Difference between revisions of "CPD-637"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.140-RXN 2.7.1.140-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == * smiles: ** CC1(C(=C(C=CC=1)O)C([O-])=O) * common name: ** 6-methylsalicyl...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(C(=C(C=CC=1)O)C([O-])=O) |
− | * | + | * common name: |
− | ** | + | ** 6-methylsalicylate |
+ | * inchi key: | ||
+ | ** InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 151.141 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Methylsalicylic acid | ||
+ | ** 6-Methyl 2-hydroxybenzenecarboxylate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.3.1.165-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54693536 54693536] |
− | * LIGAND- | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.chemspider.com/Chemical-Structure.5342108.html 5342108] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36658 36658] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02657 C02657] |
− | {{#set: | + | {{#set: smiles=CC1(C(=C(C=CC=1)O)C([O-])=O)}} |
− | {{#set: | + | {{#set: common name=6-methylsalicylate}} |
+ | {{#set: inchi key=InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=151.141 }} | ||
+ | {{#set: common name=Methylsalicylic acid|6-Methyl 2-hydroxybenzenecarboxylate}} | ||
+ | {{#set: produced by=2.3.1.165-RXN}} |
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite CPD-637
- smiles:
- CC1(C(=C(C=CC=1)O)C([O-])=O)
- common name:
- 6-methylsalicylate
- inchi key:
- InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
- molecular weight:
- 151.141
- Synonym(s):
- Methylsalicylic acid
- 6-Methyl 2-hydroxybenzenecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C(=C(C=CC=1)O)C([O-])=O)" cannot be used as a page name in this wiki.