Difference between revisions of "Tiso gene 19031"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] == * smiles: ** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Tiso_gene_19031 == * right end position: ** 479 * transcription direction: ** POSITIVE * left end position: ** 33 * centisome position: ** 1.248109...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19031 == |
− | * | + | * right end position: |
− | ** | + | ** 479 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 33 |
− | * | + | * centisome position: |
− | ** | + | ** 1.248109 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[1.18.1.2-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-17897]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7230]] | ||
+ | * [[PWY-101]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=479}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=33}} | |
− | + | {{#set: centisome position=1.248109 }} | |
− | {{#set: | + | {{#set: reaction associated=1.18.1.2-RXN|RXN-17897}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7230|PWY-101}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_19031
- right end position:
- 479
- transcription direction:
- POSITIVE
- left end position:
- 33
- centisome position:
- 1.248109
- Synonym(s):
Reactions associated
- Reaction: 1.18.1.2-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-17897
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation