Difference between revisions of "ITP"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1774 == * Synonym(s): == Reactions associated == * Reaction: 3.1.1.47-RXN ** Source: annotation-in-silico_annotation *** Assignmen...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) | ||
+ | * common name: | ||
+ | ** ITP | ||
+ | * inchi key: | ||
+ | ** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J | ||
+ | * molecular weight: | ||
+ | ** 504.137 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** inosine triphosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN0-5073]] |
− | ** | + | * [[ITPP]] |
− | *** | + | * [[ITUP]] |
− | == | + | * [[RXN0-6382]] |
+ | * [[ITCY]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[ATIDm]] | ||
+ | * [[ATID]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14120]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 132-06-9 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439] | ||
+ | * HMDB : HMDB00189 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402] | ||
+ | * BIGG : itp | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
+ | {{#set: common name=ITP}} | ||
+ | {{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}} | ||
+ | {{#set: molecular weight=504.137 }} | ||
+ | {{#set: common name=inosine triphosphate}} | ||
+ | {{#set: consumed by=RXN0-5073|ITPP|ITUP|RXN0-6382|ITCY}} | ||
+ | {{#set: produced by=ATIDm|ATID}} | ||
+ | {{#set: reversible reaction associated=RXN-14120}} |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite ITP
- smiles:
- C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- common name:
- ITP
- inchi key:
- InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
- molecular weight:
- 504.137
- Synonym(s):
- inosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.