Difference between revisions of "RXN-13607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] == * smiles: ** C=C(OP([O-])([O-])=O)C([O-])=O * i...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] ==
* smiles:
+
* direction:
** C=C(OP([O-])([O-])=O)C([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=DTBNBXWJWCWCIK-UHFFFAOYSA-K
+
 
* common name:
 
* common name:
** phosphoenolpyruvate
+
** exostosin_family_protein
* molecular weight:
+
* ec number:
** 165.019   
+
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
 
* Synonym(s):
 
* Synonym(s):
** PEP
 
** 2-(phosphonooxy)- 2-propenoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9988]]
+
* With identifiers:
* [[PEPPIth]]
+
** 1 [[UDP-GLUCURONATE]][c] '''+''' 1 [[CPD-14601]][c] '''=>''' 1 [[CPD-14602]][c] '''+''' 1 [[UDP]][c]
* [[KDO-8PSYNTH-RXN]]
+
* With common name(s):
* [[2.7.1.121-RXN]]
+
** 1 UDP-α-D-glucuronate[c] '''+''' 1 mycophenolate[c] '''=>''' 1 mycophenolic acid O-acyl-glucuronide[c] '''+''' 1 UDP[c]
* [[GTPOP]]
+
 
== Reaction(s) known to produce the compound ==
+
== Genes associated with this reaction  ==
* [[PEPSYNTH-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
* [[PEPCARBOXYKIN-RXN]]
+
* Gene: [[Tiso_gene_14140]]
* [[PEPPIth]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: EC-NUMBER
* [[RXN-14117]]
+
* Gene: [[Tiso_gene_14141]]
* [[DAHPSYN-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
* [[2.5.1.19-RXN]]
+
*** Assignment: EC-NUMBER
* [[RXN-14192]]
+
== Pathways  ==
* [[PEPDEPHOS-RXN]]
+
== Reconstruction information  ==
* [[RXN-14207]]
+
* Category: [[annotation]]
* [[2PGADEHYDRAT-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 138-08-9
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=exostosin_family_protein}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3674425 3674425]
+
{{#set: ec number=EC-2.4.1.17}}
* HMDB : HMDB00263
+
{{#set: gene associated=Tiso_gene_14140|Tiso_gene_14141}}
* LIGAND-CPD:
+
{{#set: in pathway=}}
** [http://www.genome.jp/dbget-bin/www_bget?C00074 C00074]
+
{{#set: reconstruction category=annotation}}
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
** [http://www.chemspider.com/Chemical-Structure.2907208.html 2907208]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58702 58702]
+
* BIGG : pep
+
{{#set: smiles=C=C(OP([O-])([O-])=O)C([O-])=O}}
+
{{#set: inchi key=InChIKey=DTBNBXWJWCWCIK-UHFFFAOYSA-K}}
+
{{#set: common name=phosphoenolpyruvate}}
+
{{#set: molecular weight=165.019    }}
+
{{#set: common name=PEP|2-(phosphonooxy)- 2-propenoate}}
+
{{#set: consumed by=RXN-9988|PEPPIth|KDO-8PSYNTH-RXN|2.7.1.121-RXN|GTPOP}}
+
{{#set: produced by=PEPSYNTH-RXN|PEPCARBOXYKIN-RXN|PEPPIth}}
+
{{#set: reversible reaction associated=RXN-14117|DAHPSYN-RXN|2.5.1.19-RXN|RXN-14192|PEPDEPHOS-RXN|RXN-14207|2PGADEHYDRAT-RXN}}
+

Latest revision as of 21:14, 21 March 2018

Reaction RXN-13607

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • exostosin_family_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 UDP-α-D-glucuronate[c] + 1 mycophenolate[c] => 1 mycophenolic acid O-acyl-glucuronide[c] + 1 UDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links