Difference between revisions of "L-DOPACHROME"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18238 == * left end position: ** 603 * transcription direction: ** POSITIVE * right end position: ** 1404 * centisome position: ** 19.14893...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == * smiles: ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) * common na...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) |
| − | * | + | * common name: |
| − | ** | + | ** L-dopachrome |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 192.151 |
* Synonym(s): | * Synonym(s): | ||
| + | ** indole-5,6-quinoneimine | ||
| + | ** dopachrome | ||
| + | ** 2-L-carboxy-2,3-dihydroindole-5,6-quinone | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11403]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-11369]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01693 C01693] |
| − | {{#set: | + | * HMDB : HMDB01430 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57509 57509] |
| + | * METABOLIGHTS : MTBLC57509 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173181 46173181] | ||
| + | {{#set: smiles=C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))}} | ||
| + | {{#set: common name=L-dopachrome}} | ||
| + | {{#set: inchi key=InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M}} | ||
| + | {{#set: molecular weight=192.151 }} | ||
| + | {{#set: common name=indole-5,6-quinoneimine|dopachrome|2-L-carboxy-2,3-dihydroindole-5,6-quinone}} | ||
| + | {{#set: consumed by=RXN-11403}} | ||
| + | {{#set: produced by=RXN-11369}} | ||
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite L-DOPACHROME
- smiles:
- C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))
- common name:
- L-dopachrome
- inchi key:
- InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M
- molecular weight:
- 192.151
- Synonym(s):
- indole-5,6-quinoneimine
- dopachrome
- 2-L-carboxy-2,3-dihydroindole-5,6-quinone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))" cannot be used as a page name in this wiki.
