Difference between revisions of "Tiso gene 17880"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * inchi key: ** InChIKey=NJMGRJ...") |
(Created page with "Category:Gene == Gene Tiso_gene_17880 == * right end position: ** 2493 * transcription direction: ** POSITIVE * left end position: ** 211 * centisome position: ** 6.200411...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17880 == |
− | * | + | * right end position: |
− | ** | + | ** 2493 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 211 |
− | * | + | * centisome position: |
− | ** | + | ** 6.2004113 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.4.2.31-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[3 | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[3.5.1.98-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2493}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=211}} | |
− | + | {{#set: centisome position=6.2004113 }} | |
− | + | {{#set: reaction associated=2.4.2.31-RXN|3.5.1.98-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:12, 21 March 2018
Gene Tiso_gene_17880
- right end position:
- 2493
- transcription direction:
- POSITIVE
- left end position:
- 211
- centisome position:
- 6.2004113
- Synonym(s):
Reactions associated
- Reaction: 2.4.2.31-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: 3.5.1.98-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation