Difference between revisions of "L-DOPACHROME"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14568 == * left end position: ** 3430 * transcription direction: ** NEGATIVE * right end position: ** 5471 * centisome position: ** 61.6795...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == * smiles: ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) * common na...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == |
− | * | + | * smiles: |
− | ** | + | ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) |
− | * | + | * common name: |
− | ** | + | ** L-dopachrome |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 192.151 |
* Synonym(s): | * Synonym(s): | ||
+ | ** indole-5,6-quinoneimine | ||
+ | ** dopachrome | ||
+ | ** 2-L-carboxy-2,3-dihydroindole-5,6-quinone | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11403]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11369]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01693 C01693] |
− | {{#set: | + | * HMDB : HMDB01430 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57509 57509] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57509 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173181 46173181] | ||
+ | {{#set: smiles=C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))}} | ||
+ | {{#set: common name=L-dopachrome}} | ||
+ | {{#set: inchi key=InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M}} | ||
+ | {{#set: molecular weight=192.151 }} | ||
+ | {{#set: common name=indole-5,6-quinoneimine|dopachrome|2-L-carboxy-2,3-dihydroindole-5,6-quinone}} | ||
+ | {{#set: consumed by=RXN-11403}} | ||
+ | {{#set: produced by=RXN-11369}} |
Latest revision as of 21:12, 21 March 2018
Contents
Metabolite L-DOPACHROME
- smiles:
- C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))
- common name:
- L-dopachrome
- inchi key:
- InChIKey=VJNCICVKUHKIIV-LURJTMIESA-M
- molecular weight:
- 192.151
- Synonym(s):
- indole-5,6-quinoneimine
- dopachrome
- 2-L-carboxy-2,3-dihydroindole-5,6-quinone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2))" cannot be used as a page name in this wiki.