Difference between revisions of "CPD-637"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.140-RXN 2.7.1.140-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == * smiles: ** CC1(C(=C(C=CC=1)O)C([O-])=O) * common name: ** 6-methylsalicyl...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.140-RXN 2.7.1.140-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC1(C(=C(C=CC=1)O)C([O-])=O)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.7.1.140 EC-2.7.1.140]
+
** 6-methylsalicylate
 +
* inchi key:
 +
** InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 151.141   
 
* Synonym(s):
 
* Synonym(s):
 +
** Methylsalicylic acid
 +
** 6-Methyl 2-hydroxybenzenecarboxylate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[CPD-505]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-1107]][c] '''+''' 1 [[PROTON]][c]
+
* [[2.3.1.165-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 D-myo-inositol (1,3,4,6)-tetrakisphosphate[c] '''=>''' 1 ADP[c] '''+''' 1 D-myo-inositol 1,3,4,5,6-pentakisphosphate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6366]], D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6372]], 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6365]], D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6365 PWY-6365]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12717 12717]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54693536 54693536]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03478 R03478]
+
** [http://www.chemspider.com/Chemical-Structure.5342108.html 5342108]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-2.7.1.140}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36658 36658]
−
{{#set: in pathway=PWY-6366|PWY-6372|PWY-6365|PWY-6362|PWY-6554}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02657 C02657]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC1(C(=C(C=CC=1)O)C([O-])=O)}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=6-methylsalicylate}}
 +
{{#set: inchi key=InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=151.141    }}
 +
{{#set: common name=Methylsalicylic acid|6-Methyl 2-hydroxybenzenecarboxylate}}
 +
{{#set: produced by=2.3.1.165-RXN}}

Latest revision as of 20:12, 21 March 2018

Metabolite CPD-637

  • smiles:
    • CC1(C(=C(C=CC=1)O)C([O-])=O)
  • common name:
    • 6-methylsalicylate
  • inchi key:
    • InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
  • molecular weight:
    • 151.141
  • Synonym(s):
    • Methylsalicylic acid
    • 6-Methyl 2-hydroxybenzenecarboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(C(=C(C=CC=1)O)C([O-])=O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-637&oldid=46781"