Difference between revisions of "Tiso gene 2786"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] == * smiles: ** CSCCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=MJGXIOUQXYX...")
(Created page with "Category:Gene == Gene Tiso_gene_2786 == * Synonym(s): == Reactions associated == * Reaction: RXN0-2023 ** Source: orthology-esiliculosus == Pathways associated ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] ==
+
== Gene Tiso_gene_2786 ==
* smiles:
+
** CSCCCCCCCC(=O)C([O-])=O
+
* inchi key:
+
** InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
+
* common name:
+
** 9-(methylthio)-2-oxononanoate
+
* molecular weight:
+
** 217.302   
+
 
* Synonym(s):
 
* Synonym(s):
** 9-(methylthio)-2-oxononanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-2023]]
* [[RXN-18203]]
+
** Source: [[orthology-esiliculosus]]
* [[RXNQT-4174]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN0-2023}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237169 44237169]
+
* KNAPSACK : C00007654
+
{{#set: smiles=CSCCCCCCCC(=O)C([O-])=O}}
+
{{#set: inchi key=InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M}}
+
{{#set: common name=9-(methylthio)-2-oxononanoate}}
+
{{#set: molecular weight=217.302    }}
+
{{#set: common name=9-(methylthio)-2-oxononanoic acid}}
+
{{#set: produced by=RXN-18203|RXNQT-4174}}
+

Latest revision as of 20:12, 21 March 2018

Gene Tiso_gene_2786

  • Synonym(s):

Reactions associated

Pathways associated

External links