Difference between revisions of "2.3.1.43-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.43-RXN 2.3.1.43-RXN] == * direction: ** REVERSIBLE * common name: ** phosphatidylcholine-ster...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.43-RXN 2.3.1.43-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phosphatidylcholine-sterol_o-acyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.43 EC-2.3.1.43] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Sterols]][c] '''+''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''<=>''' 1 [[2-Lysophosphatidylcholines]][c] '''+''' 1 [[Steryl-Esters]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a sterol[c] '''+''' 1 a phosphatidylcholine[c] '''<=>''' 1 a 1-acyl-sn-glycero-3-phosphocholine[c] '''+''' 1 a steryl-ester[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9096]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_16209]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02114 R02114] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P30930 P30930] |
− | * | + | ** [http://www.uniprot.org/uniprot/P10480 P10480] |
− | * | + | ** [http://www.uniprot.org/uniprot/P04180 P04180] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P16301 P16301] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P18424 P18424] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: common name=phosphatidylcholine-sterol_o-acyltransferase}} |
− | {{#set: | + | {{#set: ec number=EC-2.3.1.43}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_9096|Tiso_gene_16209}} |
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:14, 21 March 2018
Contents
Reaction 2.3.1.43-RXN
- direction:
- REVERSIBLE
- common name:
- phosphatidylcholine-sterol_o-acyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Sterols[c] + 1 PHOSPHATIDYLCHOLINE[c] <=> 1 2-Lysophosphatidylcholines[c] + 1 Steryl-Esters[c]
- With common name(s):
- 1 a sterol[c] + 1 a phosphatidylcholine[c] <=> 1 a 1-acyl-sn-glycero-3-phosphocholine[c] + 1 a steryl-ester[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9096
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16209
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links