Difference between revisions of "Tiso gene 10094"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == * smiles: ** [CH](C(C(COP([O-])([O-])=O)O)O)=O * common name: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_10094 == * right end position: ** 3101 * transcription direction: ** POSITIVE * left end position: ** 1299 * centisome position: ** 14.7212...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10094 == |
− | * | + | * right end position: |
− | ** | + | ** 3101 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1299 |
− | * | + | * centisome position: |
− | ** | + | ** 14.721214 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.14.13.8-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[RXN66-81]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
+ | == Pathways associated == | ||
+ | * [[PWY66-201]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3101}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1299}} | |
− | + | {{#set: centisome position=14.721214 }} | |
− | + | {{#set: reaction associated=1.14.13.8-RXN|RXN66-81}} | |
− | + | {{#set: pathway associated=PWY66-201}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_10094
- right end position:
- 3101
- transcription direction:
- POSITIVE
- left end position:
- 1299
- centisome position:
- 14.721214
- Synonym(s):
Reactions associated
- Reaction: 1.14.13.8-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN66-81
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation