Difference between revisions of "Red-Thioredoxin"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Thioredoxin Red-Thioredoxin] == * common name: ** a reduced thioredoxin * Synonym(s): == R...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Thioredoxin Red-Thioredoxin] ==
* smiles:
+
** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
+
* inchi key:
+
** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
+
 
* common name:
 
* common name:
** β-L-galactose 1-phosphate
+
** a reduced thioredoxin
* molecular weight:
+
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNQT-4142]]
+
* [[RXN0-5468]]
 +
* [[ADPREDUCT-RXN]]
 +
* [[CDPREDUCT-RXN]]
 +
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
 +
* [[UDPREDUCT-RXN]]
 +
* [[RXN-8668]]
 +
* [[1.8.4.14-RXN]]
 +
* [[THIOREDOXIN-RXN]]
 +
* [[GDPREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN0-6385]]
 +
* [[1.8.4.12-RXN]]
 +
* [[1.8.4.8-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a reduced thioredoxin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461]
+
{{#set: consumed by=RXN0-5468|ADPREDUCT-RXN|CDPREDUCT-RXN|RIBONUCLEOSIDE-DIP-REDUCTI-RXN|UDPREDUCT-RXN|RXN-8668|1.8.4.14-RXN|THIOREDOXIN-RXN|GDPREDUCT-RXN}}
* CHEBI:
+
{{#set: produced by=THIOREDOXIN-REDUCT-NADPH-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522]
+
{{#set: reversible reaction associated=RXN0-6385|1.8.4.12-RXN|1.8.4.8-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926]
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}}
+
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}}
+
{{#set: common name=β-L-galactose 1-phosphate}}
+
{{#set: molecular weight=258.121    }}
+
{{#set: consumed by=RXNQT-4142}}
+

Latest revision as of 20:14, 21 March 2018

Metabolite Red-Thioredoxin

  • common name:
    • a reduced thioredoxin
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links