Difference between revisions of "DGTD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** &b...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTD DGTD] == * direction: ** LEFT-TO-RIGHT * common name: ** 2'-Deoxyguanosine 5'-triphosphate dip...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTD DGTD] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** β-D-ribose 5-phosphate
+
** 2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase
−
* inchi key:
+
−
** InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
+
−
* molecular weight:
+
−
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-ribofuranose 5-phosphate
 
−
** 5-O-phosphono-β-D-ribofuranose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15346]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[DGTP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[DGMP]][c] '''+''' 1.0 [[PPI]][c]
−
* [[RXN-15345]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 H2O[c] '''+''' 1.0 dGTP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 dGMP[c] '''+''' 1.0 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18793]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140377 7140377]
+
{{#set: common name=2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_18793}}
−
** [http://www.chemspider.com/Chemical-Structure.394672.html 394672]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=β-D-ribose 5-phosphate}}
+
−
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L}}
+
−
{{#set: molecular weight=228.095    }}
+
−
{{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}}
+
−
{{#set: consumed by=RXN-15346}}
+
−
{{#set: produced by=RXN-15345}}
+

Latest revision as of 21:13, 21 March 2018

Reaction DGTD

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 dGTP[c] => 1.0 H+[c] + 1.0 dGMP[c] + 1.0 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DGTD&oldid=46867"