Difference between revisions of "ACDHi"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-173 CPD-173] == * smiles: ** C(C1(C=CC=CC=1O))O * inchi key: ** InChIKey=CQRYARSYNCAZFO-UHF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACDHi ACDHi] == * direction: ** LEFT-TO-RIGHT * common name: ** acetaldehyde-CoA dehydrogenase * Sy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-173 CPD-173] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACDHi ACDHi] ==
* smiles:
+
* direction:
** C(C1(C=CC=CC=1O))O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=CQRYARSYNCAZFO-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** salicyl alcohol
+
** acetaldehyde-CoA dehydrogenase
* molecular weight:
+
** 124.139   
+
 
* Synonym(s):
 
* Synonym(s):
** saligenin
 
** 2-hydroxybenzyl alcohol
 
** o-hydroxybenzyl alcohol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12252]]
+
** 2.0 [[NADH]][c] '''+''' 2.0 [[PROTON]][c] '''+''' 1.0 [[ACETYL-COA]][c] '''=>''' 1.0 [[ETOH]][c] '''+''' 2.0 [[NAD]][c] '''+''' 1.0 [[CO-A]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2.0 NADH[c] '''+''' 2.0 H+[c] '''+''' 1.0 acetyl-CoA[c] '''=>''' 1.0 ethanol[c] '''+''' 2.0 NAD+[c] '''+''' 1.0 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2052]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 90-01-7
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=acetaldehyde-CoA dehydrogenase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5146 5146]
+
{{#set: gene associated=Tiso_gene_2052}}
* HMDB : HMDB59709
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C02323 C02323]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.chemspider.com/Chemical-Structure.4962.html 4962]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16464 16464]
+
* METABOLIGHTS : MTBLC16464
+
{{#set: smiles=C(C1(C=CC=CC=1O))O}}
+
{{#set: inchi key=InChIKey=CQRYARSYNCAZFO-UHFFFAOYSA-N}}
+
{{#set: common name=salicyl alcohol}}
+
{{#set: molecular weight=124.139    }}
+
{{#set: common name=saligenin|2-hydroxybenzyl alcohol|o-hydroxybenzyl alcohol}}
+
{{#set: produced by=RXN-12252}}
+

Latest revision as of 20:13, 21 March 2018

Reaction ACDHi

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acetaldehyde-CoA dehydrogenase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2.0 NADH[c] + 2.0 H+[c] + 1.0 acetyl-CoA[c] => 1.0 ethanol[c] + 2.0 NAD+[c] + 1.0 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links