Difference between revisions of "CD-2S-SP-Complex"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTOSINE CYTOSINE] == * smiles: ** C1(NC(=O)N=C(N)C=1) * inchi key: ** InChIKey=OPTASPLRGRRNAP-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-2S-SP-Complex CD-2S-SP-Complex] == * common name: ** a [cysteine desulfurase]-(S-sulfanyl)2-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTOSINE CYTOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-2S-SP-Complex CD-2S-SP-Complex] ==
* smiles:
+
** C1(NC(=O)N=C(N)C=1)
+
* inchi key:
+
** InChIKey=OPTASPLRGRRNAP-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** cytosine
+
** a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex
* molecular weight:
+
** 111.103   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-amino-2-oxo-1,2-dihydropyrimidine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14387]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14065]]
+
* [[RXN-14386]]
* [[RXN0-361]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 71-30-7
+
{{#set: common name=a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex}}
* METABOLIGHTS : MTBLC16040
+
{{#set: consumed by=RXN-14387}}
* PUBCHEM:
+
{{#set: produced by=RXN-14386}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=597 597]
+
* HMDB : HMDB00630
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00380 C00380]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.577.html 577]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16040 16040]
+
* BIGG : csn
+
{{#set: smiles=C1(NC(=O)N=C(N)C=1)}}
+
{{#set: inchi key=InChIKey=OPTASPLRGRRNAP-UHFFFAOYSA-N}}
+
{{#set: common name=cytosine}}
+
{{#set: molecular weight=111.103    }}
+
{{#set: common name=4-amino-2-oxo-1,2-dihydropyrimidine}}
+
{{#set: produced by=RXN-14065|RXN0-361}}
+

Latest revision as of 20:12, 21 March 2018

Metabolite CD-2S-SP-Complex

  • common name:
    • a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex" cannot be used as a page name in this wiki.