Difference between revisions of "Tiso gene 3271"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3271 == * right end position: ** 8714 * transcription direction: ** POSITIVE * left end position: ** 6655 * centisome position: ** 38.89766...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
+
== Gene Tiso_gene_3271 ==
−
* smiles:
+
* right end position:
−
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
+
** 8714
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
+
** POSITIVE
−
* common name:
+
* left end position:
−
** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
+
** 6655
−
* molecular weight:
+
* centisome position:
−
** 572.278    
+
** 38.89766    
 
* Synonym(s):
 
* Synonym(s):
−
** iPTP
 
−
** isopentenyladenosine riboside-5'-triphosphate
 
−
** iPRTP
 
−
** isopentenyladenosine-5'-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.4.1-RXN]]
−
* [[RXN-4303]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[ALKAPHOSPHA-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5822]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8748]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5491]]
 +
* [[PWY-5083]]
 +
* [[NADPHOS-DEPHOS-PWY]]
 +
* [[NAD-BIOSYNTHESIS-II]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=8714}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=6655}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679]
+
{{#set: centisome position=38.89766   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.1.4.1-RXN|ALKAPHOSPHA-RXN|RXN-5822|RXN-8748}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424]
+
{{#set: pathway associated=PWY-5491|PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}}
−
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}}
+
−
{{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}}
+
−
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
−
{{#set: molecular weight=572.278   }}
+
−
{{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}}
+
−
{{#set: produced by=RXN-4303}}
+

Latest revision as of 20:12, 21 March 2018

Gene Tiso_gene_3271

  • right end position:
    • 8714
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6655
  • centisome position:
    • 38.89766
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3271&oldid=46840"