Difference between revisions of "ADENOSINE-NUCLEOSIDASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE GLUTATHIONE] == * smiles: ** C(S)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE-NUCLEOSIDASE-RXN ADENOSINE-NUCLEOSIDASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE-NUCLEOSIDASE-RXN ADENOSINE-NUCLEOSIDASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** inosine-uridine_preferring_nucleoside_hydrolase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.2.7 EC-3.2.2.7] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * [[ | + | ** 1 [[ADENOSINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADENINE]][c] '''+''' 1 [[D-Ribofuranose]][c] |
− | + | * With common name(s): | |
− | + | ** 1 adenosine[c] '''+''' 1 H2O[c] '''=>''' 1 adenine[c] '''+''' 1 D-ribofuranose[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Tiso_gene_9396]] | |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | + | == Pathways == | |
− | + | * [[PWY-6605]], adenine and adenosine salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6605 PWY-6605] | |
− | == | + | ** '''1''' reactions found over '''2''' reactions in the full pathway |
− | + | == Reconstruction information == | |
− | * [[ | + | * Category: [[annotation]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Tool: [[pathwaytools]] |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18669 18669] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01245 R01245] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=inosine-uridine_preferring_nucleoside_hydrolase}} | |
− | * LIGAND- | + | {{#set: ec number=EC-3.2.2.7}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Tiso_gene_9396}} |
− | + | {{#set: in pathway=PWY-6605}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:12, 21 March 2018
Contents
Reaction ADENOSINE-NUCLEOSIDASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- inosine-uridine_preferring_nucleoside_hydrolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ADENOSINE[c] + 1 WATER[c] => 1 ADENINE[c] + 1 D-Ribofuranose[c]
- With common name(s):
- 1 adenosine[c] + 1 H2O[c] => 1 adenine[c] + 1 D-ribofuranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9396
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-6605, adenine and adenosine salvage II: PWY-6605
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links