Difference between revisions of "RXN-10767"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10767 RXN-10767] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha_beta_hydrolase_fold_p...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10767 RXN-10767] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** alpha_beta_hydrolase_fold_protein |
− | * | + | ** ORF |
− | ** | + | ** serine_esterase |
+ | ** sialate_o-acetylesterase-like_protein | ||
+ | ** lysophospholipase | ||
+ | ** alpha_beta_hydrolase | ||
+ | ** protein_chloroplastic | ||
+ | ** para-nitrobenzyl_esterase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/3.1.1.1 EC-3.1.1.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[Methyl-Jasmonates]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Jasmonic-Acids]][c] '''+''' 1 [[METOH]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 a methyl jasmonate[c] '''=>''' 1 H+[c] '''+''' 1 a jasmonic acid[c] '''+''' 1 methanol[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12686]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_2556]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_10066]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_4606]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_1538]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_19778]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17029]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_1922]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_1537]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9429]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_4650]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_11351]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_16518]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=alpha_beta_hydrolase_fold_protein}} |
− | {{#set: common name= | + | {{#set: common name=ORF}} |
− | {{#set: | + | {{#set: common name=serine_esterase}} |
− | {{#set: | + | {{#set: common name=sialate_o-acetylesterase-like_protein}} |
− | {{#set: | + | {{#set: common name=lysophospholipase}} |
+ | {{#set: common name=alpha_beta_hydrolase}} | ||
+ | {{#set: common name=protein_chloroplastic}} | ||
+ | {{#set: common name=para-nitrobenzyl_esterase}} | ||
+ | {{#set: ec number=EC-3.1.1.1}} | ||
+ | {{#set: gene associated=Tiso_gene_12686|Tiso_gene_2556|Tiso_gene_10066|Tiso_gene_4606|Tiso_gene_1538|Tiso_gene_19778|Tiso_gene_17029|Tiso_gene_1922|Tiso_gene_1537|Tiso_gene_9429|Tiso_gene_4650|Tiso_gene_11351|Tiso_gene_16518}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:14, 21 March 2018
Contents
Reaction RXN-10767
- direction:
- LEFT-TO-RIGHT
- common name:
- alpha_beta_hydrolase_fold_protein
- ORF
- serine_esterase
- sialate_o-acetylesterase-like_protein
- lysophospholipase
- alpha_beta_hydrolase
- protein_chloroplastic
- para-nitrobenzyl_esterase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Methyl-Jasmonates[c] => 1 PROTON[c] + 1 Jasmonic-Acids[c] + 1 METOH[c]
- With common name(s):
- 1 H2O[c] + 1 a methyl jasmonate[c] => 1 H+[c] + 1 a jasmonic acid[c] + 1 methanol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12686
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2556
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10066
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4606
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1538
- Source: orthology-esiliculosus
- Gene: Tiso_gene_19778
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17029
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1922
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1537
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9429
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4650
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_11351
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_16518
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation