Difference between revisions of "3-Methyl-Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Saturated-Fatty-Acyl-CoA 3-Methyl-Saturated-Fatty-Acyl-CoA] == * common name: ** a 3-m...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Saturated-Fatty-Acyl-CoA 3-Methyl-Saturated-Fatty-Acyl-CoA] ==
−
* smiles:
+
−
** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C
+
−
* inchi key:
+
−
** InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N
+
 
* common name:
 
* common name:
−
** prolycopene
+
** a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA
−
* molecular weight:
+
−
** 536.882   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7,9,9',7'-tetra-cis-lycopene
 
−
** 9,9'-di-cis-ζ-carotene
 
−
** 7,9,9',7'-tetracis-lycopene
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8042]]
+
* [[RXN66-470]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-11357]]
+
* [[RXN66-469]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-12242]]
 
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10918539 10918539]
+
{{#set: consumed by=RXN66-470}}
−
* CHEBI:
+
{{#set: produced by=RXN66-469}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62466 62466]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C15858 C15858]
+
−
* HMDB : HMDB35776
+
−
{{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N}}
+
−
{{#set: common name=prolycopene}}
+
−
{{#set: molecular weight=536.882    }}
+
−
{{#set: common name=7,9,9',7'-tetra-cis-lycopene|9,9'-di-cis-ζ-carotene|7,9,9',7'-tetracis-lycopene}}
+
−
{{#set: consumed by=RXN-8042}}
+
−
{{#set: produced by=RXN-11357}}
+
−
{{#set: reversible reaction associated=RXN-12242}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA

  • common name:
    • a 3-methyl-branched 2,3,4-saturated fatty acyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-Methyl-Saturated-Fatty-Acyl-CoA&oldid=46883"