Difference between revisions of "Tiso gene 5468"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C...")
(Created page with "Category:Gene == Gene Tiso_gene_5468 == * Synonym(s): == Reactions associated == * Reaction: 3PGAREARR-RXN ** Source: orthology-creinhardtii ** Source: ortholog...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] ==
+
== Gene Tiso_gene_5468 ==
−
* smiles:
+
−
** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
+
−
* inchi key:
+
−
** InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L
+
−
* common name:
+
−
** (R)-NADHX
+
−
* molecular weight:
+
−
** 681.445   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3PGAREARR-RXN]]
−
* [[RXN-12754]]
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[PWY-7218]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY-5723]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[PWY-7124]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=3PGAREARR-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927860 56927860]
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|PWY-7218|P124-PWY|PWY-6886|PWY-5723|PWY-6142|PWY-5484|PWY-7124|PWY-7003}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64075 64075]
+
−
{{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
+
−
{{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L}}
+
−
{{#set: common name=(R)-NADHX}}
+
−
{{#set: molecular weight=681.445    }}
+
−
{{#set: common name=(6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}}
+
−
{{#set: produced by=RXN-12754}}
+

Latest revision as of 21:13, 21 March 2018

Gene Tiso_gene_5468

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5468&oldid=46952"