Difference between revisions of "CPD1F-134"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D19-31-C50-3-ACPs trans-D2-cis-cis-D19-31-C50-3-ACPs] == * common name: ** a t...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C))...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] == |
+ | * smiles: | ||
+ | ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O))) | ||
* common name: | * common name: | ||
− | ** | + | ** gibberellin A9 |
+ | * inchi key: | ||
+ | ** InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M | ||
+ | * molecular weight: | ||
+ | ** 315.388 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** C19-GAs | ||
+ | ** closed lactone gibberellin skeleton | ||
+ | ** C19 skeleton | ||
+ | ** C19-GA skeleton | ||
+ | ** C19-gibberellin skeleton | ||
+ | ** GA9 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1F-165]] |
+ | * [[RXN-171]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244370 25244370] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73255 73255] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11863 C11863] | ||
+ | {{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
+ | {{#set: common name=gibberellin A9}} | ||
+ | {{#set: inchi key=InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M}} | ||
+ | {{#set: molecular weight=315.388 }} | ||
+ | {{#set: common name=C19-GAs|closed lactone gibberellin skeleton|C19 skeleton|C19-GA skeleton|C19-gibberellin skeleton|GA9}} | ||
+ | {{#set: consumed by=RXN1F-165|RXN-171}} |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite CPD1F-134
- smiles:
- C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A9
- inchi key:
- InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
- molecular weight:
- 315.388
- Synonym(s):
- C19-GAs
- closed lactone gibberellin skeleton
- C19 skeleton
- C19-GA skeleton
- C19-gibberellin skeleton
- GA9
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.