Difference between revisions of "RXN-8032"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8032 RXN-8032] == * direction: ** REVERSIBLE * common name: ** 3-ketopimelyl-CoA thiolase * ec...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8032 RXN-8032] ==
−
* smiles:
+
* direction:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
+
 
* common name:
 
* common name:
−
** gibberellin A24
+
** 3-ketopimelyl-CoA thiolase
−
* molecular weight:
+
* ec number:
−
** 344.407   
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
 
* Synonym(s):
 
* Synonym(s):
−
** GA24
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN1F-163]]
+
** 1 [[CO-A]][c] '''+''' 1 [[3-OXOPIMELOYL-COA]][c] '''<=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[GLUTARYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 coenzyme A[c] '''+''' 1 3-oxopimeloyl-CoA[c] '''<=>''' 1 acetyl-CoA[c] '''+''' 1 glutaryl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7195]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[CENTBENZCOA-PWY]], benzoyl-CoA degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=CENTBENZCOA-PWY CENTBENZCOA-PWY]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7401]], crotonate fermentation (to acetate and cyclohexane carboxylate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7401 PWY-7401]
 +
** '''5''' reactions found over '''17''' reactions in the full pathway
 +
* [[P321-PWY]], benzoyl-CoA degradation III (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P321-PWY P321-PWY]
 +
** '''1''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05586 R05586]
−
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
+
{{#set: common name=3-ketopimelyl-CoA thiolase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.3.1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
+
{{#set: gene associated=Tiso_gene_7195}}
−
* HMDB : HMDB37103
+
{{#set: in pathway=CENTBENZCOA-PWY|PWY-7401|P321-PWY}}
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: common name=gibberellin A24}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=344.407    }}
+
−
{{#set: common name=GA24}}
+
−
{{#set: produced by=RXN1F-163}}
+

Latest revision as of 20:13, 21 March 2018

Reaction RXN-8032

  • direction:
    • REVERSIBLE
  • common name:
    • 3-ketopimelyl-CoA thiolase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • CENTBENZCOA-PWY, benzoyl-CoA degradation II (anaerobic): CENTBENZCOA-PWY
    • 2 reactions found over 7 reactions in the full pathway
  • PWY-7401, crotonate fermentation (to acetate and cyclohexane carboxylate): PWY-7401
    • 5 reactions found over 17 reactions in the full pathway
  • P321-PWY, benzoyl-CoA degradation III (anaerobic): P321-PWY
    • 1 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-8032&oldid=46865"