90FI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FI5 Q90FI5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FI4 Q90FI4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FI0 Q90FI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FH8 Q90FH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FH5 Q90FH5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FH2 Q90FH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG9 Q90FG9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG8 Q90FG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG7 Q90FG7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG6 Q90FG6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG5 Q90FG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG2 Q90FG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG1 Q90FG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FF8 Q90FF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FF1 Q90FF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FF0 Q90FF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FE6 Q90FE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FE4 Q90FE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FE3 Q90FE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FE2 Q90FE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FD9 Q90FD9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FD6 Q90FD6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FD5 Q90FD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FD4 Q90FD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FD1 Q90FD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FC5 Q90FC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FC4 Q90FC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FC2 Q90FC2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FB9 Q90FB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FB8 Q90FB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FB7 Q90FB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FB5 Q90FB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FB3 Q90FB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FB2 Q90FB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FB1 Q90FB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FA8 Q90FA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FA7 Q90FA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FA6 Q90FA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FA5 Q90FA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FA4 Q90FA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FA3 Q90FA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F99 Q90F99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F98 Q90F98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F95 Q90F95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F94 Q90F94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F93 Q90F93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F92 Q90F92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F90 Q90F90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F89 Q90F89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F88 Q90F88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F87 Q90F87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F83 Q90F83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F81 Q90F81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F79 Q90F79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F74 Q90F74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F72 Q90F72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F68 Q90F68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F64 Q90F64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F63 Q90F63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F62 Q90F62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F61 Q90F61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F60 Q90F60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F59 Q90F59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F57 Q90F57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F55 Q90F55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F53 Q90F53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F52 Q90F52]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F49 Q90F49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F48 Q90F48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F47 Q90F47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F45 Q90F45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F44 Q90F44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F43 Q90F43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F40 Q90F40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F39 Q90F39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F38 Q90F38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F36 Q90F36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F35 Q90F35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F32 Q90F32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F28 Q90F28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F24 Q90F24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F22 Q90F22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F21 Q90F21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F16 Q90F16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F15 Q90F15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F14 Q90F14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F13 Q90F13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F11 Q90F11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F10 Q90F10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F06 Q90F06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F05 Q90F05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F04 Q90F04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F03 Q90F03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EZ8 Q90EZ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EZ7 Q90EZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EZ6 Q90EZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EZ2 Q90EZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EZ1 Q90EZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EZ0 Q90EZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EY9 Q90EY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EY8 Q90EY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EY6 Q90EY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EY5 Q90EY5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EY2 Q90EY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EY1 Q90EY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EY0 Q90EY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DC4 Q90DC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DB1 Q90DB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DA6 Q90DA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D97 Q90D97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D96 Q90D96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D93 Q90D93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D92 Q90D92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D88 Q90D88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D86 Q90D86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D80 Q90D80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D76 Q90D76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D72 Q90D72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D69 Q90D69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D68 Q90D68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D67 Q90D67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D66 Q90D66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D65 Q90D65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D64 Q90D64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D61 Q90D61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D58 Q90D58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D57 Q90D57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D45 Q90D45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D41 Q90D41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D40 Q90D40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D39 Q90D39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D38 Q90D38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CT2 Q90CT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CT1 Q90CT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CS5 Q90CS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CS4 Q90CS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CS3 Q90CS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CM7 Q90CM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CM6 Q90CM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CM5 Q90CM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CM4 Q90CM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CM3 Q90CM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CM2 Q90CM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CM1 Q90CM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CM0 Q90CM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CL8 Q90CL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CL7 Q90CL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CL6 Q90CL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CL4 Q90CL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909T5 Q909T5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q905D2 Q905D2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q905D1 Q905D1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q905D0 Q905D0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q905C9 Q905C9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q905C8 Q905C8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904Z5 Q904Z5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904Z3 Q904Z3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904Y2 Q904Y2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904X5 Q904X5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904X0 Q904X0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904W8 Q904W8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904V7 Q904V7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904V0 Q904V0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904Q4 Q904Q4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904P8 Q904P8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904P2 Q904P2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904P0 Q904P0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904N9 Q904N9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904N0 Q904N0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904M9 Q904M9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904M4 Q904M4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904M1 Q904M1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904L1 Q904L1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904J4 Q904J4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904J0 Q904J0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904I4 Q904I4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904I0 Q904I0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904H6 Q904H6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904F9 Q904F9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904F2 Q904F2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904C8 Q904C8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904B2 Q904B2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903I1 Q903I1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903H4 Q903H4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903H1 Q903H1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903G8 Q903G8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903G7 Q903G7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903D4 Q903D4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903D3 Q903D3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903D0 Q903D0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C9 Q903C9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C8 Q903C8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C7 Q903C7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C6 Q903C6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C5 Q903C5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C4 Q903C4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C3 Q903C3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C2 Q903C2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903C1 Q903C1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B9 Q903B9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B8 Q903B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B7 Q903B7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B6 Q903B6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B5 Q903B5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B3 Q903B3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B2 Q903B2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B1 Q903B1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B0 Q903B0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A9 Q903A9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A8 Q903A8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A7 Q903A7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A6 Q903A6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A5 Q903A5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A4 Q903A4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A3 Q903A3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A1 Q903A1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A0 Q903A0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Z9 Q902Z9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Z4 Q902Z4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Z3 Q902Z3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Z2 Q902Z2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Z1 Q902Z1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Z0 Q902Z0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Y8 Q902Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Y7 Q902Y7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q902Y6 Q902Y6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8USR7 Q8USR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8USR6 Q8USR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8USQ9 Q8USQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US19 Q8US19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US18 Q8US18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US17 Q8US17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US16 Q8US16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US15 Q8US15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US14 Q8US14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US13 Q8US13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US12 Q8US12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US11 Q8US11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US10 Q8US10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US09 Q8US09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US08 Q8US08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US07 Q8US07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US06 Q8US06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US05 Q8US05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US04 Q8US04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US02 Q8US02]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US01 Q8US01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US00 Q8US00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ9 Q8URZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ8 Q8URZ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ6 Q8URZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ5 Q8URZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ4 Q8URZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ3 Q8URZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ2 Q8URZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ1 Q8URZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ0 Q8URZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URY9 Q8URY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URY8 Q8URY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URY7 Q8URY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV8 Q8URV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV7 Q8URV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV6 Q8URV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV5 Q8URV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV4 Q8URV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV3 Q8URV3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV2 Q8URV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV1 Q8URV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV0 Q8URV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU9 Q8URU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU8 Q8URU8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU7 Q8URU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU6 Q8URU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU5 Q8URU5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU4 Q8URU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU3 Q8URU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU2 Q8URU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU1 Q8URU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URU0 Q8URU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URT9 Q8URT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URT8 Q8URT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URT7 Q8URT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URS4 Q8URS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URS3 Q8URS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URS2 Q8URS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URS1 Q8URS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UMJ4 Q8UMJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UMJ2 Q8UMJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UM83 Q8UM83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UM79 Q8UM79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UM78 Q8UM78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UM74 Q8UM74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UM71 Q8UM71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UM69 Q8UM69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULT2 Q8ULT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULT1 Q8ULT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULT0 Q8ULT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS9 Q8ULS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS8 Q8ULS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS7 Q8ULS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS6 Q8ULS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS5 Q8ULS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS4 Q8ULS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS3 Q8ULS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS2 Q8ULS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS1 Q8ULS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULS0 Q8ULS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR9 Q8ULR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR8 Q8ULR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR7 Q8ULR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR6 Q8ULR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR5 Q8ULR5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR4 Q8ULR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR3 Q8ULR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR2 Q8ULR2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR1 Q8ULR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULR0 Q8ULR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULN7 Q8ULN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULN6 Q8ULN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULN5 Q8ULN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULN4 Q8ULN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULN3 Q8ULN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULN2 Q8ULN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULN1 Q8ULN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULN0 Q8ULN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM9 Q8ULM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM8 Q8ULM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM7 Q8ULM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM6 Q8ULM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM5 Q8ULM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM4 Q8ULM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM3 Q8ULM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM2 Q8ULM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM1 Q8ULM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULM0 Q8ULM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULL9 Q8ULL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULL8 Q8ULL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ULD4 Q8ULD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL45 Q8UL45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL44 Q8UL44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL43 Q8UL43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL41 Q8UL41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL39 Q8UL39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL38 Q8UL38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL37 Q8UL37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL36 Q8UL36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL33 Q8UL33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL32 Q8UL32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL31 Q8UL31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL30 Q8UL30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL24 Q8UL24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL19 Q8UL19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL14 Q8UL14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL12 Q8UL12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL11 Q8UL11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL08 Q8UL08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL05 Q8UL05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL04 Q8UL04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL03 Q8UL03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UL02 Q8UL02]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKZ7 Q8UKZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKZ4 Q8UKZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKZ3 Q8UKZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKZ2 Q8UKZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKZ1 Q8UKZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKZ0 Q8UKZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKY7 Q8UKY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKY6 Q8UKY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKY4 Q8UKY4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKY3 Q8UKY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKY1 Q8UKY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKY0 Q8UKY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKX8 Q8UKX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKX6 Q8UKX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKX5 Q8UKX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKW9 Q8UKW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKW8 Q8UKW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKW7 Q8UKW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKW0 Q8UKW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKV9 Q8UKV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKV7 Q8UKV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKV2 Q8UKV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKV1 Q8UKV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKV0 Q8UKV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKU9 Q8UKU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD63 Q8QD63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD58 Q8QD58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD57 Q8QD57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD47 Q8QD47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD46 Q8QD46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD45 Q8QD45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD44 Q8QD44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD42 Q8QD42]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD41 Q8QD41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD40 Q8QD40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD33 Q8QD33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD31 Q8QD31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD26 Q8QD26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD25 Q8QD25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD24 Q8QD24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD23 Q8QD23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD22 Q8QD22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD21 Q8QD21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD20 Q8QD20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD19 Q8QD19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD18 Q8QD18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD17 Q8QD17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD16 Q8QD16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD15 Q8QD15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD13 Q8QD13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD12 Q8QD12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD11 Q8QD11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD10 Q8QD10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCQ5 Q8QCQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCQ4 Q8QCQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCQ2 Q8QCQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCQ1 Q8QCQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCQ0 Q8QCQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP9 Q8QCP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP8 Q8QCP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP6 Q8QCP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP5 Q8QCP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP3 Q8QCP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCL3 Q8QCL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC99 Q8QC99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC93 Q8QC93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC92 Q8QC92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC91 Q8QC91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC90 Q8QC90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC89 Q8QC89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC88 Q8QC88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC87 Q8QC87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC86 Q8QC86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC84 Q8QC84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC83 Q8QC83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC73 Q8QC73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC70 Q8QC70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC69 Q8QC69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC64 Q8QC64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC59 Q8QC59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC57 Q8QC57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC54 Q8QC54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC52 Q8QC52]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC49 Q8QC49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC47 Q8QC47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QC44 Q8QC44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBS0 Q8QBS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBR4 Q8QBR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBR0 Q8QBR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBQ9 Q8QBQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBQ6 Q8QBQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBQ4 Q8QBQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBQ3 Q8QBQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBQ2 Q8QBQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBQ1 Q8QBQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP9 Q8QBP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP8 Q8QBP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP7 Q8QBP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP5 Q8QBP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP3 Q8QBP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP2 Q8QBP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP1 Q8QBP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP0 Q8QBP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN9 Q8QBN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN8 Q8QBN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN7 Q8QBN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN6 Q8QBN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN5 Q8QBN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN3 Q8QBN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN2 Q8QBN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN1 Q8QBN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN0 Q8QBN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM9 Q8QBM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM7 Q8QBM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM6 Q8QBM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM5 Q8QBM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM4 Q8QBM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM3 Q8QBM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM2 Q8QBM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM1 Q8QBM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBM0 Q8QBM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBE9 Q8QBE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB55 Q8QB55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB54 Q8QB54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB53 Q8QB53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB52 Q8QB52]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB51 Q8QB51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB50 Q8QB50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB49 Q8QB49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB48 Q8QB48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB47 Q8QB47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB46 Q8QB46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB45 Q8QB45]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB44 Q8QB44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB43 Q8QB43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB42 Q8QB42]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB41 Q8QB41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB40 Q8QB40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB39 Q8QB39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB38 Q8QB38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB37 Q8QB37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB36 Q8QB36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB35 Q8QB35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB34 Q8QB34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB33 Q8QB33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB32 Q8QB32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB31 Q8QB31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB30 Q8QB30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB29 Q8QB29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB28 Q8QB28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB27 Q8QB27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB26 Q8QB26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB25 Q8QB25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB24 Q8QB24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB23 Q8QB23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB22 Q8QB22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB21 Q8QB21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB20 Q8QB20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB18 Q8QB18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB17 Q8QB17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB16 Q8QB16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB14 Q8QB14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB13 Q8QB13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB12 Q8QB12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB11 Q8QB11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB10 Q8QB10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB09 Q8QB09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB08 Q8QB08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB07 Q8QB07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB06 Q8QB06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR9 Q8QAR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR8 Q8QAR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR7 Q8QAR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR6 Q8QAR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR5 Q8QAR5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR1 Q8QAR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ9 Q8QAQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ7 Q8QAQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ2 Q8QAQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ0 Q8QAQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAP7 Q8QAP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAP6 Q8QAP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAP5 Q8QAP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAN3 Q8QAN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAN2 Q8QAN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAN0 Q8QAN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA95 Q8QA95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA94 Q8QA94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA93 Q8QA93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA92 Q8QA92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA91 Q8QA91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA90 Q8QA90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA89 Q8QA89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA88 Q8QA88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA87 Q8QA87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA86 Q8QA86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA85 Q8QA85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA84 Q8QA84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA83 Q8QA83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA82 Q8QA82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA81 Q8QA81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA80 Q8QA80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA79 Q8QA79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA78 Q8QA78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA76 Q8QA76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA75 Q8QA75]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA74 Q8QA74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA73 Q8QA73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA72 Q8QA72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA71 Q8QA71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA70 Q8QA70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA69 Q8QA69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA68 Q8QA68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA67 Q8QA67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA66 Q8QA66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA65 Q8QA65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA64 Q8QA64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA63 Q8QA63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA62 Q8QA62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA61 Q8QA61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA60 Q8QA60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA59 Q8QA59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA58 Q8QA58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA57 Q8QA57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA56 Q8QA56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA55 Q8QA55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA54 Q8QA54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA53 Q8QA53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA52 Q8QA52]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA51 Q8QA51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA50 Q8QA50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA49 Q8QA49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA48 Q8QA48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA47 Q8QA47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA46 Q8QA46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA44 Q8QA44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA43 Q8QA43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA42 Q8QA42]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA41 Q8QA41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA40 Q8QA40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA39 Q8QA39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA38 Q8QA38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA37 Q8QA37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA36 Q8QA36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA35 Q8QA35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA34 Q8QA34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA33 Q8QA33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA32 Q8QA32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA31 Q8QA31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA30 Q8QA30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA28 Q8QA28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA26 Q8QA26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA25 Q8QA25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA24 Q8QA24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9V2 Q8Q9V2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9V0 Q8Q9V0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9K2 Q8Q9K2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9K1 Q8Q9K1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9K0 Q8Q9K0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J9 Q8Q9J9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J8 Q8Q9J8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J7 Q8Q9J7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J6 Q8Q9J6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J5 Q8Q9J5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J4 Q8Q9J4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J2 Q8Q9J2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J1 Q8Q9J1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9J0 Q8Q9J0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9I9 Q8Q9I9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9I8 Q8Q9I8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9I7 Q8Q9I7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9I6 Q8Q9I6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9I5 Q8Q9I5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9I3 Q8Q9I3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9H6 Q8Q9H6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9H2 Q8Q9H2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q9H0 Q8Q9H0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q930 Q8Q930]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q929 Q8Q929]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q928 Q8Q928]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q926 Q8Q926]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q925 Q8Q925]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q924 Q8Q924]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q923 Q8Q923]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q922 Q8Q922]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q921 Q8Q921]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q920 Q8Q920]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q919 Q8Q919]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q918 Q8Q918]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q917 Q8Q917]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q916 Q8Q916]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q915 Q8Q915]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q914 Q8Q914]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q913 Q8Q913]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q912 Q8Q912]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q911 Q8Q911]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q910 Q8Q910]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q909 Q8Q909]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q908 Q8Q908]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q907 Q8Q907]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q906 Q8Q906]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q905 Q8Q905]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q904 Q8Q904]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q903 Q8Q903]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q902 Q8Q902]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q901 Q8Q901]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q900 Q8Q900]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z9 Q8Q8Z9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z8 Q8Q8Z8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z7 Q8Q8Z7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z6 Q8Q8Z6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z5 Q8Q8Z5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z4 Q8Q8Z4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z3 Q8Q8Z3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z2 Q8Q8Z2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z1 Q8Q8Z1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Z0 Q8Q8Z0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y9 Q8Q8Y9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y8 Q8Q8Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y6 Q8Q8Y6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y5 Q8Q8Y5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y4 Q8Q8Y4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y3 Q8Q8Y3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y2 Q8Q8Y2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y1 Q8Q8Y1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y0 Q8Q8Y0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X9 Q8Q8X9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X8 Q8Q8X8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X7 Q8Q8X7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X5 Q8Q8X5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X4 Q8Q8X4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X2 Q8Q8X2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8W9 Q8Q8W9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8W8 Q8Q8W8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8W6 Q8Q8W6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Q0 Q8Q8Q0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P9 Q8Q8P9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P8 Q8Q8P8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P7 Q8Q8P7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P6 Q8Q8P6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P5 Q8Q8P5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P4 Q8Q8P4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P3 Q8Q8P3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P2 Q8Q8P2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P1 Q8Q8P1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8P0 Q8Q8P0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8N9 Q8Q8N9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8N7 Q8Q8N7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8N3 Q8Q8N3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8N1 Q8Q8N1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8M1 Q8Q8M1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8M0 Q8Q8M0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L9 Q8Q8L9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L8 Q8Q8L8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L7 Q8Q8L7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L2 Q8Q8L2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L0 Q8Q8L0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8K9 Q8Q8K9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8K7 Q8Q8K7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8K6 Q8Q8K6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8K5 Q8Q8K5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8K4 Q8Q8K4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8J9 Q8Q8J9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8J8 Q8Q8J8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8J7 Q8Q8J7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8J6 Q8Q8J6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8J5 Q8Q8J5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q876 Q8Q876]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q741 Q8Q741]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U9 Q8Q3U9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U8 Q8Q3U8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U7 Q8Q3U7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U6 Q8Q3U6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U5 Q8Q3U5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U4 Q8Q3U4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U3 Q8Q3U3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U2 Q8Q3U2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U1 Q8Q3U1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3U0 Q8Q3U0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T9 Q8Q3T9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T6 Q8Q3T6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T5 Q8Q3T5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T4 Q8Q3T4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T3 Q8Q3T3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T2 Q8Q3T2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T1 Q8Q3T1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T0 Q8Q3T0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S9 Q8Q3S9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S8 Q8Q3S8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S7 Q8Q3S7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S6 Q8Q3S6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S5 Q8Q3S5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S3 Q8Q3S3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S2 Q8Q3S2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S1 Q8Q3S1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3S0 Q8Q3S0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R9 Q8Q3R9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R8 Q8Q3R8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R7 Q8Q3R7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R6 Q8Q3R6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R5 Q8Q3R5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R4 Q8Q3R4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R3 Q8Q3R3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R2 Q8Q3R2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R1 Q8Q3R1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3R0 Q8Q3R0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q9 Q8Q3Q9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q8 Q8Q3Q8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q7 Q8Q3Q7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q6 Q8Q3Q6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q5 Q8Q3Q5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q4 Q8Q3Q4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q3 Q8Q3Q3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q2 Q8Q3Q2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q1 Q8Q3Q1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3Q0 Q8Q3Q0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P9 Q8Q3P9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P8 Q8Q3P8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P7 Q8Q3P7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P6 Q8Q3P6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P5 Q8Q3P5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P4 Q8Q3P4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P3 Q8Q3P3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P2 Q8Q3P2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3P1 Q8Q3P1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3N9 Q8Q3N9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3N8 Q8Q3N8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3N7 Q8Q3N7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3N6 Q8Q3N6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3N5 Q8Q3N5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3N2 Q8Q3N2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3N1 Q8Q3N1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3N0 Q8Q3N0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3M9 Q8Q3M9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3M8 Q8Q3M8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3M6 Q8Q3M6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3M5 Q8Q3M5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3M4 Q8Q3M4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3M3 Q8Q3M3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3M2 Q8Q3M2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3L9 Q8Q3L9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3L8 Q8Q3L8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3L5 Q8Q3L5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3L2 Q8Q3L2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3H8 Q8Q3H8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3H7 Q8Q3H7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3C4 Q8Q3C4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3C3 Q8Q3C3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3B8 Q8Q3B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3B7 Q8Q3B7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3B6 Q8Q3B6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3B5 Q8Q3B5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3B4 Q8Q3B4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3A8 Q8Q3A8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3A4 Q8Q3A4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2S1 Q8Q2S1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2S0 Q8Q2S0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2C7 Q8Q2C7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2C5 Q8Q2C5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2B8 Q8Q2B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2B6 Q8Q2B6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2B4 Q8Q2B4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2B3 Q8Q2B3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2B2 Q8Q2B2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2A8 Q8Q2A8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2A7 Q8Q2A7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2A5 Q8Q2A5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2A3 Q8Q2A3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2A2 Q8Q2A2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2A1 Q8Q2A1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2A0 Q8Q2A0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q299 Q8Q299]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q298 Q8Q298]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q297 Q8Q297]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q296 Q8Q296]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q295 Q8Q295]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q294 Q8Q294]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q293 Q8Q293]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q292 Q8Q292]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q291 Q8Q291]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q290 Q8Q290]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q289 Q8Q289]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q286 Q8Q286]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q285 Q8Q285]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q284 Q8Q284]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q283 Q8Q283]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q282 Q8Q282]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q281 Q8Q281]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q279 Q8Q279]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q278 Q8Q278]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q277 Q8Q277]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q276 Q8Q276]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q275 Q8Q275]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q274 Q8Q274]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q270 Q8Q270]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q269 Q8Q269]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q265 Q8Q265]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q262 Q8Q262]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q261 Q8Q261]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q260 Q8Q260]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q259 Q8Q259]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q257 Q8Q257]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q256 Q8Q256]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q255 Q8Q255]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q254 Q8Q254]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q253 Q8Q253]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q252 Q8Q252]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q251 Q8Q251]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q250 Q8Q250]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q246 Q8Q246]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q245 Q8Q245]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q244 Q8Q244]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q243 Q8Q243]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q241 Q8Q241]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q240 Q8Q240]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q239 Q8Q239]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q238 Q8Q238]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q237 Q8Q237]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q233 Q8Q233]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q232 Q8Q232]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q227 Q8Q227]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q226 Q8Q226]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q222 Q8Q222]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q221 Q8Q221]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q217 Q8Q217]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q215 Q8Q215]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q214 Q8Q214]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q213 Q8Q213]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q212 Q8Q212]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q211 Q8Q211]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q210 Q8Q210]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q165 Q8Q165]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q162 Q8Q162]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q155 Q8Q155]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q153 Q8Q153]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q152 Q8Q152]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q148 Q8Q148]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q138 Q8Q138]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q126 Q8Q126]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q122 Q8Q122]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q116 Q8Q116]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q109 Q8Q109]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q108 Q8Q108]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEQ4 Q8JEQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEQ3 Q8JEQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEQ0 Q8JEQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEP9 Q8JEP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEP6 Q8JEP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEP5 Q8JEP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEP4 Q8JEP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEP2 Q8JEP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEN9 Q8JEN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEN7 Q8JEN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEN2 Q8JEN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEN1 Q8JEN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JDS4 Q8JDS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JDS3 Q8JDS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCD6 Q8JCD6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCD5 Q8JCD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCD4 Q8JCD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCD3 Q8JCD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCD2 Q8JCD2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCD1 Q8JCD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCD0 Q8JCD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC9 Q8JCC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC8 Q8JCC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC7 Q8JCC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC6 Q8JCC6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC5 Q8JCC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC4 Q8JCC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC3 Q8JCC3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC2 Q8JCC2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC1 Q8JCC1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCC0 Q8JCC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCB9 Q8JCB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCB8 Q8JCB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCB6 Q8JCB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCB5 Q8JCB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCB4 Q8JCB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCB2 Q8JCB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCB1 Q8JCB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCB0 Q8JCB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA9 Q8JCA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA8 Q8JCA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA7 Q8JCA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA6 Q8JCA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA5 Q8JCA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA4 Q8JCA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA3 Q8JCA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA2 Q8JCA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCA1 Q8JCA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC99 Q8JC99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC98 Q8JC98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC97 Q8JC97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC96 Q8JC96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC95 Q8JC95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC94 Q8JC94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC93 Q8JC93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC92 Q8JC92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC91 Q8JC91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC90 Q8JC90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC89 Q8JC89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC88 Q8JC88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC87 Q8JC87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC86 Q8JC86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC85 Q8JC85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC84 Q8JC84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC83 Q8JC83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC82 Q8JC82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC81 Q8JC81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC80 Q8JC80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC79 Q8JC79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JA16 Q8JA16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9U0 Q8J9U0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T9 Q8J9T9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T8 Q8J9T8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T7 Q8J9T7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T6 Q8J9T6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T5 Q8J9T5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T4 Q8J9T4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T2 Q8J9T2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T1 Q8J9T1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T0 Q8J9T0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S9 Q8J9S9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S7 Q8J9S7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S6 Q8J9S6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S5 Q8J9S5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S4 Q8J9S4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S3 Q8J9S3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S2 Q8J9S2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S1 Q8J9S1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S0 Q8J9S0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9R9 Q8J9R9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9R8 Q8J9R8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9N5 Q8J9N5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9N4 Q8J9N4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9N3 Q8J9N3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9N2 Q8J9N2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9N1 Q8J9N1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9N0 Q8J9N0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8D8 Q8J8D8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8D6 Q8J8D6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8C9 Q8J8C9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8C4 Q8J8C4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8C1 Q8J8C1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8B9 Q8J8B9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8B8 Q8J8B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8B2 Q8J8B2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8A8 Q8J8A8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8A1 Q8J8A1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8A0 Q8J8A0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J897 Q8J897]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J894 Q8J894]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J893 Q8J893]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J892 Q8J892]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J887 Q8J887]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J886 Q8J886]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J884 Q8J884]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J882 Q8J882]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J879 Q8J879]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J877 Q8J877]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J875 Q8J875]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J874 Q8J874]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J873 Q8J873]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J870 Q8J870]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J866 Q8J866]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J863 Q8J863]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J862 Q8J862]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J858 Q8J858]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J857 Q8J857]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J851 Q8J851]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J848 Q8J848]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J840 Q8J840]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J837 Q8J837]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J834 Q8J834]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J828 Q8J828]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J817 Q8J817]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J815 Q8J815]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J806 Q8J806]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J805 Q8J805]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Z8 Q8J7Z8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Z5 Q8J7Z5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Z4 Q8J7Z4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Z1 Q8J7Z1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Y7 Q8J7Y7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Y6 Q8J7Y6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Y2 Q8J7Y2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7X3 Q8J7X3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7X2 Q8J7X2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7W5 Q8J7W5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7W1 Q8J7W1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7W0 Q8J7W0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7V8 Q8J7V8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7V2 Q8J7V2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7U8 Q8J7U8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7U4 Q8J7U4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7U1 Q8J7U1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7T7 Q8J7T7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7T5 Q8J7T5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7S2 Q8J7S2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7S0 Q8J7S0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7R5 Q8J7R5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7R1 Q8J7R1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Q4 Q8J7Q4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7P3 Q8J7P3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7N6 Q8J7N6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7N5 Q8J7N5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7N2 Q8J7N2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7M9 Q8J7M9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7M6 Q8J7M6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7L7 Q8J7L7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7L5 Q8J7L5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7L0 Q8J7L0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7K8 Q8J7K8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7K4 Q8J7K4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7F1 Q8J7F1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7F0 Q8J7F0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7E9 Q8J7E9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7E8 Q8J7E8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7E6 Q8J7E6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7E4 Q8J7E4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7E3 Q8J7E3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7E2 Q8J7E2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7E1 Q8J7E1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D8 Q8J7D8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D7 Q8J7D7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D4 Q8J7D4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D2 Q8J7D2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D1 Q8J7D1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D0 Q8J7D0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7C9 Q8J7C9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7C6 Q8J7C6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7C5 Q8J7C5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7C1 Q8J7C1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7C0 Q8J7C0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B8 Q8J7B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B7 Q8J7B7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B5 Q8J7B5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B4 Q8J7B4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B3 Q8J7B3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B2 Q8J7B2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B1 Q8J7B1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B0 Q8J7B0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7A9 Q8J7A9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7A8 Q8J7A8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7A7 Q8J7A7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7A3 Q8J7A3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7A2 Q8J7A2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7A1 Q8J7A1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7A0 Q8J7A0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J799 Q8J799]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J797 Q8J797]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J795 Q8J795]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J794 Q8J794]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J793 Q8J793]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J791 Q8J791]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J790 Q8J790]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J789 Q8J789]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J788 Q8J788]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J786 Q8J786]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J785 Q8J785]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J784 Q8J784]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J783 Q8J783]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J780 Q8J780]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J779 Q8J779]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J777 Q8J777]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J776 Q8J776]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J774 Q8J774]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J773 Q8J773]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J772 Q8J772]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J771 Q8J771]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J768 Q8J768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J764 Q8J764]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J763 Q8J763]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J762 Q8J762]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J760 Q8J760]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J759 Q8J759]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J758 Q8J758]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J757 Q8J757]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J756 Q8J756]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J755 Q8J755]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J754 Q8J754]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J753 Q8J753]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J752 Q8J752]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J750 Q8J750]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J744 Q8J744]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J743 Q8J743]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J742 Q8J742]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J741 Q8J741]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J739 Q8J739]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J737 Q8J737]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J736 Q8J736]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J734 Q8J734]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J733 Q8J733]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J730 Q8J730]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J726 Q8J726]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J724 Q8J724]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J721 Q8J721]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J719 Q8J719]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J718 Q8J718]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J716 Q8J716]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J715 Q8J715]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J710 Q8J710]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J707 Q8J707]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J706 Q8J706]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J704 Q8J704]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J702 Q8J702]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J700 Q8J700]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Z9 Q8J6Z9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Z8 Q8J6Z8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Z7 Q8J6Z7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Z6 Q8J6Z6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Z5 Q8J6Z5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Z3 Q8J6Z3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Z1 Q8J6Z1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Y9 Q8J6Y9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Y8 Q8J6Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Y7 Q8J6Y7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Y6 Q8J6Y6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Y4 Q8J6Y4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Y3 Q8J6Y3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Y0 Q8J6Y0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6X4 Q8J6X4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6X1 Q8J6X1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6W9 Q8J6W9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6W7 Q8J6W7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6W6 Q8J6W6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6W5 Q8J6W5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6V7 Q8J6V7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6V6 Q8J6V6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6V4 Q8J6V4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6V1 Q8J6V1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6V0 Q8J6V0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U9 Q8J6U9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U8 Q8J6U8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U7 Q8J6U7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U6 Q8J6U6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U5 Q8J6U5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U2 Q8J6U2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U1 Q8J6U1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6T9 Q8J6T9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6T8 Q8J6T8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6T7 Q8J6T7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6T6 Q8J6T6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6T5 Q8J6T5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6T3 Q8J6T3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6T0 Q8J6T0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6S7 Q8J6S7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6S4 Q8J6S4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6S3 Q8J6S3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6R9 Q8J6R9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6R6 Q8J6R6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6R2 Q8J6R2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Q9 Q8J6Q9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Q8 Q8J6Q8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Q6 Q8J6Q6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Q3 Q8J6Q3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Q0 Q8J6Q0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6P7 Q8J6P7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6P6 Q8J6P6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6N9 Q8J6N9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6N5 Q8J6N5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6N3 Q8J6N3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6N2 Q8J6N2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6H0 Q8J6H0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6E6 Q8J6E6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J4Z8 Q8J4Z8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AFP9 Q8AFP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q79787 Q79787]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75831 Q75831]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75830 Q75830]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75826 Q75826]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75823 Q75823]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75822 Q75822]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75821 Q75821]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75819 Q75819]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75818 Q75818]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75817 Q75817]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75816 Q75816]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75813 Q75813]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75811 Q75811]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75807 Q75807]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75805 Q75805]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75799 Q75799]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75798 Q75798]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75794 Q75794]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75791 Q75791]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75790 Q75790]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75789 Q75789]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75786 Q75786]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75784 Q75784]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75774 Q75774]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75773 Q75773]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75772 Q75772]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75771 Q75771]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75769 Q75769]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75768 Q75768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75766 Q75766]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75764 Q75764]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75763 Q75763]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75762 Q75762]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75761 Q75761]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75394 Q75394]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75393 Q75393]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72547 Q72547]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90187 P90187]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90185 P90185]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90184 P90184]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90183 P90183]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90182 P90182]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90181 P90181]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90180 P90180]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90179 P90179]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93181 O93181]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93177 O93177]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93172 O93172]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93169 O93169]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93166 O93166]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92864 O92864]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92862 O92862]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92861 O92861]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92860 O92860]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92859 O92859]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92856 O92856]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92850 O92850]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92849 O92849]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92847 O92847]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92770 O92770]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92082 O92082]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92081 O92081]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92075 O92075]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92064 O92064]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92061 O92061]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92060 O92060]
| + | |
− | ** [http://www.uniprot.org/uniprot/O90906 O90906]
| + | |
− | ** [http://www.uniprot.org/uniprot/O90904 O90904]
| + | |
− | ** [http://www.uniprot.org/uniprot/O90893 O90893]
| + | |
− | ** [http://www.uniprot.org/uniprot/O71232 O71232]
| + | |
− | ** [http://www.uniprot.org/uniprot/O40463 O40463]
| + | |
− | ** [http://www.uniprot.org/uniprot/O40462 O40462]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39210 O39210]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39205 O39205]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39204 O39204]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39202 O39202]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39201 O39201]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39200 O39200]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36558 O36558]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36556 O36556]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36553 O36553]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36552 O36552]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4J4 Q7M4J4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADC5 Q8ADC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AE80 Q8AE80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AE40 Q8AE40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AE32 Q8AE32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADU3 Q8ADU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADG5 Q8ADG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AD77 Q8AD77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JBY3 Q8JBY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AE48 Q8AE48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADJ7 Q8ADJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADA9 Q8ADA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADR1 Q8ADR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC59 Q8JC59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADR9 Q8ADR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADP5 Q8ADP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ACB3 Q8ACB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADE9 Q8ADE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AC79 Q8AC79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AE15 Q8AE15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JBK4 Q8JBK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADV1 Q8ADV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JBT8 Q8JBT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADZ1 Q8ADZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADQ3 Q8ADQ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JBV6 Q8JBV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JBH7 Q8JBH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADY3 Q8ADY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADN7 Q8ADN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC14 Q8JC14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JBM2 Q8JBM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8ADD3 Q8ADD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC77 Q8JC77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JC23 Q8JC23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JBQ2 Q8JBQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AUI4 Q8AUI4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AQW3 Q8AQW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AQV4 Q8AQV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AQU5 Q8AQU5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AQS7 Q8AQS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35963 P35963]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33459 P33459]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31822 P31822]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD66 Q8QD66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IL2 Q90IL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD30 Q8QD30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJH3 Q9WJH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IN7 Q90IN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD48 Q8QD48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKJ7 Q9WKJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJH4 Q9WJH4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ89 Q9QJ89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIQ4 Q9QIQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIM1 Q9QIM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN04 Q9IN04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN01 Q9IN01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGB8 Q9IGB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5H0 Q9E5H0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E569 Q9E569]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E353 Q9E353]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99EV2 Q99EV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z49 Q98Z49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QI7 Q90QI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N33 Q90N33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY7 Q90MY7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW1 Q90MW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KU8 Q90KU8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KA3 Q90KA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K71 Q90K71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K44 Q90K44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JT0 Q90JT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JR3 Q90JR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J53 Q90J53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HH6 Q90HH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKY9 Q8UKY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKX3 Q8UKX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKW6 Q8UKW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UKW1 Q8UKW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD59 Q8QD59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD50 Q8QD50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD49 Q8QD49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD43 Q8QD43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD28 Q8QD28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QD14 Q8QD14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAP3 Q8QAP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAN8 Q8QAN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAN6 Q8QAN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAM5 Q8QAM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8N4 Q8Q8N4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8M8 Q8Q8M8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8K3 Q8Q8K3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q273 Q8Q273]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7S7 Q8J7S7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J792 Q8J792]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J775 Q8J775]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J714 Q8J714]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92854 O92854]
| + | |
− | ** [http://www.uniprot.org/uniprot/O90905 O90905]
| + | |
− | ** [http://www.uniprot.org/uniprot/O71234 O71234]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92077 O92077]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N71 Q90N71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CH9 Q90CH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6S6 Q8J6S6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IY0 Q90IY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEN5 Q9QEN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q154 Q8Q154]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6V2 Q8J6V2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G49 Q90G49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URR4 Q8URR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QBZ1 Q9QBZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEG3 Q8JEG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9S8 Q8J9S8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CS1 Q90CS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QDG1 Q8QDG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92888 O92888]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92079 O92079]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92901 O92901]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPK0 Q9DPK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RP7 Q90RP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N37 Q90N37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FX5 Q90FX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UT52 Q8UT52]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KL6 Q90KL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP1 Q8QCP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92080 O92080]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GI2 Q90GI2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q78241 Q78241]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SZ4 Q90SZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IM0 Q90IM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DU7 Q90DU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q73330 Q73330]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q71813 Q71813]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YLQ5 Q9YLQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WQ95 Q9WQ95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKA6 Q9WKA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJK5 Q9WJK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJF5 Q9WJF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFQ2 Q9WFQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFJ1 Q9WFJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBW5 Q9WBW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBW1 Q9WBW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQV4 Q9QQV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQV3 Q9QQV3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLW6 Q9QLW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLU7 Q9QLU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLS2 Q9QLS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLS1 Q9QLS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLR9 Q9QLR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJB2 Q9QJB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJA2 Q9QJA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJA0 Q9QJA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIP8 Q9QIP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIJ6 Q9QIJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIJ1 Q9QIJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIJ0 Q9QIJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QBZ5 Q9QBZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q711 Q9Q711]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q3A0 Q9Q3A0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q380 Q9Q380]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q374 Q9Q374]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Q300 Q9Q300]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5Q8 Q9J5Q8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5P8 Q9J5P8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5P2 Q9J5P2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4Y2 Q9J4Y2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IZ58 Q9IZ58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVC7 Q9IVC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IVB5 Q9IVB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN30 Q9IN30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN19 Q9IN19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN06 Q9IN06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN05 Q9IN05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IN03 Q9IN03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IM85 Q9IM85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGK2 Q9IGK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGC7 Q9IGC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGC3 Q9IGC3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDM9 Q9IDM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDI8 Q9IDI8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDD7 Q9IDD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDB3 Q9IDB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDA8 Q9IDA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ID61 Q9ID61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EN69 Q9EN69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5X4 Q9E5X4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5X2 Q9E5X2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5V8 Q9E5V8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5V4 Q9E5V4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5U1 Q9E5U1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5U0 Q9E5U0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E572 Q9E572]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E555 Q9E555]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E551 Q9E551]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3Z5 Q9E3Z5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZE0 Q9DZE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DZ80 Q9DZ80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPL2 Q9DPL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPK9 Q9DPK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FH2 Q99FH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99FG4 Q99FG4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F91 Q99F91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F79 Q99F79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99F73 Q99F73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99ET7 Q99ET7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99ET4 Q99ET4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99ET3 Q99ET3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q99DN4 Q99DN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999S8 Q999S8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999F7 Q999F7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999F0 Q999F0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999E3 Q999E3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q993R3 Q993R3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q991M8 Q991M8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZH2 Q98ZH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z35 Q98Z35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z30 Q98Z30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YW3 Q98YW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YQ5 Q98YQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YP1 Q98YP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YM9 Q98YM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98YB4 Q98YB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Y88 Q98Y88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90TA0 Q90TA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T99 Q90T99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T92 Q90T92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T88 Q90T88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T64 Q90T64]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T50 Q90T50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T48 Q90T48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T47 Q90T47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T21 Q90T21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T16 Q90T16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T14 Q90T14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T07 Q90T07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T02 Q90T02]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SW6 Q90SW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SV1 Q90SV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SU0 Q90SU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ST1 Q90ST1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SS1 Q90SS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SR7 Q90SR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SR4 Q90SR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90QE4 Q90QE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ND3 Q90ND3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ND0 Q90ND0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N97 Q90N97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N82 Q90N82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N43 Q90N43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N34 Q90N34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90N06 Q90N06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MY6 Q90MY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW7 Q90MW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MW3 Q90MW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MB2 Q90MB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M82 Q90M82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M80 Q90M80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M74 Q90M74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M50 Q90M50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M44 Q90M44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT6 Q90LT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LT5 Q90LT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LS9 Q90LS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LS5 Q90LS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LS2 Q90LS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LR9 Q90LR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LH4 Q90LH4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LG5 Q90LG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LG4 Q90LG4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LG1 Q90LG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LF9 Q90LF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LF8 Q90LF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LF4 Q90LF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LC6 Q90LC6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LB9 Q90LB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LB8 Q90LB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LB6 Q90LB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LB5 Q90LB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L68 Q90L68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L61 Q90L61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L39 Q90L39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L33 Q90L33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L04 Q90L04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KS3 Q90KS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KR6 Q90KR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KQ8 Q90KQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KM7 Q90KM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KK9 Q90KK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KF5 Q90KF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KB1 Q90KB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K94 Q90K94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K62 Q90K62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K37 Q90K37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K02 Q90K02]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K01 Q90K01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JX8 Q90JX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JX3 Q90JX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JV2 Q90JV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JU0 Q90JU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JT7 Q90JT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JS4 Q90JS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JQ8 Q90JQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JQ5 Q90JQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JL2 Q90JL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JG8 Q90JG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JE1 Q90JE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JD1 Q90JD1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JB9 Q90JB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JA7 Q90JA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JA5 Q90JA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J99 Q90J99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J86 Q90J86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J77 Q90J77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J43 Q90J43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J36 Q90J36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J23 Q90J23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J20 Q90J20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90J13 Q90J13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IX0 Q90IX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IW7 Q90IW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IW5 Q90IW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IU6 Q90IU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IU0 Q90IU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IL5 Q90IL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90II5 Q90II5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IG3 Q90IG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IF7 Q90IF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IF4 Q90IF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IC7 Q90IC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IC3 Q90IC3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IC0 Q90IC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IB3 Q90IB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IA9 Q90IA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I76 Q90I76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I67 Q90I67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I16 Q90I16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HX3 Q90HX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HW2 Q90HW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HN7 Q90HN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HN4 Q90HN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HM2 Q90HM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HK5 Q90HK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HJ5 Q90HJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HI0 Q90HI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HE5 Q90HE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HB7 Q90HB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HB4 Q90HB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H87 Q90H87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H85 Q90H85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H49 Q90H49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H44 Q90H44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H28 Q90H28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H13 Q90H13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H08 Q90H08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GY0 Q90GY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GW7 Q90GW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GV2 Q90GV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GT4 Q90GT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GS0 Q90GS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GP3 Q90GP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GM9 Q90GM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GK9 Q90GK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GK1 Q90GK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GD5 Q90GD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GB5 Q90GB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G78 Q90G78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G65 Q90G65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G53 Q90G53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G27 Q90G27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G22 Q90G22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FZ5 Q90FZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FY8 Q90FY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FW2 Q90FW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FU1 Q90FU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FT4 Q90FT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FH4 Q90FH4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FG4 Q90FG4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FF4 Q90FF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FE1 Q90FE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F82 Q90F82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F30 Q90F30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F17 Q90F17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F07 Q90F07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D91 Q90D91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D90 Q90D90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D44 Q90D44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D35 Q90D35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CT0 Q90CT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CS9 Q90CS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90BB0 Q90BB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904L9 Q904L9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904L2 Q904L2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904J2 Q904J2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903B4 Q903B4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903A2 Q903A2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8USR0 Q8USR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8USQ1 Q8USQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8US03 Q8US03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URZ7 Q8URZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URX6 Q8URX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URX5 Q8URX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URX4 Q8URX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URX2 Q8URX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URX1 Q8URX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URX0 Q8URX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URW9 Q8URW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URW8 Q8URW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URW7 Q8URW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URW6 Q8URW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URW3 Q8URW3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URW2 Q8URW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URW1 Q8URW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URW0 Q8URW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URV9 Q8URV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UM84 Q8UM84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP2 Q8QCP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCP0 Q8QCP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCN9 Q8QCN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCN8 Q8QCN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCN6 Q8QCN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBR1 Q8QBR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBP4 Q8QBP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR3 Q8QAR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR0 Q8QAR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ6 Q8QAQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ5 Q8QAQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ4 Q8QAQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ1 Q8QAQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAP9 Q8QAP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAP8 Q8QAP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAN9 Q8QAN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAN5 Q8QAN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAN4 Q8QAN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAM9 Q8QAM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAM3 Q8QAM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAM0 Q8QAM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAL7 Q8QAL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA29 Q8QA29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA27 Q8QA27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA23 Q8QA23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q927 Q8Q927]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L3 Q8Q8L3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q874 Q8Q874]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q7B7 Q8Q7B7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q749 Q8Q749]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q743 Q8Q743]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q734 Q8Q734]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q5W9 Q8Q5W9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3T7 Q8Q3T7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3M7 Q8Q3M7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q2A6 Q8Q2A6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q220 Q8Q220]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEQ5 Q8JEQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEQ1 Q8JEQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEP0 Q8JEP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEN3 Q8JEN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JDS7 Q8JDS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JDS6 Q8JDS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JDS5 Q8JDS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JDS1 Q8JDS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JDS0 Q8JDS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JDR9 Q8JDR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCE7 Q8JCE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J9T3 Q8J9T3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8D7 Q8J8D7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8D1 Q8J8D1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J878 Q8J878]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J871 Q8J871]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J839 Q8J839]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J823 Q8J823]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7W6 Q8J7W6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7V5 Q8J7V5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7U5 Q8J7U5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7U2 Q8J7U2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7T1 Q8J7T1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7S1 Q8J7S1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7R8 Q8J7R8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Q9 Q8J7Q9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Q3 Q8J7Q3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7P7 Q8J7P7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7M4 Q8J7M4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D9 Q8J7D9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7D5 Q8J7D5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J769 Q8J769]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J767 Q8J767]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J749 Q8J749]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J746 Q8J746]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J745 Q8J745]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J732 Q8J732]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6W4 Q8J6W4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6W3 Q8J6W3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6W0 Q8J6W0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6V8 Q8J6V8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U3 Q8J6U3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6U0 Q8J6U0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6R7 Q8J6R7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6P2 Q8J6P2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6P1 Q8J6P1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6P0 Q8J6P0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75836 Q75836]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75829 Q75829]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75828 Q75828]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75825 Q75825]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75820 Q75820]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75810 Q75810]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75809 Q75809]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75800 Q75800]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75795 Q75795]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75777 Q75777]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75770 Q75770]
| + | |
− | ** [http://www.uniprot.org/uniprot/P90186 P90186]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93171 O93171]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92865 O92865]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92853 O92853]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92769 O92769]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92086 O92086]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92085 O92085]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92083 O92083]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92063 O92063]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39203 O39203]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36573 O36573]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36569 O36569]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEN4 Q9QEN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZF3 Q98ZF3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M47 Q90M47]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JZ6 Q90JZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IZ7 Q90IZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAQ8 Q8QAQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JEN8 Q8JEN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8D3 Q8J8D3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M2A9 Q7M2A9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IW43 Q9IW43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90CW8 Q90CW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GN1 Q90GN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IK4 Q90IK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L27 Q90L27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T06 Q90T06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QEN6 Q9QEN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RP5 Q90RP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90ID3 Q90ID3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDA4 Q9IDA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WKE3 Q9WKE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFM3 Q9WFM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WFL1 Q9WFL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQU5 Q9QQU5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLU1 Q9QLU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLT8 Q9QLT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJ92 Q9QJ92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIN9 Q9QIN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J5P9 Q9J5P9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4W2 Q9J4W2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDE0 Q9IDE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IDC4 Q9IDC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DPF5 Q9DPF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q992A8 Q992A8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZH0 Q98ZH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98ZA6 Q98ZA6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z71 Q98Z71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98Z61 Q98Z61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SU4 Q90SU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90NC1 Q90NC1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MX2 Q90MX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L24 Q90L24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KX7 Q90KX7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KV9 Q90KV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KU4 Q90KU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KE7 Q90KE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K82 Q90K82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JW2 Q90JW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JQ9 Q90JQ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90JI3 Q90JI3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I65 Q90I65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90I62 Q90I62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HT7 Q90HT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HL8 Q90HL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HD0 Q90HD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HB6 Q90HB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GS2 Q90GS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GP8 Q90GP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GH9 Q90GH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GG3 Q90GG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GD0 Q90GD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GC8 Q90GC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FL3 Q90FL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FC8 Q90FC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FA9 Q90FA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F27 Q90F27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D53 Q90D53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904M5 Q904M5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBN4 Q8QBN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X1 Q8Q8X1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8N8 Q8Q8N8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8N2 Q8Q8N2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8M7 Q8Q8M7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8M6 Q8Q8M6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8M3 Q8Q8M3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L6 Q8Q8L6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L5 Q8Q8L5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8L1 Q8Q8L1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8K8 Q8Q8K8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q113 Q8Q113]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8D2 Q8J8D2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J8C3 Q8J8C3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Y1 Q8J7Y1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7M5 Q8J7M5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7L9 Q8J7L9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7B6 Q8J7B6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J6Y2 Q8J6Y2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q75767 Q75767]
| + | |
− | ** [http://www.uniprot.org/uniprot/O90892 O90892]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03354 P03354]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10266 P10266]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32542 P32542]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19561 P19561]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24107 P24107]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14078 P14078]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03371 P03371]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16088 P16088]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04584 P04584]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25059 P25059]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03361 P03361]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18042 P18042]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03362 P03362]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21414 P21414]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03363 P03363]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07572 P07572]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18802 P18802]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17283 P17283]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20876 P20876]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03370 P03370]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31792 P31792]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E7M1 Q9E7M1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J8E2 Q9J8E2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q83362 Q83362]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RL4 Q90RL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31623 P31623]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10272 P10272]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11227 P11227]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03369 P03369]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03366 P03366]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03368 P03368]
| + | |
− | ** [http://www.uniprot.org/uniprot/P71276 P71276]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23070 P23070]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23072 P23072]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23071 P23071]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11660 P11660]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21325 P21325]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q63288 Q63288]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05804 Q05804]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S869 Q9S869]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q63289 Q63289]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q47526 Q47526]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q77112 Q77112]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90017 Q90017]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90018 Q90018]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90013 Q90013]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89972 Q89972]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90019 Q90019]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90012 Q90012]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89973 Q89973]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89975 Q89975]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89976 Q89976]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89974 Q89974]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89978 Q89978]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89977 Q89977]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89979 Q89979]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBJ5 Q9EBJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EES4 Q9EES4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBJ9 Q9EBJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK4 Q9EBK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK5 Q9EBK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90L11 Q90L11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBJ7 Q9EBJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK9 Q9EBK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL7 Q9EBL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL5 Q9EBL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM9 Q9EBM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK3 Q9EBK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBJ8 Q9EBJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL9 Q9EBL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL8 Q9EBL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK1 Q9EBK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WLR0 Q9WLR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQT6 Q9QQT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQT5 Q9QQT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLS7 Q9QLS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJA7 Q9QJA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJA5 Q9QJA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIQ5 Q9QIQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIM3 Q9QIM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIK2 Q9QIK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4Y1 Q9J4Y1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4X8 Q9J4X8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9J4W7 Q9J4W7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IZ19 Q9IZ19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGC0 Q9IGC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELE1 Q9ELE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL98 Q9EL98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL16 Q9EL16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EK21 Q9EK21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EK16 Q9EK16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJX9 Q9EJX9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJL7 Q9EJL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJK1 Q9EJK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJI2 Q9EJI2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJF3 Q9EJF3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJB7 Q9EJB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ10 Q9EJ10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ05 Q9EJ05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIT8 Q9EIT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIJ8 Q9EIJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIJ6 Q9EIJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI35 Q9EI35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI34 Q9EI34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI33 Q9EI33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI32 Q9EI32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI31 Q9EI31]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHP0 Q9EHP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHN8 Q9EHN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHN5 Q9EHN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EH43 Q9EH43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EH09 Q9EH09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EH07 Q9EH07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGX5 Q9EGX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGW6 Q9EGW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGW5 Q9EGW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGW4 Q9EGW4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG62 Q9EG62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG58 Q9EG58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG46 Q9EG46]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG33 Q9EG33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG28 Q9EG28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG27 Q9EG27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFR7 Q9EFR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF61 Q9EF61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EET3 Q9EET3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EET0 Q9EET0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEQ6 Q9EEQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED40 Q9ED40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC86 Q9EC86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC82 Q9EC82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM5 Q9EBM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM4 Q9EBM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM1 Q9EBM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL6 Q9EBL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL4 Q9EBL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL3 Q9EBL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL2 Q9EBL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK7 Q9EBK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBJ4 Q9EBJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBC3 Q9EBC3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBB2 Q9EBB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5H4 Q9E5H4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5H3 Q9E5H3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5H2 Q9E5H2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5H1 Q9E5H1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5G6 Q9E5G6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5G4 Q9E5G4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5G1 Q9E5G1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F9 Q9E5F9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F8 Q9E5F8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F7 Q9E5F7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F6 Q9E5F6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F5 Q9E5F5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F4 Q9E5F4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F3 Q9E5F3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F2 Q9E5F2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F1 Q9E5F1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5F0 Q9E5F0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E9 Q9E5E9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E8 Q9E5E8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E7 Q9E5E7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E6 Q9E5E6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E4 Q9E5E4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E3 Q9E5E3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E2 Q9E5E2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E1 Q9E5E1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5E0 Q9E5E0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5D9 Q9E5D9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5D8 Q9E5D8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5D7 Q9E5D7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5D5 Q9E5D5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5D4 Q9E5D4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5D3 Q9E5D3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E5D2 Q9E5D2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E568 Q9E568]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E567 Q9E567]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E566 Q9E566]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E565 Q9E565]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E564 Q9E564]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999S7 Q999S7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999F9 Q999F9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T98 Q90T98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SZ0 Q90SZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90SX5 Q90SX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LE4 Q90LE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KX1 Q90KX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90KN7 Q90KN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90K08 Q90K08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IW1 Q90IW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GJ0 Q90GJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90G23 Q90G23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FN2 Q90FN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FK3 Q90FK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FJ4 Q90FJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90FC7 Q90FC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D78 Q90D78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D74 Q90D74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909S7 Q909S7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCN7 Q8QCN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCN5 Q8QCN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCN4 Q8QCN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QCL4 Q8QCL4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QB15 Q8QB15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAR2 Q8QAR2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QAP2 Q8QAP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3A3 Q8Q3A3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3A2 Q8Q3A2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB76 Q8JB76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB74 Q8JB74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB54 Q8JB54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB41 Q8JB41]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB38 Q8JB38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB32 Q8JB32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB19 Q8JB19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB09 Q8JB09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB00 Q8JB00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAZ0 Q8JAZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAY9 Q8JAY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAY6 Q8JAY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7X4 Q8J7X4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7W8 Q8J7W8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7Q1 Q8J7Q1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7M3 Q8J7M3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J7C8 Q8J7C8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89987 Q89987]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89986 Q89986]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89985 Q89985]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89984 Q89984]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89983 Q89983]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89982 Q89982]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89981 Q89981]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89980 Q89980]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89968 Q89968]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89967 Q89967]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89966 Q89966]
| + | |
− | ** [http://www.uniprot.org/uniprot/O93173 O93173]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89988 Q89988]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89991 Q89991]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89990 Q89990]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89992 Q89992]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89989 Q89989]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89993 Q89993]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89994 Q89994]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89995 Q89995]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89996 Q89996]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89997 Q89997]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89998 Q89998]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89999 Q89999]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90000 Q90000]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90001 Q90001]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90002 Q90002]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90003 Q90003]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90006 Q90006]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90007 Q90007]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90008 Q90008]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90009 Q90009]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90010 Q90010]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90005 Q90005]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90004 Q90004]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90011 Q90011]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90014 Q90014]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90015 Q90015]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90016 Q90016]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89969 Q89969]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89970 Q89970]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89971 Q89971]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89944 Q89944]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89945 Q89945]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89946 Q89946]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89947 Q89947]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89948 Q89948]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89949 Q89949]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89951 Q89951]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89953 Q89953]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89954 Q89954]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89955 Q89955]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEC9 Q9EEC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ1 Q9EKZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKP5 Q9EKP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEB1 Q9EEB1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL09 Q9EL09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ3 Q9EKZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKP2 Q9EKP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDL9 Q9EDL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK2 Q9EBK2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ2 Q9EKZ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKP4 Q9EKP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI84 Q9EI84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL12 Q9EL12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ7 Q9EKZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM7 Q9EBM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL11 Q9EL11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEH1 Q9EEH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDL2 Q9EDL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI95 Q9EI95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URS8 Q8URS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ9 Q9EKZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DB6 Q90DB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QIK7 Q9QIK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL02 Q9EL02]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKK8 Q9EKK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL15 Q9EL15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL21 Q9EL21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDK8 Q9EDK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDL5 Q9EDL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8URS6 Q8URS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB97 Q8JB97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3F4 Q8Q3F4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJK9 Q9WJK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJK7 Q9WJK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJJ1 Q9WJJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WJH8 Q9WJH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WBW9 Q9WBW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLT7 Q9QLT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QLS9 Q9QLS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QJB4 Q9QJB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IZ30 Q9IZ30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IZ29 Q9IZ29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IGD0 Q9IGD0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IFC8 Q9IFC8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IFB5 Q9IFB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9IFB0 Q9IFB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELR8 Q9ELR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELR6 Q9ELR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELL2 Q9ELL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELL0 Q9ELL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELK5 Q9ELK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELJ9 Q9ELJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELJ8 Q9ELJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELJ6 Q9ELJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELJ4 Q9ELJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELJ3 Q9ELJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELG6 Q9ELG6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELG4 Q9ELG4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELG3 Q9ELG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELG2 Q9ELG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELG0 Q9ELG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELF9 Q9ELF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELF0 Q9ELF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELE9 Q9ELE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELE5 Q9ELE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELE2 Q9ELE2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELE0 Q9ELE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELD8 Q9ELD8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELD7 Q9ELD7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELD2 Q9ELD2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELB4 Q9ELB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELA9 Q9ELA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELA8 Q9ELA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELA7 Q9ELA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELA2 Q9ELA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELA0 Q9ELA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL99 Q9EL99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL97 Q9EL97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL88 Q9EL88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL20 Q9EL20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL19 Q9EL19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL14 Q9EL14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL13 Q9EL13]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL10 Q9EL10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL07 Q9EL07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL06 Q9EL06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL05 Q9EL05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL04 Q9EL04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL03 Q9EL03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL00 Q9EL00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ8 Q9EKZ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ6 Q9EKZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ5 Q9EKZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKZ0 Q9EKZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKY9 Q9EKY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKY8 Q9EKY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKY6 Q9EKY6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKY5 Q9EKY5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKY4 Q9EKY4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKY3 Q9EKY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKY1 Q9EKY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKX9 Q9EKX9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKX8 Q9EKX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKX6 Q9EKX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKX5 Q9EKX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKX3 Q9EKX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKX2 Q9EKX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKX0 Q9EKX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKW8 Q9EKW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKW6 Q9EKW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKW5 Q9EKW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKV9 Q9EKV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKV8 Q9EKV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKV4 Q9EKV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKV2 Q9EKV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKU1 Q9EKU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKU0 Q9EKU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKT7 Q9EKT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKT6 Q9EKT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKT5 Q9EKT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKT4 Q9EKT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKT3 Q9EKT3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKT2 Q9EKT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKS4 Q9EKS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKR3 Q9EKR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKQ5 Q9EKQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKP9 Q9EKP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKN6 Q9EKN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKN5 Q9EKN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKN0 Q9EKN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKM7 Q9EKM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKM6 Q9EKM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKM5 Q9EKM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKM4 Q9EKM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKL5 Q9EKL5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKL3 Q9EKL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKL2 Q9EKL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKK7 Q9EKK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKK5 Q9EKK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKK3 Q9EKK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKF0 Q9EKF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKE8 Q9EKE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKD5 Q9EKD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKD4 Q9EKD4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKC5 Q9EKC5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EKA2 Q9EKA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EK32 Q9EK32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJX3 Q9EJX3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJX2 Q9EJX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJW8 Q9EJW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJW7 Q9EJW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJW2 Q9EJW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJW1 Q9EJW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJV4 Q9EJV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJU9 Q9EJU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJU8 Q9EJU8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJU7 Q9EJU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJS8 Q9EJS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJS5 Q9EJS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJQ2 Q9EJQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJQ0 Q9EJQ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJP9 Q9EJP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJP4 Q9EJP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJP3 Q9EJP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJN6 Q9EJN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJN2 Q9EJN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJM8 Q9EJM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJM7 Q9EJM7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJM6 Q9EJM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJM5 Q9EJM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJM3 Q9EJM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJM1 Q9EJM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJM0 Q9EJM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJL9 Q9EJL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJL8 Q9EJL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJK6 Q9EJK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJK4 Q9EJK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJI1 Q9EJI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJH9 Q9EJH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJH8 Q9EJH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJG5 Q9EJG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJG1 Q9EJG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJG0 Q9EJG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJF8 Q9EJF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJF4 Q9EJF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJF2 Q9EJF2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJF1 Q9EJF1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJF0 Q9EJF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJE9 Q9EJE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJE8 Q9EJE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJE7 Q9EJE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJE6 Q9EJE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJC6 Q9EJC6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJA7 Q9EJA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ59 Q9EJ59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ34 Q9EJ34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ29 Q9EJ29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ27 Q9EJ27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ26 Q9EJ26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ12 Q9EJ12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ11 Q9EJ11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJ09 Q9EJ09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIY3 Q9EIY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIY2 Q9EIY2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIW2 Q9EIW2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIW1 Q9EIW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIW0 Q9EIW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV9 Q9EIV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV8 Q9EIV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV7 Q9EIV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV6 Q9EIV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV5 Q9EIV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV4 Q9EIV4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV3 Q9EIV3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV2 Q9EIV2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV1 Q9EIV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIV0 Q9EIV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIU9 Q9EIU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIU1 Q9EIU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIT5 Q9EIT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIT4 Q9EIT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIS7 Q9EIS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIS3 Q9EIS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIQ5 Q9EIQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIN2 Q9EIN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIM8 Q9EIM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIM6 Q9EIM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIM5 Q9EIM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIM3 Q9EIM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIM2 Q9EIM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIM1 Q9EIM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIL9 Q9EIL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIL6 Q9EIL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIJ1 Q9EIJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EII6 Q9EII6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIH9 Q9EIH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIH0 Q9EIH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIF4 Q9EIF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIB9 Q9EIB9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIB2 Q9EIB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI91 Q9EI91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI88 Q9EI88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI87 Q9EI87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI85 Q9EI85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI80 Q9EI80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI56 Q9EI56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI55 Q9EI55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI51 Q9EI51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EI48 Q9EI48]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHW1 Q9EHW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHU9 Q9EHU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHU5 Q9EHU5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHU2 Q9EHU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHU1 Q9EHU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHU0 Q9EHU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHT9 Q9EHT9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHT8 Q9EHT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHT6 Q9EHT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHT5 Q9EHT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHT4 Q9EHT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHT1 Q9EHT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHT0 Q9EHT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHS9 Q9EHS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHS7 Q9EHS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHS4 Q9EHS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHS3 Q9EHS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHS2 Q9EHS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHS0 Q9EHS0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHR9 Q9EHR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHR8 Q9EHR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHR6 Q9EHR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHK9 Q9EHK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHJ9 Q9EHJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHJ8 Q9EHJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHJ7 Q9EHJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHI7 Q9EHI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHE6 Q9EHE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHE5 Q9EHE5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHE4 Q9EHE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHC7 Q9EHC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHB8 Q9EHB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHB6 Q9EHB6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGU5 Q9EGU5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGU3 Q9EGU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGS3 Q9EGS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGS2 Q9EGS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGS1 Q9EGS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGR9 Q9EGR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGR1 Q9EGR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG92 Q9EG92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG91 Q9EG91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG90 Q9EG90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG89 Q9EG89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG88 Q9EG88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG87 Q9EG87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG86 Q9EG86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG85 Q9EG85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG83 Q9EG83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG71 Q9EG71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG65 Q9EG65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG61 Q9EG61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG59 Q9EG59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG55 Q9EG55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG54 Q9EG54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG53 Q9EG53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG52 Q9EG52]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG51 Q9EG51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG49 Q9EG49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG43 Q9EG43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EG42 Q9EG42]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFW0 Q9EFW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFS8 Q9EFS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFS4 Q9EFS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFS1 Q9EFS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFR9 Q9EFR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFJ5 Q9EFJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFA0 Q9EFA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF73 Q9EF73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF72 Q9EF72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF63 Q9EF63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF60 Q9EF60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF59 Q9EF59]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF58 Q9EF58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF55 Q9EF55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF49 Q9EF49]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF44 Q9EF44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF39 Q9EF39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF35 Q9EF35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF32 Q9EF32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF30 Q9EF30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF25 Q9EF25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF23 Q9EF23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF21 Q9EF21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF20 Q9EF20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF19 Q9EF19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF14 Q9EF14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF11 Q9EF11]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF10 Q9EF10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF09 Q9EF09]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEY9 Q9EEY9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEY8 Q9EEY8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEY5 Q9EEY5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEW9 Q9EEW9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEW6 Q9EEW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEU1 Q9EEU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEJ9 Q9EEJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEI8 Q9EEI8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEH7 Q9EEH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEF5 Q9EEF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EED6 Q9EED6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EED4 Q9EED4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EED0 Q9EED0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEB4 Q9EEB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEB2 Q9EEB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE96 Q9EE96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE87 Q9EE87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE80 Q9EE80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE72 Q9EE72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE70 Q9EE70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE65 Q9EE65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE61 Q9EE61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE56 Q9EE56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE53 Q9EE53]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE40 Q9EE40]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE23 Q9EE23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE21 Q9EE21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDL8 Q9EDL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDL7 Q9EDL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDL6 Q9EDL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDL3 Q9EDL3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDL0 Q9EDL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDK9 Q9EDK9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDK6 Q9EDK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDK5 Q9EDK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDK1 Q9EDK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDK0 Q9EDK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDJ7 Q9EDJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDJ5 Q9EDJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDI8 Q9EDI8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDI6 Q9EDI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDI3 Q9EDI3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDI1 Q9EDI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDI0 Q9EDI0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDH9 Q9EDH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDH6 Q9EDH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDH4 Q9EDH4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDH3 Q9EDH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDH2 Q9EDH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDH1 Q9EDH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDG9 Q9EDG9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDG8 Q9EDG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDG7 Q9EDG7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDG6 Q9EDG6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDG3 Q9EDG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDG1 Q9EDG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDF7 Q9EDF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDF3 Q9EDF3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDF2 Q9EDF2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDE7 Q9EDE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EDE6 Q9EDE6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED04 Q9ED04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED03 Q9ED03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED02 Q9ED02]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED01 Q9ED01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECZ7 Q9ECZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECZ6 Q9ECZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECZ4 Q9ECZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECZ3 Q9ECZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECZ1 Q9ECZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECZ0 Q9ECZ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECU8 Q9ECU8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECJ3 Q9ECJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECH6 Q9ECH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECH4 Q9ECH4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECG7 Q9ECG7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECG5 Q9ECG5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECG4 Q9ECG4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECG1 Q9ECG1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECF6 Q9ECF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECE0 Q9ECE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC87 Q9EC87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC85 Q9EC85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC83 Q9EC83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC66 Q9EC66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC65 Q9EC65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC61 Q9EC61]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC60 Q9EC60]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC38 Q9EC38]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC36 Q9EC36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC35 Q9EC35]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC34 Q9EC34]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC33 Q9EC33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC28 Q9EC28]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC27 Q9EC27]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC26 Q9EC26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC23 Q9EC23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC22 Q9EC22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC21 Q9EC21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC20 Q9EC20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC19 Q9EC19]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC18 Q9EC18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC17 Q9EC17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC16 Q9EC16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC15 Q9EC15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC07 Q9EC07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBU1 Q9EBU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBP1 Q9EBP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBP0 Q9EBP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBN9 Q9EBN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBN5 Q9EBN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBN4 Q9EBN4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBN3 Q9EBN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBN2 Q9EBN2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBN1 Q9EBN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBN0 Q9EBN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM6 Q9EBM6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM3 Q9EBM3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM2 Q9EBM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBM0 Q9EBM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL1 Q9EBL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBL0 Q9EBL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK8 Q9EBK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBK6 Q9EBK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBJ2 Q9EBJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBJ1 Q9EBJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBJ0 Q9EBJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBI9 Q9EBI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBI7 Q9EBI7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBI6 Q9EBI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBI1 Q9EBI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBH9 Q9EBH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBH3 Q9EBH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBH2 Q9EBH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBH0 Q9EBH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBG9 Q9EBG9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBG8 Q9EBG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBG7 Q9EBG7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBG3 Q9EBG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBG2 Q9EBG2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBG0 Q9EBG0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBF7 Q9EBF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBF6 Q9EBF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBF3 Q9EBF3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBD9 Q9EBD9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBD8 Q9EBD8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBD5 Q9EBD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBB4 Q9EBB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBA3 Q9EBA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBA1 Q9EBA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBA0 Q9EBA0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB99 Q9EB99]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB98 Q9EB98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB97 Q9EB97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB96 Q9EB96]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB94 Q9EB94]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB93 Q9EB93]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB92 Q9EB92]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB91 Q9EB91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB89 Q9EB89]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB88 Q9EB88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB87 Q9EB87]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB86 Q9EB86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB85 Q9EB85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB83 Q9EB83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB81 Q9EB81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB79 Q9EB79]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB77 Q9EB77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB76 Q9EB76]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB75 Q9EB75]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB74 Q9EB74]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB73 Q9EB73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB72 Q9EB72]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB71 Q9EB71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB70 Q9EB70]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB69 Q9EB69]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB68 Q9EB68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB67 Q9EB67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EB66 Q9EB66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q999D1 Q999D1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T25 Q90T25]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90T15 Q90T15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90RX8 Q90RX8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MS8 Q90MS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MS7 Q90MS7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MS5 Q90MS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MS1 Q90MS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MQ1 Q90MQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MP7 Q90MP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90M30 Q90M30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LS4 Q90LS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI6 Q90LI6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90LI5 Q90LI5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IZ5 Q90IZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90IJ0 Q90IJ0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90HW5 Q90HW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90H22 Q90H22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90GD6 Q90GD6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90F54 Q90F54]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DB5 Q90DB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DB3 Q90DB3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DA9 Q90DA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90DA8 Q90DA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D84 Q90D84]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909T4 Q909T4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909T3 Q909T3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909T2 Q909T2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909S8 Q909S8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909S6 Q909S6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909S0 Q909S0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q909R8 Q909R8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904Q1 Q904Q1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904P5 Q904P5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904K6 Q904K6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904I7 Q904I7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904E0 Q904E0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904D3 Q904D3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904D1 Q904D1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UNP5 Q8UNP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QBR8 Q8QBR8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8QA77 Q8QA77]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8Y7 Q8Q8Y7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X6 Q8Q8X6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q8X3 Q8Q8X3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3I3 Q8Q3I3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3I2 Q8Q3I2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3G3 Q8Q3G3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3G1 Q8Q3G1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8Q3F8 Q8Q3F8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JD04 Q8JD04]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCW5 Q8JCW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCT2 Q8JCT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCS2 Q8JCS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCR7 Q8JCR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCR3 Q8JCR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB91 Q8JB91]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB90 Q8JB90]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB88 Q8JB88]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB81 Q8JB81]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB80 Q8JB80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB73 Q8JB73]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB68 Q8JB68]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB66 Q8JB66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB65 Q8JB65]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB63 Q8JB63]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB62 Q8JB62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB58 Q8JB58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB51 Q8JB51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB44 Q8JB44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB43 Q8JB43]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB42 Q8JB42]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB30 Q8JB30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB23 Q8JB23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB22 Q8JB22]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB21 Q8JB21]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB17 Q8JB17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB14 Q8JB14]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB02 Q8JB02]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAZ9 Q8JAZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAZ7 Q8JAZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAZ6 Q8JAZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAZ5 Q8JAZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAZ3 Q8JAZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J853 Q8J853]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8J824 Q8J824]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AM30 Q8AM30]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AM23 Q8AM23]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AF67 Q8AF67]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89965 Q89965]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89964 Q89964]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89958 Q89958]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89957 Q89957]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89956 Q89956]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89952 Q89952]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92062 O92062]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89959 Q89959]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89961 Q89961]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89960 Q89960]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89962 Q89962]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89963 Q89963]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECI5 Q9ECI5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED55 Q9ED55]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90D82 Q90D82]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JAY5 Q8JAY5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECJ2 Q9ECJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJW6 Q9EJW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELQ5 Q9ELQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELQ4 Q9ELQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELQ2 Q9ELQ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELQ1 Q9ELQ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP9 Q9ELP9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP8 Q9ELP8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP7 Q9ELP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP6 Q9ELP6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP5 Q9ELP5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP4 Q9ELP4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP3 Q9ELP3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP2 Q9ELP2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELP1 Q9ELP1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELN9 Q9ELN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELN8 Q9ELN8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELN7 Q9ELN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELN6 Q9ELN6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELN5 Q9ELN5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELH7 Q9ELH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELH3 Q9ELH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ELH0 Q9ELH0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL85 Q9EL85]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL83 Q9EL83]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EL80 Q9EL80]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EK78 Q9EK78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EK37 Q9EK37]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJE4 Q9EJE4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJC9 Q9EJC9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJC7 Q9EJC7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJC4 Q9EJC4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJC1 Q9EJC1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJC0 Q9EJC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJB8 Q9EJB8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJB5 Q9EJB5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJA9 Q9EJA9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJA8 Q9EJA8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJA5 Q9EJA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EJA4 Q9EJA4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIS4 Q9EIS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIR9 Q9EIR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIR7 Q9EIR7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIR3 Q9EIR3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIP7 Q9EIP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIJ2 Q9EIJ2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EII1 Q9EII1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIH8 Q9EIH8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIH7 Q9EIH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIH6 Q9EIH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIH5 Q9EIH5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIH2 Q9EIH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EIG8 Q9EIG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHK7 Q9EHK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHK4 Q9EHK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHJ6 Q9EHJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHJ4 Q9EHJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHJ3 Q9EHJ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHI9 Q9EHI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHI5 Q9EHI5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EHI2 Q9EHI2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EH12 Q9EH12]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGZ9 Q9EGZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGL2 Q9EGL2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGL1 Q9EGL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EGJ8 Q9EGJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFT5 Q9EFT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFT4 Q9EFT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EFR5 Q9EFR5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EF01 Q9EF01]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEZ5 Q9EEZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEX0 Q9EEX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEW5 Q9EEW5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEU4 Q9EEU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEU3 Q9EEU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEU2 Q9EEU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEU0 Q9EEU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EET9 Q9EET9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EET8 Q9EET8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EET7 Q9EET7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EET6 Q9EET6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EET5 Q9EET5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EET4 Q9EET4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEL8 Q9EEL8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EEF4 Q9EEF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EE66 Q9EE66]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED51 Q9ED51]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED50 Q9ED50]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED39 Q9ED39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED36 Q9ED36]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ED08 Q9ED08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECT2 Q9ECT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECT0 Q9ECT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECS9 Q9ECS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECS3 Q9ECS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECR6 Q9ECR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECR1 Q9ECR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECK0 Q9ECK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECJ9 Q9ECJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECJ8 Q9ECJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECJ4 Q9ECJ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECI3 Q9ECI3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECI1 Q9ECI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECG6 Q9ECG6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECF7 Q9ECF7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECF0 Q9ECF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECE9 Q9ECE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECE8 Q9ECE8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECE3 Q9ECE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECE1 Q9ECE1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ECD9 Q9ECD9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EC58 Q9EC58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBT6 Q9EBT6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBT4 Q9EBT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBT3 Q9EBT3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBT1 Q9EBT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBS9 Q9EBS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBS5 Q9EBS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBS4 Q9EBS4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9EBS2 Q9EBS2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E408 Q9E408]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E407 Q9E407]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E400 Q9E400]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E347 Q9E347]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90MR9 Q90MR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q904K9 Q904K9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCZ6 Q8JCZ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCX2 Q8JCX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCX1 Q8JCX1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCV7 Q8JCV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCU9 Q8JCU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JCT1 Q8JCT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JBA2 Q8JBA2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB86 Q8JB86]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB71 Q8JB71]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB56 Q8JB56]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB33 Q8JB33]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB24 Q8JB24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB07 Q8JB07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JB03 Q8JB03]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89950 Q89950]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89943 Q89943]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05532 Q05532]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q95SX7 Q95SX7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M271 Q7M271]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72861 Q72861]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72862 Q72862]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72863 Q72863]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72864 Q72864]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72865 Q72865]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72867 Q72867]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72868 Q72868]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DP10 Q9DP10]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W830 Q9W830]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9QQH6 Q9QQH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ILN9 Q9ILN9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ILN0 Q9ILN0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E9X0 Q9E9X0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E9W9 Q9E9W9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E9W8 Q9E9W8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E9W7 Q9E9W7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E9W6 Q9E9W6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3M7 Q9E3M7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DP32 Q9DP32]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DP18 Q9DP18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DP17 Q9DP17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DP15 Q9DP15]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DP07 Q9DP07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DP06 Q9DP06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DP00 Q9DP00]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNZ9 Q9DNZ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNZ4 Q9DNZ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNZ3 Q9DNZ3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNX6 Q9DNX6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNX4 Q9DNX4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNX2 Q9DNX2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNW7 Q9DNW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNW1 Q9DNW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNW0 Q9DNW0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNV9 Q9DNV9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNV8 Q9DNV8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNV6 Q9DNV6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNV5 Q9DNV5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNV3 Q9DNV3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNV1 Q9DNV1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNV0 Q9DNV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNU9 Q9DNU9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNU7 Q9DNU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNU6 Q9DNU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNU4 Q9DNU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNU3 Q9DNU3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNU2 Q9DNU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNU0 Q9DNU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNT7 Q9DNT7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNT3 Q9DNT3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNT2 Q9DNT2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNT1 Q9DNT1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNT0 Q9DNT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNS6 Q9DNS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNS5 Q9DNS5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNS3 Q9DNS3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNS1 Q9DNS1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNK0 Q9DNK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNJ9 Q9DNJ9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9DNI9 Q9DNI9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EU4 Q90EU4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90EU2 Q90EU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903S8 Q903S8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q903Q6 Q903Q6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UNW1 Q8UNW1]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36741 O36741]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72870 Q72870]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72872 Q72872]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72887 Q72887]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72873 Q72873]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72875 Q72875]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72876 Q72876]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72877 Q72877]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72878 Q72878]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72879 Q72879]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72880 Q72880]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72881 Q72881]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72882 Q72882]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3X0 Q9E3X0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E3W9 Q9E3W9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9E340 Q9E340]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8UNQ5 Q8UNQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/O92118 O92118]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72884 Q72884]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72885 Q72885]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q72886 Q72886]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SIS9 Q9SIS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRK7 Q9ZRK7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRK6 Q9ZRK6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRK5 Q9ZRK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00068 Q00068]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00066 Q00066]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00067 Q00067]
| + | |
− | ** [http://www.uniprot.org/uniprot/O64428 O64428]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRL6 Q9ZRL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/O64386 O64386]
| + | |
− | ** [http://www.uniprot.org/uniprot/O64388 O64388]
| + | |
− | ** [http://www.uniprot.org/uniprot/O64389 O64389]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRK4 Q9ZRK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRK3 Q9ZRK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRK8 Q9ZRK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03278 Q03278]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q85521 Q85521]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96420 Q96420]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96421 Q96421]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96422 Q96422]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04013 O04013]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRL1 Q9ZRL1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRL0 Q9ZRL0]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22674 O22674]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22675 O22675]
| + | |
− | ** [http://www.uniprot.org/uniprot/O44323 O44323]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=tick_transposon}} | + | |
− | {{#set: common name=pol-like_protein}} | + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: common name=polyprotein}} | + | |
− | {{#set: common name=astrotactin-2-_partial}}
| + | |
− | {{#set: ec number=EC-2.7.7.49}}
| + | |
− | {{#set: gene associated=Tiso_gene_9299|Tiso_gene_19787|Tiso_gene_13149|Tiso_gene_16363|Tiso_gene_17913|Tiso_gene_12839|Tiso_gene_11396|Tiso_gene_16466|Tiso_gene_10914|Tiso_gene_13740|Tiso_gene_20543|Tiso_gene_2320|Tiso_gene_6741|Tiso_gene_13368|Tiso_gene_17558|Tiso_gene_1846}} | + | |
− | {{#set: in pathway=}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=in-silico_annotation}}
| + | |