Difference between revisions of "Uracil-54-in-tRNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * inchi key: ** InChIKey=AAW...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] == * common name: ** a uracil54 in tRNA * Synonym(s): ** a...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] ==
−
* smiles:
+
−
** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
+
−
* inchi key:
+
−
** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
+
 
* common name:
 
* common name:
−
** L-quinate
+
** a uracil54 in tRNA
−
* molecular weight:
+
−
** 191.16   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (-)-quinic acid
+
** a tRNA containing uracil at position 54
−
** (-)-quinate
+
** a tRNA uracil54
−
** (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[QUINATE-5-DEHYDROGENASE-RXN]]
+
* [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
−
* [[RXN-7967]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 77-95-2
+
{{#set: common name=a uracil54 in tRNA}}
−
* PUBCHEM:
+
{{#set: common name=a tRNA containing uracil at position 54|a tRNA uracil54}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034]
+
{{#set: consumed by=TRNA-URACIL-5--METHYLTRANSFERASE-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296]
+
−
{{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}}
+
−
{{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}}
+
−
{{#set: common name=L-quinate}}
+
−
{{#set: molecular weight=191.16    }}
+
−
{{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}}
+
−
{{#set: consumed by=QUINATE-5-DEHYDROGENASE-RXN|RXN-7967}}
+

Latest revision as of 20:12, 21 March 2018

Metabolite Uracil-54-in-tRNA

  • common name:
    • a uracil54 in tRNA
  • Synonym(s):
    • a tRNA containing uracil at position 54
    • a tRNA uracil54

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Uracil-54-in-tRNA&oldid=46803"