Difference between revisions of "RXN1G-607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-607 RXN1G-607] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-607 RXN1G-607] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 6-cis-tridecenoyl-CoA
+
** trans-delta2-cis,cis-delta15,27-C46:3-[acyl-carrier protein] reductase
−
* inchi key:
+
* ec number:
−
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
+
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
−
* molecular weight:
+
−
** 957.819   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 6Z-tridecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14771]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[trans-D2-cis-cis-D15-27-C46-3-ACPs]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D15-27-C46-2-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a trans-delta2-cis,cis-delta15,27-C46:3-[acp][c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta15,27-C46:2-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
+
{{#set: common name=trans-delta2-cis,cis-delta15,27-C46:3-[acyl-carrier protein] reductase}}
−
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-1.3.1.M4}}
−
{{#set: common name=6-cis-tridecenoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_10778}}
−
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
+
{{#set: in pathway=PWYG-321}}
−
{{#set: molecular weight=957.819    }}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=6Z-tridecenoyl-CoA}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: consumed by=RXN-14771}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:13, 21 March 2018

Reaction RXN1G-607

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-delta2-cis,cis-delta15,27-C46:3-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"trans-delta2-cis,cis-delta15,27-C46:3-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-607&oldid=46998"