Difference between revisions of "2.3.1.176-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-396 CPD-396] == * smiles: ** C[N+]1(=CC=CC(=C1)C(=O)N) * common name: ** 1-methylnicotinami...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.176-RXN 2.3.1.176-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.176-RXN 2.3.1.176-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.3.1.176 EC-2.3.1.176] | |
− | + | ||
− | + | ||
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-7257]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[CPD-202]][c] '''+''' 1 [[PROPIONYL-COA]][c] |
− | == | + | * With common name(s): |
+ | ** 1 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl CoA[c] '''+''' 1 coenzyme A[c] '''=>''' 1 choloyl-CoA[c] '''+''' 1 propanoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16181]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6061]], bile acid biosynthesis, neutral pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6061 PWY-6061] | ||
+ | ** '''3''' reactions found over '''29''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16865 16865] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03719 R03719] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: ec number=EC-2.3.1.176}} | |
− | + | {{#set: gene associated=Tiso_gene_16181}} | |
− | + | {{#set: in pathway=PWY-6061}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:12, 21 March 2018
Contents
Reaction 2.3.1.176-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-7257[c] + 1 CO-A[c] => 1 CPD-202[c] + 1 PROPIONYL-COA[c]
- With common name(s):
- 1 3α,7α,12α-trihydroxy-24-oxo-5-β-cholestanoyl CoA[c] + 1 coenzyme A[c] => 1 choloyl-CoA[c] + 1 propanoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16181
- Source: orthology-athaliana
- Source: orthology-esiliculosus
Pathways
- PWY-6061, bile acid biosynthesis, neutral pathway: PWY-6061
- 3 reactions found over 29 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links