Difference between revisions of "CPD1F-96"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFtm METHFtm] == * direction: ** REVERSIBLE * common name: ** 5,10-Methenyltetrahydrofolate upta...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFtm METHFtm] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 
* common name:
 
* common name:
−
** 5,10-Methenyltetrahydrofolate uptake carrier, mitochondria
+
** gibberellin A19
 +
* inchi key:
 +
** InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L
 +
* molecular weight:
 +
** 360.406   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA19
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1F-169]]
−
** 1.0 [[PROTON]][c] '''+''' 1.0 [[5-10-METHENYL-THF]][c] '''<=>''' 1.0 [[5-10-METHENYL-THF]][m] '''+''' 1.0 [[PROTON]][m]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN1F-168]]
−
** 1.0 H+[c] '''+''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] '''<=>''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[m] '''+''' 1.0 H+[m]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19115]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=5,10-Methenyltetrahydrofolate uptake carrier, mitochondria}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200921 25200921]
−
{{#set: gene associated=Tiso_gene_19115}}
+
* HMDB : HMDB36896
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58587 58587]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02034 C02034]
 +
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A19}}
 +
{{#set: inchi key=InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L}}
 +
{{#set: molecular weight=360.406    }}
 +
{{#set: common name=GA19}}
 +
{{#set: consumed by=RXN1F-169}}
 +
{{#set: produced by=RXN1F-168}}

Latest revision as of 21:14, 21 March 2018

Metabolite CPD1F-96

  • smiles:
    • C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • common name:
    • gibberellin A19
  • inchi key:
    • InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L
  • molecular weight:
    • 360.406
  • Synonym(s):
    • GA19

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-96&oldid=47058"