Difference between revisions of "CPDQT-30"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-29-3-hydroxyC48-2-ACPs cis-cis-D11-29-3-hydroxyC48-2-ACPs] == * common name: ** a c...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] == * smiles: ** CSCCCCCCCC(=O)C([O-])=O * common name: ** 9-(methylthio)-2-o...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-29-3-hydroxyC48-2-ACPs cis-cis-D11-29-3-hydroxyC48-2-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] ==
 +
* smiles:
 +
** CSCCCCCCCC(=O)C([O-])=O
 
* common name:
 
* common name:
** a cis,cis-delta11,29-3-hydroxy C48:2-[acp]
+
** 9-(methylthio)-2-oxononanoate
 +
* inchi key:
 +
** InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 217.302   
 
* Synonym(s):
 
* Synonym(s):
** a cis,cis-delta 11,29-3-hydroxy C48:2-[acyl-carrier-protein]
+
** 9-(methylthio)-2-oxononanoic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-853]]
+
* [[RXN-18203]]
 +
* [[RXNQT-4174]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a cis,cis-delta11,29-3-hydroxy C48:2-[acp]}}
+
* PUBCHEM:
{{#set: common name=a cis,cis-delta 11,29-3-hydroxy C48:2-[acyl-carrier-protein]}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237169 44237169]
{{#set: produced by=RXN1G-853}}
+
* KNAPSACK : C00007654
 +
{{#set: smiles=CSCCCCCCCC(=O)C([O-])=O}}
 +
{{#set: common name=9-(methylthio)-2-oxononanoate}}
 +
{{#set: inchi key=InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=217.302    }}
 +
{{#set: common name=9-(methylthio)-2-oxononanoic acid}}
 +
{{#set: produced by=RXN-18203|RXNQT-4174}}

Latest revision as of 20:13, 21 March 2018

Metabolite CPDQT-30

  • smiles:
    • CSCCCCCCCC(=O)C([O-])=O
  • common name:
    • 9-(methylthio)-2-oxononanoate
  • inchi key:
    • InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
  • molecular weight:
    • 217.302
  • Synonym(s):
    • 9-(methylthio)-2-oxononanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007654
"CSCCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.