Difference between revisions of "CPD-397"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12175 CPD-12175] == * smiles: ** CC(C([O-])=O)CO * inchi key: ** InChIKey=DBXBTMSZEOQQDU-VK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * common name: ** S-methyl-L-methio...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C[S+](CCC([N+])C(=O)[O-])C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** S-methyl-L-methionine |
| + | * inchi key: | ||
| + | ** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 164.242 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** S-methylmethionine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MMUM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252] |
| + | * BIGG : mmet | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172] |
| − | + | {{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}} | |
| − | {{#set: smiles= | + | {{#set: common name=S-methyl-L-methionine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}} |
| − | {{#set: | + | {{#set: molecular weight=164.242 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=S-methylmethionine}} |
| − | {{#set: common name= | + | {{#set: consumed by=MMUM-RXN}} |
| − | {{#set: consumed by= | + | |
| − | + | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-397
- smiles:
- C[S+](CCC([N+])C(=O)[O-])C
- common name:
- S-methyl-L-methionine
- inchi key:
- InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
- molecular weight:
- 164.242
- Synonym(s):
- S-methylmethionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[S+](CCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.
