Difference between revisions of "UDP-MANNAC"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-MANNAC UDP-MANNAC] == * smiles: ** CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(O...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-MANNAC UDP-MANNAC] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** UDP-N-acetyl-α-D-mannosamine |
| + | * inchi key: | ||
| + | ** InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 605.342 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 2- | + | ** uridine diphosphate N-acetylmannosamine |
| − | ** | + | ** uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester |
| + | ** UDP-acetylmannosamine | ||
| + | ** UDP-ManNAc | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[UDPGLCNACEPIM-RXN]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01170 C01170] |
| + | * HMDB : HMDB13112 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68623 68623] |
| − | {{#set: smiles= | + | * BIGG : uacmam |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245190 25245190] |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)}} |
| − | {{#set: common name=2- | + | {{#set: common name=UDP-N-acetyl-α-D-mannosamine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L}} |
| + | {{#set: molecular weight=605.342 }} | ||
| + | {{#set: common name=uridine diphosphate N-acetylmannosamine|uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester|UDP-acetylmannosamine|UDP-ManNAc}} | ||
| + | {{#set: reversible reaction associated=UDPGLCNACEPIM-RXN}} | ||
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite UDP-MANNAC
- smiles:
- CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)
- common name:
- UDP-N-acetyl-α-D-mannosamine
- inchi key:
- InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L
- molecular weight:
- 605.342
- Synonym(s):
- uridine diphosphate N-acetylmannosamine
- uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester
- UDP-acetylmannosamine
- UDP-ManNAc
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)" cannot be used as a page name in this wiki.
