Difference between revisions of "RXN1G-182"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == * smiles: ** CC1(=C(C2(=C(C=N1)COC2=O))O) * inchi key: ** InChIKey=HHPDVQLB...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-182 RXN1G-182] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta5,23-3-oxo-C42...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-182 RXN1G-182] ==
* smiles:
+
* direction:
** CC1(=C(C2(=C(C=N1)COC2=O))O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 4-pyridoxolactone
+
** cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase
* molecular weight:
+
* ec number:
** 165.148   
+
** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[PYRIDOXAL-4-DEHYDROGENASE-RXN]]
+
** 1 [[cis-cis-D5-23-3-oxo-C42-2-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[cis-cis-D5-23-3-hydroxyC42-2-ACPs]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a cis,cis-delta5,23-3-oxo-C42:2-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 a cis,cis-delta5,23-3-hydroxyC42:2-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151228 151228]
+
{{#set: common name=cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase}}
* CHEMSPIDER:
+
{{#set: ec number=EC-1.1.1.M9}}
** [http://www.chemspider.com/Chemical-Structure.133287.html 133287]
+
{{#set: gene associated=Tiso_gene_13083}}
* CHEBI:
+
{{#set: in pathway=PWYG-321}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16871 16871]
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
** [http://www.genome.jp/dbget-bin/www_bget?C00971 C00971]
+
{{#set: reconstruction tool=pantograph}}
* HMDB : HMDB03454
+
{{#set: smiles=CC1(=C(C2(=C(C=N1)COC2=O))O)}}
+
{{#set: inchi key=InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N}}
+
{{#set: common name=4-pyridoxolactone}}
+
{{#set: molecular weight=165.148    }}
+
{{#set: produced by=PYRIDOXAL-4-DEHYDROGENASE-RXN}}
+

Latest revision as of 20:13, 21 March 2018

Reaction RXN1G-182

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.