Difference between revisions of "CPD-14594"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * smiles: ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** linustatin |
| + | * inchi key: | ||
| + | ** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 409.389 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** propanenitrile |
| − | ** | + | ** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13602]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles=C( | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301] |
| − | {{#set: | + | {{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}} |
| − | {{#set: | + | {{#set: common name=linustatin}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}} |
| − | {{#set: common name= | + | {{#set: molecular weight=409.389 }} |
| − | {{#set: consumed by=RXN- | + | {{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}} |
| − | + | {{#set: consumed by=RXN-13602}} | |
| − | + | ||
Latest revision as of 21:13, 21 March 2018
Contents
Metabolite CPD-14594
- smiles:
- CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
- common name:
- linustatin
- inchi key:
- InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
- molecular weight:
- 409.389
- Synonym(s):
- propanenitrile
- [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
