Difference between revisions of "Tiso gene 1316"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
(Created page with "Category:Gene == Gene Tiso_gene_1316 == * Synonym(s): == Reactions associated == * Reaction: UDPGLCNACEPIM-RXN ** Source: annotation-in-silico_annotation *** Assi...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] ==
+
== Gene Tiso_gene_1316 ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
+
* common name:
+
** geranylgeranyl chlorophyll b
+
* molecular weight:
+
** 901.439   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[UDPGLCNACEPIM-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-7673]]
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7816]]
 +
* [[PWY-7815]]
 +
* [[TEICHOICACID-PWY]]
 +
* [[PWY-7819]]
 +
* [[PWY-7335]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=UDPGLCNACEPIM-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245917 25245917]
+
{{#set: pathway associated=PWY-7816|PWY-7815|TEICHOICACID-PWY|PWY-7819|PWY-7335}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=geranylgeranyl chlorophyll b}}
+
{{#set: molecular weight=901.439    }}
+
{{#set: reversible reaction associated=RXN-7673}}
+

Latest revision as of 21:13, 21 March 2018

Gene Tiso_gene_1316

  • Synonym(s):

Reactions associated

Pathways associated

External links