Difference between revisions of "Sulfurylated-ThiI"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurylated-ThiI Sulfurylated-ThiI] == * common name: ** an S-sulfanyl-[ThiI sulfur-carrier pr...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurylated-ThiI Sulfurylated-ThiI] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** S- | + | ** an S-sulfanyl-[ThiI sulfur-carrier protein] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a sulfurylated sulfur-carrier protein ThiI |
| + | ** a ThiI persulfide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14382]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-9787]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an S-sulfanyl-[ThiI sulfur-carrier protein]}} | |
| − | + | {{#set: common name=a sulfurylated sulfur-carrier protein ThiI|a ThiI persulfide}} | |
| − | + | {{#set: produced by=RXN-14382}} | |
| − | + | {{#set: reversible reaction associated=RXN-9787}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite Sulfurylated-ThiI
- common name:
- an S-sulfanyl-[ThiI sulfur-carrier protein]
- Synonym(s):
- a sulfurylated sulfur-carrier protein ThiI
- a ThiI persulfide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an S-sulfanyl-[ThiI sulfur-carrier protein" cannot be used as a page name in this wiki.
