Difference between revisions of "Tiso gene 14568"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * smiles: ** CCC=CCC1(C(=O)CCC1CC([O-])=O) * inchi key: ** InChIKey=ZNJFBWY...")
(Created page with "Category:Gene == Gene Tiso_gene_14568 == * right end position: ** 5471 * transcription direction: ** NEGATIVE * left end position: ** 3430 * centisome position: ** 61.6795...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] ==
+
== Gene Tiso_gene_14568 ==
* smiles:
+
* right end position:
** CCC=CCC1(C(=O)CCC1CC([O-])=O)
+
** 5471
* inchi key:
+
* transcription direction:
** InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M
+
** NEGATIVE
* common name:
+
* left end position:
** (+)-7-iso-jasmonate
+
** 3430
* molecular weight:
+
* centisome position:
** 209.264    
+
** 61.679554    
 
* Synonym(s):
 
* Synonym(s):
** (+)-7-iso-jasmonic acid
 
** iso-jasmonic acid
 
** (3R,7S)-(+)-7-iso-jasmonate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[F16ALDOLASE-RXN]]
* [[RXN-10708]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-8631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[SEDOBISALDOL-RXN]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY66-399]]
 +
* [[PWY66-373]]
 +
* [[SUCSYN-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-7385]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[CALVIN-PWY]]
 +
* [[PWY0-1517]]
 +
* [[PWY-1861]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[P185-PWY]]
 +
* [[GLUCONEO-PWY]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMFA02020003
+
{{#set: right end position=5471}}
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7251182 7251182]
+
{{#set: left end position=3430}}
* CHEMSPIDER:
+
{{#set: centisome position=61.679554   }}
** [http://www.chemspider.com/Chemical-Structure.5584838.html 5584838]
+
{{#set: reaction associated=F16ALDOLASE-RXN|RXN-8631|SEDOBISALDOL-RXN}}
* CHEBI:
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY66-399|PWY66-373|SUCSYN-PWY|GLYCOLYSIS|PWY-7385|ANAGLYCOLYSIS-PWY|CALVIN-PWY|PWY0-1517|PWY-1861|PWY-6142|PWY-5484|P185-PWY|GLUCONEO-PWY}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18435 18435]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16317 C16317]
+
{{#set: smiles=CCC=CCC1(C(=O)CCC1CC([O-])=O)}}
+
{{#set: inchi key=InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M}}
+
{{#set: common name=(+)-7-iso-jasmonate}}
+
{{#set: molecular weight=209.264   }}
+
{{#set: common name=(+)-7-iso-jasmonic acid|iso-jasmonic acid|(3R,7S)-(+)-7-iso-jasmonate}}
+
{{#set: produced by=RXN-10708}}
+

Latest revision as of 20:12, 21 March 2018

Gene Tiso_gene_14568

  • right end position:
    • 5471
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3430
  • centisome position:
    • 61.679554
  • Synonym(s):

Reactions associated

Pathways associated

External links