Difference between revisions of "Uracil-54-in-tRNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * common name:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] == * common name: ** a uracil54 in tRNA * Synonym(s): ** a...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] ==
* smiles:
+
** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
+
 
* common name:
 
* common name:
** phytyl monophosphate
+
** a uracil54 in tRNA
* inchi key:
+
** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
+
* molecular weight:
+
** 374.499   
+
 
* Synonym(s):
 
* Synonym(s):
** phytolmonophosphate
+
** a tRNA containing uracil at position 54
 +
** a tRNA uracil54
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7683]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a uracil54 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113]
+
{{#set: common name=a tRNA containing uracil at position 54|a tRNA uracil54}}
* CHEBI:
+
{{#set: consumed by=TRNA-URACIL-5--METHYLTRANSFERASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483]
+
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}}
+
{{#set: common name=phytyl monophosphate}}
+
{{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}}
+
{{#set: molecular weight=374.499    }}
+
{{#set: common name=phytolmonophosphate}}
+
{{#set: produced by=RXN-7683}}
+

Latest revision as of 20:12, 21 March 2018

Metabolite Uracil-54-in-tRNA

  • common name:
    • a uracil54 in tRNA
  • Synonym(s):
    • a tRNA containing uracil at position 54
    • a tRNA uracil54

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links