Difference between revisions of "Tiso gene 2631"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-881 CPD-881] == * smiles: ** CC(C=CC1(=C(CCCC1(C)C)C))=CC=CC(=CC=O)C * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_2631 == * right end position: ** 18267 * transcription direction: ** NEGATIVE * left end position: ** 14517 * centisome position: ** 77.626...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2631 == |
− | * | + | * right end position: |
− | ** | + | ** 18267 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 14517 |
− | * | + | * centisome position: |
− | ** | + | ** 77.62687 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12195]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12196]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN0-5462]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7210]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=18267}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=14517}} | |
− | + | {{#set: centisome position=77.62687 }} | |
− | + | {{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} | |
− | + | {{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_2631
- right end position:
- 18267
- transcription direction:
- NEGATIVE
- left end position:
- 14517
- centisome position:
- 77.62687
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: NUCLEOSIDE-TRIPHOSPHATASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12195
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12196
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-5462
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation