Difference between revisions of "CPD1F-120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] == * direction: ** REVERSIBLE * common name: ** galactose-3-o-sulfotransferase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 
* common name:
 
* common name:
−
** galactose-3-o-sulfotransferase_2-like
+
** gibberellin A24
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11]
+
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
 +
* molecular weight:
 +
** 344.407   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA24
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PAPS]][c] '''+''' 1 [[1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[Seminolipids]][c] '''+''' 1 [[3-5-ADP]][c]
+
* [[RXN1F-163]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 a 1-O-alkyl-2-O-acyl-3-O-&beta;-D-galactosyl-sn-glycerol[c] '''<=>''' 1 H+[c] '''+''' 1 a seminolipid[c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13030]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=galactose-3-o-sulfotransferase_2-like}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
−
{{#set: ec number=EC-2.8.2.11}}
+
* HMDB : HMDB37103
−
{{#set: gene associated=Tiso_gene_13030}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A24}}
 +
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
 +
{{#set: molecular weight=344.407    }}
 +
{{#set: common name=GA24}}
 +
{{#set: produced by=RXN1F-163}}

Latest revision as of 20:12, 21 March 2018

Metabolite CPD1F-120

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • common name:
    • gibberellin A24
  • inchi key:
    • InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
  • molecular weight:
    • 344.407
  • Synonym(s):
    • GA24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-120&oldid=46814"