Difference between revisions of "Tiso gene 7286"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_7286 == * right end position: ** 10064 * transcription direction: ** POSITIVE * left end position: ** 7630 * centisome position: ** 67.2958...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_7286 == |
| − | * | + | * right end position: |
| − | ** | + | ** 10064 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 7630 |
| − | * | + | * centisome position: |
| − | ** | + | ** 67.29582 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[ARYLSULFAT-RXN]] | |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | == | + | *** Assignment: automated-name-match |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=10064}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=7630}} |
| − | {{#set: | + | {{#set: centisome position=67.29582 }} |
| − | {{#set: | + | {{#set: reaction associated=ARYLSULFAT-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 21:13, 21 March 2018
Gene Tiso_gene_7286
- right end position:
- 10064
- transcription direction:
- POSITIVE
- left end position:
- 7630
- centisome position:
- 67.29582
- Synonym(s):
Reactions associated
- Reaction: ARYLSULFAT-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
