Difference between revisions of "Tiso gene 16775"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * common name: ** biot...") |
(Created page with "Category:Gene == Gene Tiso_gene_16775 == * right end position: ** 3395 * transcription direction: ** NEGATIVE * left end position: ** 2 * centisome position: ** 4.84730960...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16775 == |
− | * | + | * right end position: |
− | ** | + | ** 3395 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 2 |
− | * | + | * centisome position: |
− | ** | + | ** 4.847309600e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.4.2.31-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
− | * | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=3395}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=2}} | |
− | + | {{#set: centisome position=4.847309600e-2}} | |
− | + | {{#set: reaction associated=2.4.2.31-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_16775
- right end position:
- 3395
- transcription direction:
- NEGATIVE
- left end position:
- 2
- centisome position:
- 4.847309600e-2
- Synonym(s):
Reactions associated
- Reaction: 2.4.2.31-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation