Difference between revisions of "RXN0-882"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15900 CPD-15900] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15900 CPD-15900] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] ==
* smiles:
+
* direction:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J
+
** [http://enzyme.expasy.org/EC/1.17.7.1 EC-1.17.7.1]
* common name:
+
** 2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA
+
* molecular weight:
+
** 903.641   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[PROTON]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c]
* [[RXN-15013]]
+
* With common name(s):
 +
** 1 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H+[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H2O[c] '''+''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15758]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551544 72551544]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08689 R08689]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76527 76527]
+
{{#set: ec number=EC-1.17.7.1}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: gene associated=Tiso_gene_15758}}
{{#set: inchi key=InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J}}
+
{{#set: in pathway=PWY-7560}}
{{#set: common name=2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=903.641    }}
+
{{#set: reconstruction source=orthology-synechocystis|orthology-esiliculosus}}
{{#set: consumed or produced by=RXN-15013}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:14, 21 March 2018

Reaction RXN0-882

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7560, methylerythritol phosphate pathway II: PWY-7560
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links