Difference between revisions of "CPD1F-134"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] == * direction: ** REVERSIBLE * common name: ** galactose-3-o-sulfotransferase...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C))...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
 
* common name:
 
* common name:
** galactose-3-o-sulfotransferase_2-like
+
** gibberellin A9
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11]
+
** InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
 +
* molecular weight:
 +
** 315.388   
 
* Synonym(s):
 
* Synonym(s):
 +
** C19-GAs
 +
** closed lactone gibberellin skeleton
 +
** C19 skeleton
 +
** C19-GA skeleton
 +
** C19-gibberellin skeleton
 +
** GA9
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN1F-165]]
** 1 [[PAPS]][c] '''+''' 1 [[1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c] '''+''' 1 [[Seminolipids]][c]
+
* [[RXN-171]]
* With common name(s):
+
== Reaction(s) known to produce the compound ==
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 a 1-O-alkyl-2-O-acyl-3-O-&beta;-D-galactosyl-sn-glycerol[c] '''<=>''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a seminolipid[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_13030]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
{{#set: common name=galactose-3-o-sulfotransferase_2-like}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244370 25244370]
{{#set: ec number=EC-2.8.2.11}}
+
* CHEBI:
{{#set: gene associated=Tiso_gene_13030}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73255 73255]
{{#set: in pathway=}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11863 C11863]
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=gibberellin A9}}
 +
{{#set: inchi key=InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M}}
 +
{{#set: molecular weight=315.388    }}
 +
{{#set: common name=C19-GAs|closed lactone gibberellin skeleton|C19 skeleton|C19-GA skeleton|C19-gibberellin skeleton|GA9}}
 +
{{#set: consumed by=RXN1F-165|RXN-171}}

Latest revision as of 20:13, 21 March 2018

Metabolite CPD1F-134

  • smiles:
    • C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • common name:
    • gibberellin A9
  • inchi key:
    • InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
  • molecular weight:
    • 315.388
  • Synonym(s):
    • C19-GAs
    • closed lactone gibberellin skeleton
    • C19 skeleton
    • C19-GA skeleton
    • C19-gibberellin skeleton
    • GA9

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.