Difference between revisions of "Tiso gene 17498"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17498 == * right end position: ** 2404 * transcription direction: ** POSITIVE * left end position: ** 515 * centisome position: ** 14.06335...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
+
== Gene Tiso_gene_17498 ==
* smiles:
+
* right end position:
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2404
* inchi key:
+
* transcription direction:
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
+
** POSITIVE
* common name:
+
* left end position:
** 6-cis-tridecenoyl-CoA
+
** 515
* molecular weight:
+
* centisome position:
** 957.819    
+
** 14.063354    
 
* Synonym(s):
 
* Synonym(s):
** 6Z-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14771]]
+
* Reaction: [[3.1.13.4-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=2404}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=515}}
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
+
{{#set: centisome position=14.063354   }}
{{#set: common name=6-cis-tridecenoyl-CoA}}
+
{{#set: reaction associated=3.1.13.4-RXN}}
{{#set: molecular weight=957.819   }}
+
{{#set: common name=6Z-tridecenoyl-CoA}}
+
{{#set: consumed by=RXN-14771}}
+

Latest revision as of 20:13, 21 March 2018

Gene Tiso_gene_17498

  • right end position:
    • 2404
  • transcription direction:
    • POSITIVE
  • left end position:
    • 515
  • centisome position:
    • 14.063354
  • Synonym(s):

Reactions associated

Pathways associated

External links