Difference between revisions of "Tiso gene 15060"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_15060 == * right end position: ** 4815 * transcription direction: ** POSITIVE * left end position: ** 305 * centisome position: ** 5.798479...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15060 == |
− | * | + | * right end position: |
− | ** | + | ** 4815 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 305 |
− | * | + | * centisome position: |
− | ** | + | ** 5.798479 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[2.7.11.24-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4815}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=305}} | |
− | + | {{#set: centisome position=5.798479 }} | |
− | + | {{#set: reaction associated=2.7.11.24-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_15060
- right end position:
- 4815
- transcription direction:
- POSITIVE
- left end position:
- 305
- centisome position:
- 5.798479
- Synonym(s):
Reactions associated
- Reaction: 2.7.11.24-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation