Difference between revisions of "RXN-17883"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-MANNAC UDP-MANNAC] == * smiles: ** CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17883 RXN-17883] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-MANNAC UDP-MANNAC] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17883 RXN-17883] ==
−
* smiles:
+
* direction:
−
** CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L
+
−
* common name:
+
−
** UDP-N-acetyl-α-D-mannosamine
+
−
* molecular weight:
+
−
** 605.342   
+
 
* Synonym(s):
 
* Synonym(s):
−
** uridine diphosphate N-acetylmannosamine
 
−
** uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester
 
−
** UDP-acetylmannosamine
 
−
** UDP-ManNAc
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[N-terminal-L-cysteine-sulfinate]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[N-terminal-L-cysteine-sulfonate]][c]
−
* [[UDPGLCNACEPIM-RXN]]
+
* With common name(s):
 +
** 1 hydrogen peroxide[c] '''+''' 1 an N-terminal 3-sulfino-L-alanyl-[protein][c] '''=>''' 1 H2O[c] '''+''' 1 H+[c] '''+''' 1 an N-terminal 3-sulfo-L-alanyl-[protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799]
 +
** '''8''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01170 C01170]
+
{{#set: in pathway=PWY-7799}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68623 68623]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* BIGG : uacmam
+
{{#set: reconstruction tool=pathwaytools}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245190 25245190]
+
−
* HMDB : HMDB13112
+
−
{{#set: smiles=CC(=O)NC3(C(O)C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))3)}}
+
−
{{#set: inchi key=InChIKey=LFTYTUAZOPRMMI-ZYQOOJPVSA-L}}
+
−
{{#set: common name=UDP-N-acetyl-α-D-mannosamine}}
+
−
{{#set: molecular weight=605.342    }}
+
−
{{#set: common name=uridine diphosphate N-acetylmannosamine|uridine 5'-(trihydrogen diphosphate), P'-(2-(acetylamino)-2-deoxy-α-D-mannopyranosyl) ester|UDP-acetylmannosamine|UDP-ManNAc}}
+
−
{{#set: consumed or produced by=UDPGLCNACEPIM-RXN}}
+

Latest revision as of 21:14, 21 March 2018

Reaction RXN-17883

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7799, Arg/N-end rule pathway (eukaryotic): PWY-7799
    • 8 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17883&oldid=47018"