Difference between revisions of "Tiso gene 19031"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * inchi key: ** InChIKey=VZCYOOQTPOCHF...")
 
(Created page with "Category:Gene == Gene Tiso_gene_19031 == * right end position: ** 479 * transcription direction: ** POSITIVE * left end position: ** 33 * centisome position: ** 1.248109...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] ==
+
== Gene Tiso_gene_19031 ==
−
* smiles:
+
* right end position:
−
** C([O-])(=O)C=CC([O-])=O
+
** 479
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** maleate
+
** 33
−
* molecular weight:
+
* centisome position:
−
** 114.057    
+
** 1.248109    
 
* Synonym(s):
 
* Synonym(s):
−
** maleic acid
 
−
** cis-butenedioic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.18.1.2-RXN]]
−
* [[RXN-646]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-17897]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7230]]
 +
* [[PWY-101]]
 
== External links  ==
 
== External links  ==
−
* CAS : 110-16-7
+
{{#set: right end position=479}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227]
+
{{#set: left end position=33}}
−
* HMDB : HMDB00176
+
{{#set: centisome position=1.248109   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=1.18.1.2-RXN|RXN-17897}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384]
+
{{#set: pathway associated=PWY-7230|PWY-101}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780]
+
−
{{#set: smiles=C([O-])(=O)C=CC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}}
+
−
{{#set: common name=maleate}}
+
−
{{#set: molecular weight=114.057   }}
+
−
{{#set: common name=maleic acid|cis-butenedioic acid}}
+
−
{{#set: produced by=RXN-646}}
+

Latest revision as of 20:12, 21 March 2018

Gene Tiso_gene_19031

  • right end position:
    • 479
  • transcription direction:
    • POSITIVE
  • left end position:
    • 33
  • centisome position:
    • 1.248109
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19031&oldid=46849"