Difference between revisions of "RXN-10767"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIK...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10767 RXN-10767] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha_beta_hydrolase_fold_p...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10767 RXN-10767] ==
−
* smiles:
+
* direction:
−
** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** 3-isopropyl-10-(methylthio)-2-oxodecanoate
+
** alpha_beta_hydrolase_fold_protein
−
* molecular weight:
+
** ORF
−
** 274.331   
+
** serine_esterase
 +
** sialate_o-acetylesterase-like_protein
 +
** lysophospholipase
 +
** alpha_beta_hydrolase
 +
** protein_chloroplastic
 +
** para-nitrobenzyl_esterase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.1.1 EC-3.1.1.1]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-18201]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[Methyl-Jasmonates]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Jasmonic-Acids]][c] '''+''' 1 [[METOH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-18200]]
+
** 1 H2O[c] '''+''' 1 a methyl jasmonate[c] '''=>''' 1 H+[c] '''+''' 1 a jasmonic acid[c] '''+''' 1 methanol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12686]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2556]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10066]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4606]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1538]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_19778]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17029]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1922]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_1537]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9429]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4650]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_11351]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_16518]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L}}
+
{{#set: common name=alpha_beta_hydrolase_fold_protein}}
−
{{#set: common name=3-isopropyl-10-(methylthio)-2-oxodecanoate}}
+
{{#set: common name=ORF}}
−
{{#set: molecular weight=274.331    }}
+
{{#set: common name=serine_esterase}}
−
{{#set: consumed by=RXN-18201}}
+
{{#set: common name=sialate_o-acetylesterase-like_protein}}
−
{{#set: consumed or produced by=RXN-18200}}
+
{{#set: common name=lysophospholipase}}
 +
{{#set: common name=alpha_beta_hydrolase}}
 +
{{#set: common name=protein_chloroplastic}}
 +
{{#set: common name=para-nitrobenzyl_esterase}}
 +
{{#set: ec number=EC-3.1.1.1}}
 +
{{#set: gene associated=Tiso_gene_12686|Tiso_gene_2556|Tiso_gene_10066|Tiso_gene_4606|Tiso_gene_1538|Tiso_gene_19778|Tiso_gene_17029|Tiso_gene_1922|Tiso_gene_1537|Tiso_gene_9429|Tiso_gene_4650|Tiso_gene_11351|Tiso_gene_16518}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:14, 21 March 2018

Reaction RXN-10767

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alpha_beta_hydrolase_fold_protein
    • ORF
    • serine_esterase
    • sialate_o-acetylesterase-like_protein
    • lysophospholipase
    • alpha_beta_hydrolase
    • protein_chloroplastic
    • para-nitrobenzyl_esterase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10767&oldid=47024"