Difference between revisions of "Tiso gene 17287"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] == * smiles: ** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])...")
(Created page with "Category:Gene == Gene Tiso_gene_17287 == * right end position: ** 3640 * transcription direction: ** NEGATIVE * left end position: ** 734 * centisome position: ** 19.29040...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] ==
+
== Gene Tiso_gene_17287 ==
−
* smiles:
+
* right end position:
−
** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))
+
** 3640
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** uroporphyrinogen-I
+
** 734
−
* molecular weight:
+
* centisome position:
−
** 828.742    
+
** 19.290407    
 
* Synonym(s):
 
* Synonym(s):
−
** uroporphyrinogen I
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GCVP-RXN]]
−
* [[RXN-14396]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[GCVT-RXN]]
−
* [[RXN-10642]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-6321]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[GLYCINE-SYN2-PWY]]
 +
* [[GLYCLEAV-PWY]]
 +
* [[PWY-3841]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3640}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201940 25201940]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=734}}
−
** [http://www.chemspider.com/Chemical-Structure.389644.html 389644]
+
{{#set: centisome position=19.290407   }}
−
* CHEBI:
+
{{#set: reaction associated=GCVP-RXN|GCVT-RXN|RXN-6321}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62626 62626]
+
{{#set: pathway associated=GLYCINE-SYN2-PWY|GLYCLEAV-PWY|PWY-3841}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05766 C05766]
+
−
* HMDB : HMDB02211
+
−
{{#set: smiles=C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))}}
+
−
{{#set: inchi key=InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F}}
+
−
{{#set: common name=uroporphyrinogen-I}}
+
−
{{#set: molecular weight=828.742   }}
+
−
{{#set: common name=uroporphyrinogen I}}
+
−
{{#set: produced by=RXN-14396}}
+
−
{{#set: reversible reaction associated=RXN-10642}}
+

Latest revision as of 21:12, 21 March 2018

Gene Tiso_gene_17287

  • right end position:
    • 3640
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 734
  • centisome position:
    • 19.290407
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17287&oldid=46809"