Difference between revisions of "RXN-15090"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] == * smiles: ** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15090 RXN-15090] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-monoacylglycerol acyltran...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15090 RXN-15090] ==
* smiles:
+
* direction:
** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
+
 
* common name:
 
* common name:
** oleanolate
+
** 2-monoacylglycerol acyltransferase
* molecular weight:
+
* ec number:
** 455.699   
+
** [http://enzyme.expasy.org/EC/2.3.1.22 EC-2.3.1.22]
 
* Synonym(s):
 
* Synonym(s):
** oleanolic acid
 
** oleanic acid
 
** caryophyllin
 
** 3-beta-Hydroxyolean-12-en-28-oic acid
 
** oleonolic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9000]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[OLEOYL-COA]][c] '''+''' 1 [[CPD0-1812]][c] '''=>''' 1 [[CPD-15977]][c] '''+''' 1 [[CO-A]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oleoyl-CoA[c] '''+''' 1 2-oleoylglycerol[c] '''=>''' 1 1,2-dioleoylglycerol[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7420]], monoacylglycerol metabolism (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7420 PWY-7420]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11865404 11865404]
+
{{#set: common name=2-monoacylglycerol acyltransferase}}
* CHEMSPIDER:
+
{{#set: ec number=EC-2.3.1.22}}
** [http://www.chemspider.com/Chemical-Structure.10039737.html 10039737]
+
{{#set: in pathway=PWY-7420}}
* CHEBI:
+
{{#set: reconstruction category=annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=82828 82828]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
* METABOLIGHTS : MTBLC37659
+
{{#set: reconstruction tool=pathwaytools}}
* HMDB : HMDB02364
+
{{#set: smiles=CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C}}
+
{{#set: inchi key=InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M}}
+
{{#set: common name=oleanolate}}
+
{{#set: molecular weight=455.699    }}
+
{{#set: common name=oleanolic acid|oleanic acid|caryophyllin|3-beta-Hydroxyolean-12-en-28-oic acid|oleonolic acid}}
+
{{#set: consumed by=RXN-9000}}
+

Latest revision as of 21:14, 21 March 2018

Reaction RXN-15090

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 2-monoacylglycerol acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 oleoyl-CoA[c] + 1 2-oleoylglycerol[c] => 1 1,2-dioleoylglycerol[c] + 1 coenzyme A[c]

Genes associated with this reaction

Pathways

  • PWY-7420, monoacylglycerol metabolism (yeast): PWY-7420
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links