Difference between revisions of "CPD1F-120"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Thioredoxin Red-Thioredoxin] == * common name: ** a reduced thioredoxin * Synonym(s): == R...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == |
| + | * smiles: | ||
| + | ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) | ||
* common name: | * common name: | ||
| − | ** | + | ** gibberellin A24 |
| + | * inchi key: | ||
| + | ** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L | ||
| + | * molecular weight: | ||
| + | ** 344.407 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** GA24 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-163]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232] |
| − | {{#set: | + | * HMDB : HMDB37103 |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861] | ||
| + | {{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} | ||
| + | {{#set: common name=gibberellin A24}} | ||
| + | {{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}} | ||
| + | {{#set: molecular weight=344.407 }} | ||
| + | {{#set: common name=GA24}} | ||
| + | {{#set: produced by=RXN1F-163}} | ||
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite CPD1F-120
- smiles:
- C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- common name:
- gibberellin A24
- inchi key:
- InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
- molecular weight:
- 344.407
- Synonym(s):
- GA24
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.
