Difference between revisions of "CPD-7117"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARTOACYLASE-RXN ASPARTOACYLASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** aspartoac...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4))) |
* common name: | * common name: | ||
| − | ** | + | ** delphinidin-3-O-β-D-glucoside |
| − | ** | + | * inchi key: |
| − | * | + | ** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M |
| − | ** | + | * molecular weight: |
| + | ** 463.374 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** delfinidin-3-O-glucoside | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-8228]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * LIPID_MAPS : LMPK12010278 |
| − | ** [http:// | + | * PUBCHEM: |
| − | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515359 102515359] |
| − | ** [http://www. | + | * HMDB : HMDB37997 |
| − | * | + | * CHEBI: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138] | |
| − | {{#set: common name= | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}} |
| − | + | {{#set: common name=delphinidin-3-O-β-D-glucoside}} | |
| − | {{#set: | + | {{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}} |
| − | + | {{#set: molecular weight=463.374 }} | |
| − | {{#set: | + | {{#set: common name=delfinidin-3-O-glucoside}} |
| − | {{#set: | + | {{#set: consumed by=RXN-8228}} |
| − | {{#set: | + | |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-7117
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
- common name:
- delphinidin-3-O-β-D-glucoside
- inchi key:
- InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
- molecular weight:
- 463.374
- Synonym(s):
- delfinidin-3-O-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))" cannot be used as a page name in this wiki.
